Initial commit: OCA Technical packages (595 packages)

odoo-bringout-oca-queue-queue_job/README.md

@@ -0,0 +1,48 @@
+# Job Queue
+
+Odoo addon: queue_job
+
+## Installation
+
+```bash
+pip install odoo-bringout-oca-queue-queue_job
+```
+
+## Dependencies
+
+This addon depends on:
+- mail
+- base_sparse_field
+- web
+
+## Manifest Information
+
+- **Name**: Job Queue
+- **Version**: 16.0.2.11.4
+- **Category**: Generic Modules
+- **License**: LGPL-3
+- **Installable**: True
+
+## Source
+
+Based on [OCA/queue](https://github.com/OCA/queue) branch 16.0, addon `queue_job`.
+
+## License
+
+This package maintains the original LGPL-3 license from the upstream Odoo project.
+
+## Documentation
+
+- Overview: doc/OVERVIEW.md
+- Architecture: doc/ARCHITECTURE.md
+- Models: doc/MODELS.md
+- Controllers: doc/CONTROLLERS.md
+- Wizards: doc/WIZARDS.md
+- Reports: doc/REPORTS.md
+- Security: doc/SECURITY.md
+- Install: doc/INSTALL.md
+- Usage: doc/USAGE.md
+- Configuration: doc/CONFIGURATION.md
+- Dependencies: doc/DEPENDENCIES.md
+- Troubleshooting: doc/TROUBLESHOOTING.md
+- FAQ: doc/FAQ.md

odoo-bringout-oca-queue-queue_job/doc/ARCHITECTURE.md

@@ -0,0 +1,32 @@
+# Architecture
+
+```mermaid
+flowchart TD
+    U[Users] -->|HTTP| V[Views and QWeb Templates]
+    V --> C[Controllers]
+    V --> W[Wizards – Transient Models]
+    C --> M[Models and ORM]
+    W --> M
+    M --> R[Reports]
+    DX[Data XML] --> M
+    S[Security – ACLs and Groups] -. enforces .-> M
+
+    subgraph Queue_job Module - queue_job
+      direction LR
+      M:::layer
+      W:::layer
+      C:::layer
+      V:::layer
+      R:::layer
+      S:::layer
+      DX:::layer
+    end
+
+    classDef layer fill:#eef8ff,stroke:#6ea8fe,stroke-width:1px
+```
+
+Notes
+- Views include tree/form/kanban templates and report templates.
+- Controllers provide website/portal routes when present.
+- Wizards are UI flows implemented with `models.TransientModel`.
+- Data XML loads data/demo records; Security defines groups and access.

odoo-bringout-oca-queue-queue_job/doc/CONFIGURATION.md

@@ -0,0 +1,3 @@
+# Configuration
+
+Refer to Odoo settings for queue_job. Configure related models, access rights, and options as needed.

odoo-bringout-oca-queue-queue_job/doc/CONTROLLERS.md

@@ -0,0 +1,17 @@
+# Controllers
+
+HTTP routes provided by this module.
+
+```mermaid
+sequenceDiagram
+    participant U as User/Client
+    participant C as Module Controllers
+    participant O as ORM/Views
+
+    U->>C: HTTP GET/POST (routes)
+    C->>O: ORM operations, render templates
+    O-->>U: HTML/JSON/PDF
+```
+
+Notes
+- See files in controllers/ for route definitions.

odoo-bringout-oca-queue-queue_job/doc/DEPENDENCIES.md

@@ -0,0 +1,7 @@
+# Dependencies
+
+This addon depends on:
+
+- [mail](../../odoo-bringout-oca-ocb-mail)
+- [base_sparse_field](../../odoo-bringout-oca-ocb-base_sparse_field)
+- [web](../../odoo-bringout-oca-ocb-web)

odoo-bringout-oca-queue-queue_job/doc/FAQ.md

@@ -0,0 +1,4 @@
+# FAQ
+
+- Q: Which Odoo version? A: 16.0 (OCA/OCB packaged).
+- Q: How to enable? A: Start server with --addon queue_job or install in UI.

odoo-bringout-oca-queue-queue_job/doc/INSTALL.md

@@ -0,0 +1,7 @@
+# Install
+
+```bash
+pip install odoo-bringout-oca-queue-queue_job"
+# or
+uv pip install odoo-bringout-oca-queue-queue_job"
+```

odoo-bringout-oca-queue-queue_job/doc/MODELS.md

@@ -0,0 +1,17 @@
+# Models
+
+Detected core models and extensions in queue_job.
+
+```mermaid
+classDiagram
+    class queue_job
+    class queue_job_channel
+    class queue_job_function
+    class queue_job_lock
+    class base
+    class ir_model_fields
+```
+
+Notes
+- Classes show model technical names; fields omitted for brevity.
+- Items listed under _inherit are extensions of existing models.

odoo-bringout-oca-queue-queue_job/doc/OVERVIEW.md

@@ -0,0 +1,6 @@
+# Overview
+
+Packaged Odoo addon: queue_job. Provides features documented in upstream Odoo 16 under this addon.
+
+- Source: OCA/OCB 16.0, addon queue_job
+- License: LGPL-3

odoo-bringout-oca-queue-queue_job/doc/REPORTS.md

@@ -0,0 +1,3 @@
+# Reports
+
+This module does not define custom reports.

odoo-bringout-oca-queue-queue_job/doc/SECURITY.md

@@ -0,0 +1,42 @@
+# Security
+
+Access control and security definitions in queue_job.
+
+## Access Control Lists (ACLs)
+
+Model access permissions defined in:
+- **[ir.model.access.csv](../queue_job/security/ir.model.access.csv)**
+  - 7 model access rules
+
+## Record Rules
+
+Row-level security rules defined in:
+
+## Security Groups & Configuration
+
+Security groups and permissions defined in:
+- **[security.xml](../queue_job/security/security.xml)**
+  - 1 security groups defined
+
+```mermaid
+graph TB
+    subgraph "Security Layers"
+        A[Users] --> B[Groups]
+        B --> C[Access Control Lists]
+        C --> D[Models]
+        B --> E[Record Rules]
+        E --> F[Individual Records]
+    end
+```
+
+Security files overview:
+- **[ir.model.access.csv](../queue_job/security/ir.model.access.csv)**
+  - Model access permissions (CRUD rights)
+- **[security.xml](../queue_job/security/security.xml)**
+  - Security groups, categories, and XML-based rules
+
+Notes
+- Access Control Lists define which groups can access which models
+- Record Rules provide row-level security (filter records by user/group)
+- Security groups organize users and define permission sets
+- All security is enforced at the ORM level by Odoo

odoo-bringout-oca-queue-queue_job/doc/TROUBLESHOOTING.md

@@ -0,0 +1,5 @@
+# Troubleshooting
+
+- Ensure Python and Odoo environment matches repo guidance.
+- Check database connectivity and logs if startup fails.
+- Validate that dependent addons listed in DEPENDENCIES.md are installed.

odoo-bringout-oca-queue-queue_job/doc/USAGE.md

@@ -0,0 +1,7 @@
+# Usage
+
+Start Odoo including this addon (from repo root):
+
+```bash
+python3 scripts/nix_odoo_web_server.py --db-name mydb --addon queue_job
+```

odoo-bringout-oca-queue-queue_job/doc/WIZARDS.md

@@ -0,0 +1,3 @@
+# Wizards
+
+This module does not include UI wizards.

odoo-bringout-oca-queue-queue_job/pyproject.toml

@@ -0,0 +1,44 @@
+[project]
+name = "odoo-bringout-oca-queue-queue_job"
+version = "16.0.0"
+description = "Job Queue - Odoo addon"
+authors = [
+    { name = "Ernad Husremovic", email = "hernad@bring.out.ba" }
+]
+dependencies = [
+    "odoo-bringout-oca-ocb-mail>=16.0.0",
+    "odoo-bringout-oca-queue-base_sparse_field>=16.0.0",
+    "odoo-bringout-oca-ocb-web>=16.0.0",
+    "requests>=2.25.1"
+]
+readme = "README.md"
+requires-python = ">= 3.11"
+classifiers = [
+    "Development Status :: 5 - Production/Stable",
+    "Intended Audience :: Developers",
+    "License :: OSI Approved :: GNU Lesser General Public License v3 (LGPLv3)",
+    "Programming Language :: Python :: 3",
+    "Programming Language :: Python :: 3.11", 
+    "Programming Language :: Python :: 3.12",
+    "Topic :: Office/Business",
+]
+
+[project.urls]
+homepage = "https://github.com/bringout/0"
+repository = "https://github.com/bringout/0"
+
+[build-system]
+requires = ["hatchling"]
+build-backend = "hatchling.build"
+
+[tool.hatch.metadata]
+allow-direct-references = true
+
+[tool.hatch.build.targets.wheel]
+packages = ["queue_job"]
+
+[tool.rye]
+managed = true
+dev-dependencies = [
+    "pytest>=8.4.1",
+]

odoo-bringout-oca-queue-queue_job/queue_job/README.rst

@@ -0,0 +1,707 @@
+.. image:: https://odoo-community.org/readme-banner-image
+   :target: https://odoo-community.org/get-involved?utm_source=readme
+   :alt: Odoo Community Association
+
+=========
+Job Queue
+=========
+
+.. 
+   !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+   !! This file is generated by oca-gen-addon-readme !!
+   !! changes will be overwritten.                   !!
+   !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+   !! source digest: sha256:7cc71c9aa5e6aec02e31b34ff1df8b45615787be688cbb13ac7714243400d7f8
+   !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+
+.. |badge1| image:: https://img.shields.io/badge/maturity-Mature-brightgreen.png
+    :target: https://odoo-community.org/page/development-status
+    :alt: Mature
+.. |badge2| image:: https://img.shields.io/badge/license-LGPL--3-blue.png
+    :target: http://www.gnu.org/licenses/lgpl-3.0-standalone.html
+    :alt: License: LGPL-3
+.. |badge3| image:: https://img.shields.io/badge/github-OCA%2Fqueue-lightgray.png?logo=github
+    :target: https://github.com/OCA/queue/tree/16.0/queue_job
+    :alt: OCA/queue
+.. |badge4| image:: https://img.shields.io/badge/weblate-Translate%20me-F47D42.png
+    :target: https://translation.odoo-community.org/projects/queue-16-0/queue-16-0-queue_job
+    :alt: Translate me on Weblate
+.. |badge5| image:: https://img.shields.io/badge/runboat-Try%20me-875A7B.png
+    :target: https://runboat.odoo-community.org/builds?repo=OCA/queue&target_branch=16.0
+    :alt: Try me on Runboat
+
+|badge1| |badge2| |badge3| |badge4| |badge5|
+
+This addon adds an integrated Job Queue to Odoo.
+
+It allows to postpone method calls executed asynchronously.
+
+Jobs are executed in the background by a ``Jobrunner``, in their own transaction.
+
+Example:
+
+.. code-block:: python
+
+  from odoo import models, fields, api
+
+  class MyModel(models.Model):
+     _name = 'my.model'
+
+     def my_method(self, a, k=None):
+         _logger.info('executed with a: %s and k: %s', a, k)
+
+
+  class MyOtherModel(models.Model):
+      _name = 'my.other.model'
+
+      def button_do_stuff(self):
+          self.env['my.model'].with_delay().my_method('a', k=2)
+
+
+In the snippet of code above, when we call ``button_do_stuff``, a job **capturing
+the method and arguments** will be postponed.  It will be executed as soon as the
+Jobrunner has a free bucket, which can be instantaneous if no other job is
+running.
+
+
+Features:
+
+* Views for jobs, jobs are stored in PostgreSQL
+* Jobrunner: execute the jobs, highly efficient thanks to PostgreSQL's NOTIFY
+* Channels: give a capacity for the root channel and its sub-channels and
+  segregate jobs in them. Allow for instance to restrict heavy jobs to be
+  executed one at a time while little ones are executed 4 at a times.
+* Retries: Ability to retry jobs by raising a type of exception
+* Retry Pattern: the 3 first tries, retry after 10 seconds, the 5 next tries,
+  retry after 1 minutes, ...
+* Job properties: priorities, estimated time of arrival (ETA), custom
+  description, number of retries
+* Related Actions: link an action on the job view, such as open the record
+  concerned by the job
+
+**Table of contents**
+
+.. contents::
+   :local:
+
+Installation
+============
+
+Be sure to have the ``requests`` library.
+
+Configuration
+=============
+
+* Using environment variables and command line:
+
+  * Adjust environment variables (optional):
+
+    - ``ODOO_QUEUE_JOB_CHANNELS=root:4`` or any other channels configuration.
+      The default is ``root:1``
+
+    - if ``xmlrpc_port`` is not set: ``ODOO_QUEUE_JOB_PORT=8069``
+
+  * Start Odoo with ``--load=web,queue_job``
+    and ``--workers`` greater than 1. [1]_
+
+* Keep in mind that the number of workers should be greater than the number of
+  channels. ``queue_job`` will reuse normal Odoo workers to process jobs. It
+  will not spawn its own workers.
+
+* Using the Odoo configuration file:
+
+.. code-block:: ini
+
+  [options]
+  (...)
+  workers = 6
+  server_wide_modules = web,queue_job
+
+  (...)
+  [queue_job]
+  channels = root:2
+
+* Environment variables have priority over the configuration file.
+
+* Confirm the runner is starting correctly by checking the odoo log file:
+
+.. code-block::
+
+  ...INFO...queue_job.jobrunner.runner: starting
+  ...INFO...queue_job.jobrunner.runner: initializing database connections
+  ...INFO...queue_job.jobrunner.runner: queue job runner ready for db <dbname>
+  ...INFO...queue_job.jobrunner.runner: database connections ready
+
+* Create jobs (eg using ``base_import_async``) and observe they
+  start immediately and in parallel.
+
+* Tip: to enable debug logging for the queue job, use
+  ``--log-handler=odoo.addons.queue_job:DEBUG``
+
+.. [1] It works with the threaded Odoo server too, although this way
+       of running Odoo is obviously not for production purposes.
+
+* Jobs that remain in `enqueued` or `started` state (because, for instance, their worker has been killed) will be automatically re-queued.
+
+Usage
+=====
+
+To use this module, you need to:
+
+#. Go to ``Job Queue`` menu
+
+Developers
+~~~~~~~~~~
+
+Delaying jobs
+-------------
+
+The fast way to enqueue a job for a method is to use ``with_delay()`` on a record
+or model:
+
+
+.. code-block:: python
+
+   def button_done(self):
+       self.with_delay().print_confirmation_document(self.state)
+       self.write({"state": "done"})
+       return True
+
+Here, the method ``print_confirmation_document()`` will be executed asynchronously
+as a job. ``with_delay()`` can take several parameters to define more precisely how
+the job is executed (priority, ...).
+
+All the arguments passed to the method being delayed are stored in the job and
+passed to the method when it is executed asynchronously, including ``self``, so
+the current record is maintained during the job execution (warning: the context
+is not kept).
+
+Dependencies can be expressed between jobs. To start a graph of jobs, use ``delayable()``
+on a record or model. The following is the equivalent of ``with_delay()`` but using the
+long form:
+
+.. code-block:: python
+
+   def button_done(self):
+       delayable = self.delayable()
+       delayable.print_confirmation_document(self.state)
+       delayable.delay()
+       self.write({"state": "done"})
+       return True
+
+Methods of Delayable objects return itself, so it can be used as a builder pattern,
+which in some cases allow to build the jobs dynamically:
+
+.. code-block:: python
+
+    def button_generate_simple_with_delayable(self):
+        self.ensure_one()
+        # Introduction of a delayable object, using a builder pattern
+        # allowing to chain jobs or set properties. The delay() method
+        # on the delayable object actually stores the delayable objects
+        # in the queue_job table
+        (
+            self.delayable()
+            .generate_thumbnail((50, 50))
+            .set(priority=30)
+            .set(description=_("generate xxx"))
+            .delay()
+        )
+
+The simplest way to define a dependency is to use ``.on_done(job)`` on a Delayable:
+
+.. code-block:: python
+
+    def button_chain_done(self):
+        self.ensure_one()
+        job1 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        job2 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        job3 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        # job 3 is executed when job 2 is done which is executed when job 1 is done
+        job1.on_done(job2.on_done(job3)).delay()
+
+Delayables can be chained to form more complex graphs using the ``chain()`` and
+``group()`` primitives.
+A chain represents a sequence of jobs to execute in order, a group represents
+jobs which can be executed in parallel. Using ``chain()`` has the same effect as
+using several nested ``on_done()`` but is more readable. Both can be combined to
+form a graph, for instance we can group [A] of jobs, which blocks another group
+[B] of jobs. When and only when all the jobs of the group [A] are executed, the
+jobs of the group [B] are executed. The code would look like:
+
+.. code-block:: python
+
+   from odoo.addons.queue_job.delay import group, chain
+
+   def button_done(self):
+       group_a = group(self.delayable().method_foo(), self.delayable().method_bar())
+       group_b = group(self.delayable().method_baz(1), self.delayable().method_baz(2))
+       chain(group_a, group_b).delay()
+       self.write({"state": "done"})
+       return True
+
+When a failure happens in a graph of jobs, the execution of the jobs that depend on the
+failed job stops. They remain in a state ``wait_dependencies`` until their "parent" job is
+successful. This can happen in two ways: either the parent job retries and is successful
+on a second try, either the parent job is manually "set to done" by a user. In these two
+cases, the dependency is resolved and the graph will continue to be processed. Alternatively,
+the failed job and all its dependent jobs can be canceled by a user. The other jobs of the
+graph that do not depend on the failed job continue their execution in any case.
+
+Note: ``delay()`` must be called on the delayable, chain, or group which is at the top
+of the graph. In the example above, if it was called on ``group_a``, then ``group_b``
+would never be delayed (but a warning would be shown).
+
+It is also possible to split a job into several jobs, each one processing a part of the
+work. This can be useful to avoid very long jobs, parallelize some task and get more specific 
+errors. Usage is as follows:
+
+.. code-block:: python
+
+    def button_split_delayable(self):
+        (
+            self  # Can be a big recordset, let's say 1000 records
+            .delayable()
+            .generate_thumbnail((50, 50))
+            .set(priority=30)
+            .set(description=_("generate xxx"))
+            .split(50)  # Split the job in 20 jobs of 50 records each
+            .delay()
+        )
+
+The ``split()`` method takes a ``chain`` boolean keyword argument. If set to
+True, the jobs will be chained, meaning that the next job will only start when the previous
+one is done:
+
+.. code-block:: python
+
+    def button_increment_var(self):
+        (
+            self
+            .delayable()
+            .increment_counter()
+            .split(1, chain=True) # Will exceute the jobs one after the other
+            .delay()
+        )
+
+
+Enqueing Job Options
+--------------------
+
+* priority: default is 10, the closest it is to 0, the faster it will be
+  executed
+* eta: Estimated Time of Arrival of the job. It will not be executed before this
+  date/time
+* max_retries: default is 5, maximum number of retries before giving up and set
+  the job state to 'failed'. A value of 0 means infinite retries.
+* description: human description of the job. If not set, description is computed
+  from the function doc or method name
+* channel: the complete name of the channel to use to process the function. If
+  specified it overrides the one defined on the function
+* identity_key: key uniquely identifying the job, if specified and a job with
+  the same key has not yet been run, the new job will not be created
+
+Configure default options for jobs
+----------------------------------
+
+In earlier versions, jobs could be configured using the ``@job`` decorator.
+This is now obsolete, they can be configured using optional ``queue.job.function``
+and ``queue.job.channel`` XML records.
+
+Example of channel:
+
+.. code-block:: XML
+
+    <record id="channel_sale" model="queue.job.channel">
+        <field name="name">sale</field>
+        <field name="parent_id" ref="queue_job.channel_root" />
+    </record>
+
+Example of job function:
+
+.. code-block:: XML
+
+    <record id="job_function_sale_order_action_done" model="queue.job.function">
+        <field name="model_id" ref="sale.model_sale_order" />
+        <field name="method">action_done</field>
+        <field name="channel_id" ref="channel_sale" />
+        <field name="related_action" eval='{"func_name": "custom_related_action"}' />
+        <field name="retry_pattern" eval="{1: 60, 2: 180, 3: 10, 5: 300}" />
+    </record>
+
+The general form for the ``name`` is: ``<model.name>.method``.
+
+The channel, related action and retry pattern options are optional, they are
+documented below.
+
+When writing modules, if 2+ modules add a job function or channel with the same
+name (and parent for channels), they'll be merged in the same record, even if
+they have different xmlids. On uninstall, the merged record is deleted when all
+the modules using it are uninstalled.
+
+
+**Job function: model**
+
+If the function is defined in an abstract model, you can not write
+``<field name="model_id" ref="xml_id_of_the_abstract_model"</field>``
+but you have to define a function for each model that inherits from the abstract model.
+
+
+**Job function: channel**
+
+The channel where the job will be delayed. The default channel is ``root``.
+
+**Job function: related action**
+
+The *Related Action* appears as a button on the Job's view.
+The button will execute the defined action.
+
+The default one is to open the view of the record related to the job (form view
+when there is a single record, list view for several records).
+In many cases, the default related action is enough and doesn't need
+customization, but it can be customized by providing a dictionary on the job
+function:
+
+.. code-block:: python
+
+   {
+       "enable": False,
+       "func_name": "related_action_partner",
+       "kwargs": {"name": "Partner"},
+   }
+
+* ``enable``: when ``False``, the button has no effect (default: ``True``)
+* ``func_name``: name of the method on ``queue.job`` that returns an action
+* ``kwargs``: extra arguments to pass to the related action method
+
+Example of related action code:
+
+.. code-block:: python
+
+    class QueueJob(models.Model):
+        _inherit = 'queue.job'
+
+        def related_action_partner(self, name):
+            self.ensure_one()
+            model = self.model_name
+            partner = self.records
+            action = {
+                'name': name,
+                'type': 'ir.actions.act_window',
+                'res_model': model,
+                'view_type': 'form',
+                'view_mode': 'form',
+                'res_id': partner.id,
+            }
+            return action
+
+
+**Job function: retry pattern**
+
+When a job fails with a retryable error type, it is automatically
+retried later. By default, the retry is always 10 minutes later.
+
+A retry pattern can be configured on the job function. What a pattern represents
+is "from X tries, postpone to Y seconds". It is expressed as a dictionary where
+keys are tries and values are seconds to postpone as integers:
+
+
+.. code-block:: python
+
+   {
+       1: 10,
+       5: 20,
+       10: 30,
+       15: 300,
+   }
+
+Based on this configuration, we can tell that:
+
+* 5 first retries are postponed 10 seconds later
+* retries 5 to 10 postponed 20 seconds later
+* retries 10 to 15 postponed 30 seconds later
+* all subsequent retries postponed 5 minutes later
+
+**Job Context**
+
+The context of the recordset of the job, or any recordset passed in arguments of
+a job, is transferred to the job according to an allow-list.
+
+The default allow-list is `("tz", "lang", "allowed_company_ids", "force_company", "active_test")`. It can
+be customized in ``Base._job_prepare_context_before_enqueue_keys``.
+**Bypass jobs on running Odoo**
+
+When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.
+
+To do so you can set `QUEUE_JOB__NO_DELAY=1` in your environment.
+
+**Bypass jobs in tests**
+
+When writing tests on job-related methods is always tricky to deal with
+delayed recordsets. To make your testing life easier
+you can set `queue_job__no_delay=True` in the context.
+
+Tip: you can do this at test case level like this
+
+.. code-block:: python
+
+    @classmethod
+    def setUpClass(cls):
+        super().setUpClass()
+        cls.env = cls.env(context=dict(
+            cls.env.context,
+            queue_job__no_delay=True,  # no jobs thanks
+        ))
+
+Then all your tests execute the job methods synchronously
+without delaying any jobs.
+
+Testing
+-------
+
+**Asserting enqueued jobs**
+
+The recommended way to test jobs, rather than running them directly and synchronously is to
+split the tests in two parts:
+
+ * one test where the job is mocked (trap jobs with ``trap_jobs()`` and the test
+   only verifies that the job has been delayed with the expected arguments
+ * one test that only calls the method of the job synchronously, to validate the
+   proper behavior of this method only
+
+Proceeding this way means that you can prove that jobs will be enqueued properly
+at runtime, and it ensures your code does not have a different behavior in tests
+and in production (because running your jobs synchronously may have a different
+behavior as they are in the same transaction / in the middle of the method).
+Additionally, it gives more control on the arguments you want to pass when
+calling the job's method (synchronously, this time, in the second type of
+tests), and it makes tests smaller.
+
+The best way to run such assertions on the enqueued jobs is to use
+``odoo.addons.queue_job.tests.common.trap_jobs()``.
+
+Inside this context manager, instead of being added in the database's queue,
+jobs are pushed in an in-memory list. The context manager then provides useful
+helpers to verify that jobs have been enqueued with the expected arguments. It
+even can run the jobs of its list synchronously! Details in
+``odoo.addons.queue_job.tests.common.JobsTester``.
+
+A very small example (more details in ``tests/common.py``):
+
+.. code-block:: python
+
+    # code
+    def my_job_method(self, name, count):
+        self.write({"name": " ".join([name] * count)
+
+    def method_to_test(self):
+        count = self.env["other.model"].search_count([])
+        self.with_delay(priority=15).my_job_method("Hi!", count=count)
+        return count
+
+    # tests
+    from odoo.addons.queue_job.tests.common import trap_jobs
+
+    # first test only check the expected behavior of the method and the proper
+    # enqueuing of jobs
+    def test_method_to_test(self):
+        with trap_jobs() as trap:
+            result = self.env["model"].method_to_test()
+            expected_count = 12
+
+            trap.assert_jobs_count(1, only=self.env["model"].my_job_method)
+            trap.assert_enqueued_job(
+                self.env["model"].my_job_method,
+                args=("Hi!",),
+                kwargs=dict(count=expected_count),
+                properties=dict(priority=15)
+            )
+            self.assertEqual(result, expected_count)
+
+
+     # second test to validate the behavior of the job unitarily
+     def test_my_job_method(self):
+         record = self.env["model"].browse(1)
+         record.my_job_method("Hi!", count=12)
+         self.assertEqual(record.name, "Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!")
+
+If you prefer, you can still test the whole thing in a single test, by calling
+``jobs_tester.perform_enqueued_jobs()`` in your test.
+
+.. code-block:: python
+
+    def test_method_to_test(self):
+        with trap_jobs() as trap:
+            result = self.env["model"].method_to_test()
+            expected_count = 12
+
+            trap.assert_jobs_count(1, only=self.env["model"].my_job_method)
+            trap.assert_enqueued_job(
+                self.env["model"].my_job_method,
+                args=("Hi!",),
+                kwargs=dict(count=expected_count),
+                properties=dict(priority=15)
+            )
+            self.assertEqual(result, expected_count)
+
+            trap.perform_enqueued_jobs()
+
+            record = self.env["model"].browse(1)
+            record.my_job_method("Hi!", count=12)
+            self.assertEqual(record.name, "Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!")
+
+**Execute jobs synchronously when running Odoo**
+
+When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.
+
+To do so you can set ``QUEUE_JOB__NO_DELAY=1`` in your environment.
+
+.. WARNING:: Do not do this in production
+
+**Execute jobs synchronously in tests**
+
+You should use ``trap_jobs``, really, but if for any reason you could not use it,
+and still need to have job methods executed synchronously in your tests, you can
+do so by setting ``queue_job__no_delay=True`` in the context.
+
+Tip: you can do this at test case level like this
+
+.. code-block:: python
+
+    @classmethod
+    def setUpClass(cls):
+        super().setUpClass()
+        cls.env = cls.env(context=dict(
+            cls.env.context,
+            queue_job__no_delay=True,  # no jobs thanks
+        ))
+
+Then all your tests execute the job methods synchronously without delaying any
+jobs.
+
+In tests you'll have to mute the logger like:
+
+    @mute_logger('odoo.addons.queue_job.models.base')
+
+.. NOTE:: in graphs of jobs, the ``queue_job__no_delay`` context key must be in at
+          least one job's env of the graph for the whole graph to be executed synchronously
+
+
+Tips and tricks
+---------------
+
+* **Idempotency** (https://www.restapitutorial.com/lessons/idempotency.html): The queue_job should be idempotent so they can be retried several times without impact on the data.
+* **The job should test at the very beginning its relevance**: the moment the job will be executed is unknown by design. So the first task of a job should be to check if the related work is still relevant at the moment of the execution.
+
+Patterns
+--------
+Through the time, two main patterns emerged:
+
+1. For data exposed to users, a model should store the data and the model should be the creator of the job. The job is kept hidden from the users
+2. For technical data, that are not exposed to the users, it is generally alright to create directly jobs with data passed as arguments to the job, without intermediary models.
+
+Known issues / Roadmap
+======================
+
+* After creating a new database or installing ``queue_job`` on an
+  existing database, Odoo must be restarted for the runner to detect it.
+
+* When Odoo shuts down normally, it waits for running jobs to finish.
+  However, when the Odoo server crashes or is otherwise force-stopped,
+  running jobs are interrupted while the runner has no chance to know
+  they have been aborted. In such situations, jobs may remain in
+  ``started`` or ``enqueued`` state after the Odoo server is halted.
+  Since the runner has no way to know if they are actually running or
+  not, and does not know for sure if it is safe to restart the jobs,
+  it does not attempt to restart them automatically. Such stale jobs
+  therefore fill the running queue and prevent other jobs to start.
+  You must therefore requeue them manually, either from the Jobs view,
+  or by running the following SQL statement *before starting Odoo*:
+
+.. code-block:: sql
+
+  update queue_job set state='pending' where state in ('started', 'enqueued')
+
+Changelog
+=========
+
+.. [ The change log. The goal of this file is to help readers
+    understand changes between version. The primary audience is
+    end users and integrators. Purely technical changes such as
+    code refactoring must not be mentioned here.
+
+    This file may contain ONE level of section titles, underlined
+    with the ~ (tilde) character. Other section markers are
+    forbidden and will likely break the structure of the README.rst
+    or other documents where this fragment is included. ]
+
+Next
+~~~~
+
+* [ADD] Run jobrunner as a worker process instead of a thread in the main
+  process (when running with --workers > 0)
+* [REF] ``@job`` and ``@related_action`` deprecated, any method can be delayed,
+  and configured using ``queue.job.function`` records
+* [MIGRATION] from 13.0 branched at rev. e24ff4b
+
+Bug Tracker
+===========
+
+Bugs are tracked on `GitHub Issues <https://github.com/OCA/queue/issues>`_.
+In case of trouble, please check there if your issue has already been reported.
+If you spotted it first, help us to smash it by providing a detailed and welcomed
+`feedback <https://github.com/OCA/queue/issues/new?body=module:%20queue_job%0Aversion:%2016.0%0A%0A**Steps%20to%20reproduce**%0A-%20...%0A%0A**Current%20behavior**%0A%0A**Expected%20behavior**>`_.
+
+Do not contact contributors directly about support or help with technical issues.
+
+Credits
+=======
+
+Authors
+~~~~~~~
+
+* Camptocamp
+* ACSONE SA/NV
+
+Contributors
+~~~~~~~~~~~~
+
+* Guewen Baconnier <guewen.baconnier@camptocamp.com>
+* Stéphane Bidoul <stephane.bidoul@acsone.eu>
+* Matthieu Dietrich <matthieu.dietrich@camptocamp.com>
+* Jos De Graeve <Jos.DeGraeve@apertoso.be>
+* David Lefever <dl@taktik.be>
+* Laurent Mignon <laurent.mignon@acsone.eu>
+* Laetitia Gangloff <laetitia.gangloff@acsone.eu>
+* Cédric Pigeon <cedric.pigeon@acsone.eu>
+* Tatiana Deribina <tatiana.deribina@avoin.systems>
+* Souheil Bejaoui <souheil.bejaoui@acsone.eu>
+* Eric Antones <eantones@nuobit.com>
+* Simone Orsi <simone.orsi@camptocamp.com>
+
+Maintainers
+~~~~~~~~~~~
+
+This module is maintained by the OCA.
+
+.. image:: https://odoo-community.org/logo.png
+   :alt: Odoo Community Association
+   :target: https://odoo-community.org
+
+OCA, or the Odoo Community Association, is a nonprofit organization whose
+mission is to support the collaborative development of Odoo features and
+promote its widespread use.
+
+.. |maintainer-guewen| image:: https://github.com/guewen.png?size=40px
+    :target: https://github.com/guewen
+    :alt: guewen
+
+Current `maintainer <https://odoo-community.org/page/maintainer-role>`__:
+
+|maintainer-guewen| 
+
+This module is part of the `OCA/queue <https://github.com/OCA/queue/tree/16.0/queue_job>`_ project on GitHub.
+
+You are welcome to contribute. To learn how please visit https://odoo-community.org/page/Contribute.

odoo-bringout-oca-queue-queue_job/queue_job/__init__.py

@@ -0,0 +1,10 @@
+from . import controllers
+from . import fields
+from . import models
+from . import wizards
+from . import jobrunner
+from .post_init_hook import post_init_hook
+from .post_load import post_load
+
+# shortcuts
+from .job import identity_exact

odoo-bringout-oca-queue-queue_job/queue_job/__manifest__.py

@@ -0,0 +1,35 @@
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+{
+    "name": "Job Queue",
+    "version": "16.0.2.11.4",
+    "author": "Camptocamp,ACSONE SA/NV,Odoo Community Association (OCA)",
+    "website": "https://github.com/OCA/queue",
+    "license": "LGPL-3",
+    "category": "Generic Modules",
+    "depends": ["mail", "base_sparse_field", "web"],
+    "external_dependencies": {"python": ["requests"]},
+    "data": [
+        "security/security.xml",
+        "security/ir.model.access.csv",
+        "views/queue_job_views.xml",
+        "views/queue_job_channel_views.xml",
+        "views/queue_job_function_views.xml",
+        "wizards/queue_jobs_to_done_views.xml",
+        "wizards/queue_jobs_to_cancelled_views.xml",
+        "wizards/queue_requeue_job_views.xml",
+        "views/queue_job_menus.xml",
+        "data/queue_data.xml",
+        "data/queue_job_function_data.xml",
+    ],
+    "assets": {
+        "web.assets_backend": [
+            "/queue_job/static/src/views/**/*",
+        ],
+    },
+    "installable": True,
+    "development_status": "Mature",
+    "maintainers": ["guewen"],
+    "post_init_hook": "post_init_hook",
+    "post_load": "post_load",
+}

odoo-bringout-oca-queue-queue_job/queue_job/controllers/__init__.py

@@ -0,0 +1 @@
+from . import main

odoo-bringout-oca-queue-queue_job/queue_job/controllers/main.py

@@ -0,0 +1,312 @@
+# Copyright (c) 2015-2016 ACSONE SA/NV (<http://acsone.eu>)
+# Copyright 2013-2016 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import logging
+import random
+import time
+import traceback
+from io import StringIO
+
+from psycopg2 import OperationalError, errorcodes
+from werkzeug.exceptions import BadRequest, Forbidden
+
+from odoo import SUPERUSER_ID, _, api, http, registry, tools
+from odoo.service.model import PG_CONCURRENCY_ERRORS_TO_RETRY
+
+from ..delay import chain, group
+from ..exception import FailedJobError, NothingToDoJob, RetryableJobError
+from ..job import ENQUEUED, Job
+
+_logger = logging.getLogger(__name__)
+
+PG_RETRY = 5  # seconds
+
+DEPENDS_MAX_TRIES_ON_CONCURRENCY_FAILURE = 5
+
+
+class RunJobController(http.Controller):
+    def _try_perform_job(self, env, job):
+        """Try to perform the job."""
+        job.set_started()
+        job.store()
+        env.cr.commit()
+        job.lock()
+
+        _logger.debug("%s started", job)
+
+        job.perform()
+        # Triggers any stored computed fields before calling 'set_done'
+        # so that will be part of the 'exec_time'
+        env.flush_all()
+        job.set_done()
+        job.store()
+        env.flush_all()
+        env.cr.commit()
+        _logger.debug("%s done", job)
+
+    def _enqueue_dependent_jobs(self, env, job):
+        tries = 0
+        while True:
+            try:
+                job.enqueue_waiting()
+            except OperationalError as err:
+                # Automatically retry the typical transaction serialization
+                # errors
+                if err.pgcode not in PG_CONCURRENCY_ERRORS_TO_RETRY:
+                    raise
+                if tries >= DEPENDS_MAX_TRIES_ON_CONCURRENCY_FAILURE:
+                    _logger.info(
+                        "%s, maximum number of tries reached to update dependencies",
+                        errorcodes.lookup(err.pgcode),
+                    )
+                    raise
+                wait_time = random.uniform(0.0, 2**tries)
+                tries += 1
+                _logger.info(
+                    "%s, retry %d/%d in %.04f sec...",
+                    errorcodes.lookup(err.pgcode),
+                    tries,
+                    DEPENDS_MAX_TRIES_ON_CONCURRENCY_FAILURE,
+                    wait_time,
+                )
+                time.sleep(wait_time)
+            else:
+                break
+
+    @http.route("/queue_job/runjob", type="http", auth="none", save_session=False)
+    def runjob(self, db, job_uuid, **kw):
+        http.request.session.db = db
+        env = http.request.env(user=SUPERUSER_ID)
+
+        def retry_postpone(job, message, seconds=None):
+            job.env.clear()
+            with registry(job.env.cr.dbname).cursor() as new_cr:
+                job.env = api.Environment(new_cr, SUPERUSER_ID, {})
+                job.postpone(result=message, seconds=seconds)
+                job.set_pending(reset_retry=False)
+                job.store()
+
+        # ensure the job to run is in the correct state and lock the record
+        env.cr.execute(
+            "SELECT state FROM queue_job WHERE uuid=%s AND state=%s FOR UPDATE",
+            (job_uuid, ENQUEUED),
+        )
+        if not env.cr.fetchone():
+            _logger.warning(
+                "was requested to run job %s, but it does not exist, "
+                "or is not in state %s",
+                job_uuid,
+                ENQUEUED,
+            )
+            return ""
+
+        job = Job.load(env, job_uuid)
+        assert job and job.state == ENQUEUED
+
+        try:
+            try:
+                self._try_perform_job(env, job)
+            except OperationalError as err:
+                # Automatically retry the typical transaction serialization
+                # errors
+                if err.pgcode not in PG_CONCURRENCY_ERRORS_TO_RETRY:
+                    raise
+
+                _logger.debug("%s OperationalError, postponed", job)
+                raise RetryableJobError(
+                    tools.ustr(err.pgerror, errors="replace"), seconds=PG_RETRY
+                ) from err
+
+        except NothingToDoJob as err:
+            if str(err):
+                msg = str(err)
+            else:
+                msg = _("Job interrupted and set to Done: nothing to do.")
+            job.set_done(msg)
+            job.store()
+            env.cr.commit()
+
+        except RetryableJobError as err:
+            # delay the job later, requeue
+            retry_postpone(job, str(err), seconds=err.seconds)
+            _logger.debug("%s postponed", job)
+            # Do not trigger the error up because we don't want an exception
+            # traceback in the logs we should have the traceback when all
+            # retries are exhausted
+            env.cr.rollback()
+            return ""
+
+        except (FailedJobError, Exception) as orig_exception:
+            buff = StringIO()
+            traceback.print_exc(file=buff)
+            traceback_txt = buff.getvalue()
+            _logger.error(traceback_txt)
+            job.env.clear()
+            with registry(job.env.cr.dbname).cursor() as new_cr:
+                job.env = job.env(cr=new_cr)
+                vals = self._get_failure_values(job, traceback_txt, orig_exception)
+                job.set_failed(**vals)
+                job.store()
+                buff.close()
+            raise
+
+        _logger.debug("%s enqueue depends started", job)
+        self._enqueue_dependent_jobs(env, job)
+        _logger.debug("%s enqueue depends done", job)
+
+        return ""
+
+    def _get_failure_values(self, job, traceback_txt, orig_exception):
+        """Collect relevant data from exception."""
+        exception_name = orig_exception.__class__.__name__
+        if hasattr(orig_exception, "__module__"):
+            exception_name = orig_exception.__module__ + "." + exception_name
+        exc_message = getattr(orig_exception, "name", str(orig_exception))
+        return {
+            "exc_info": traceback_txt,
+            "exc_name": exception_name,
+            "exc_message": exc_message,
+        }
+
+    # flake8: noqa: C901
+    @http.route("/queue_job/create_test_job", type="http", auth="user")
+    def create_test_job(
+        self,
+        priority=None,
+        max_retries=None,
+        channel=None,
+        description="Test job",
+        size=1,
+        failure_rate=0,
+    ):
+        """Create test jobs
+
+        Examples of urls:
+
+        * http://127.0.0.1:8069/queue_job/create_test_job: single job
+        * http://127.0.0.1:8069/queue_job/create_test_job?size=10: a graph of 10 jobs
+        * http://127.0.0.1:8069/queue_job/create_test_job?size=10&failure_rate=0.5:
+          a graph of 10 jobs, half will fail
+
+        """
+        if not http.request.env.user.has_group("base.group_erp_manager"):
+            raise Forbidden(_("Access Denied"))
+
+        if failure_rate is not None:
+            try:
+                failure_rate = float(failure_rate)
+            except (ValueError, TypeError):
+                failure_rate = 0
+
+        if not (0 <= failure_rate <= 1):
+            raise BadRequest("failure_rate must be between 0 and 1")
+
+        if size is not None:
+            try:
+                size = int(size)
+            except (ValueError, TypeError):
+                size = 1
+
+        if priority is not None:
+            try:
+                priority = int(priority)
+            except ValueError:
+                priority = None
+
+        if max_retries is not None:
+            try:
+                max_retries = int(max_retries)
+            except ValueError:
+                max_retries = None
+
+        if size == 1:
+            return self._create_single_test_job(
+                priority=priority,
+                max_retries=max_retries,
+                channel=channel,
+                description=description,
+                failure_rate=failure_rate,
+            )
+
+        if size > 1:
+            return self._create_graph_test_jobs(
+                size,
+                priority=priority,
+                max_retries=max_retries,
+                channel=channel,
+                description=description,
+                failure_rate=failure_rate,
+            )
+        return ""
+
+    def _create_single_test_job(
+        self,
+        priority=None,
+        max_retries=None,
+        channel=None,
+        description="Test job",
+        size=1,
+        failure_rate=0,
+    ):
+        delayed = (
+            http.request.env["queue.job"]
+            .with_delay(
+                priority=priority,
+                max_retries=max_retries,
+                channel=channel,
+                description=description,
+            )
+            ._test_job(failure_rate=failure_rate)
+        )
+        return "job uuid: %s" % (delayed.db_record().uuid,)
+
+    TEST_GRAPH_MAX_PER_GROUP = 5
+
+    def _create_graph_test_jobs(
+        self,
+        size,
+        priority=None,
+        max_retries=None,
+        channel=None,
+        description="Test job",
+        failure_rate=0,
+    ):
+        model = http.request.env["queue.job"]
+        current_count = 0
+
+        possible_grouping_methods = (chain, group)
+
+        tails = []  # we can connect new graph chains/groups to tails
+        root_delayable = None
+        while current_count < size:
+            jobs_count = min(
+                size - current_count, random.randint(1, self.TEST_GRAPH_MAX_PER_GROUP)
+            )
+
+            jobs = []
+            for __ in range(jobs_count):
+                current_count += 1
+                jobs.append(
+                    model.delayable(
+                        priority=priority,
+                        max_retries=max_retries,
+                        channel=channel,
+                        description="%s #%d" % (description, current_count),
+                    )._test_job(failure_rate=failure_rate)
+                )
+
+            grouping = random.choice(possible_grouping_methods)
+            delayable = grouping(*jobs)
+            if not root_delayable:
+                root_delayable = delayable
+            else:
+                tail_delayable = random.choice(tails)
+                tail_delayable.on_done(delayable)
+            tails.append(delayable)
+
+        root_delayable.delay()
+
+        return "graph uuid: %s" % (
+            list(root_delayable._head())[0]._generated_job.graph_uuid,
+        )

odoo-bringout-oca-queue-queue_job/queue_job/data/queue_data.xml

@@ -0,0 +1,28 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+    <data noupdate="1">
+        <!-- Queue-job-related subtypes for messaging / Chatter -->
+        <record id="mt_job_failed" model="mail.message.subtype">
+            <field name="name">Job failed</field>
+            <field name="res_model">queue.job</field>
+            <field name="default" eval="True" />
+        </record>
+        <record id="ir_cron_autovacuum_queue_jobs" model="ir.cron">
+            <field name="name">AutoVacuum Job Queue</field>
+            <field ref="model_queue_job" name="model_id" />
+            <field eval="True" name="active" />
+            <field name="user_id" ref="base.user_root" />
+            <field name="interval_number">1</field>
+            <field name="interval_type">days</field>
+            <field name="numbercall">-1</field>
+            <field eval="False" name="doall" />
+            <field name="state">code</field>
+            <field name="code">model.autovacuum()</field>
+        </record>
+    </data>
+    <data noupdate="0">
+        <record model="queue.job.channel" id="channel_root">
+            <field name="name">root</field>
+        </record>
+    </data>
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/data/queue_job_function_data.xml

@@ -0,0 +1,6 @@
+<odoo noupdate="1">
+    <record id="job_function_queue_job__test_job" model="queue.job.function">
+        <field name="model_id" ref="queue_job.model_queue_job" />
+        <field name="method">_test_job</field>
+    </record>
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/delay.py

@@ -0,0 +1,666 @@
+# Copyright 2019 Camptocamp
+# Copyright 2019 Guewen Baconnier
+# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl.html)
+
+import itertools
+import logging
+import uuid
+from collections import defaultdict, deque
+
+from .job import Job
+from .utils import must_run_without_delay
+
+_logger = logging.getLogger(__name__)
+
+
+def group(*delayables):
+    """Return a group of delayable to form a graph
+
+    A group means that jobs can be executed concurrently.
+    A job or a group of jobs depending on a group can be executed only after
+    all the jobs of the group are done.
+
+    Shortcut to :class:`~odoo.addons.queue_job.delay.DelayableGroup`.
+
+    Example::
+
+        g1 = group(delayable1, delayable2)
+        g2 = group(delayable3, delayable4)
+        g1.on_done(g2)
+        g1.delay()
+    """
+    return DelayableGroup(*delayables)
+
+
+def chain(*delayables):
+    """Return a chain of delayable to form a graph
+
+    A chain means that jobs must be executed sequentially.
+    A job or a group of jobs depending on a group can be executed only after
+    the last job of the chain is done.
+
+    Shortcut to :class:`~odoo.addons.queue_job.delay.DelayableChain`.
+
+    Example::
+
+        chain1 = chain(delayable1, delayable2, delayable3)
+        chain2 = chain(delayable4, delayable5, delayable6)
+        chain1.on_done(chain2)
+        chain1.delay()
+    """
+    return DelayableChain(*delayables)
+
+
+class Graph:
+    """Acyclic directed graph holding vertices of any hashable type
+
+    This graph is not specifically designed to hold :class:`~Delayable`
+    instances, although ultimately it is used for this purpose.
+    """
+
+    __slots__ = "_graph"
+
+    def __init__(self, graph=None):
+        if graph:
+            self._graph = graph
+        else:
+            self._graph = {}
+
+    def add_vertex(self, vertex):
+        """Add a vertex
+
+        Has no effect if called several times with the same vertex
+        """
+        self._graph.setdefault(vertex, set())
+
+    def add_edge(self, parent, child):
+        """Add an edge between a parent and a child vertex
+
+        Has no effect if called several times with the same pair of vertices
+        """
+        self.add_vertex(child)
+        self._graph.setdefault(parent, set()).add(child)
+
+    def vertices(self):
+        """Return the vertices (nodes) of the graph"""
+        return set(self._graph)
+
+    def edges(self):
+        """Return the edges (links) of the graph"""
+        links = []
+        for vertex, neighbours in self._graph.items():
+            for neighbour in neighbours:
+                links.append((vertex, neighbour))
+        return links
+
+    # from
+    # https://codereview.stackexchange.com/questions/55767/finding-all-paths-from-a-given-graph
+    def paths(self, vertex):
+        """Generate the maximal cycle-free paths in graph starting at vertex.
+
+        >>> g = {1: [2, 3], 2: [3, 4], 3: [1], 4: []}
+        >>> sorted(self.paths(1))
+        [[1, 2, 3], [1, 2, 4], [1, 3]]
+        >>> sorted(self.paths(3))
+        [[3, 1, 2, 4]]
+        """
+        path = [vertex]  # path traversed so far
+        seen = {vertex}  # set of vertices in path
+
+        def search():
+            dead_end = True
+            for neighbour in self._graph[path[-1]]:
+                if neighbour not in seen:
+                    dead_end = False
+                    seen.add(neighbour)
+                    path.append(neighbour)
+                    yield from search()
+                    path.pop()
+                    seen.remove(neighbour)
+            if dead_end:
+                yield list(path)
+
+        yield from search()
+
+    def topological_sort(self):
+        """Yields a proposed order of nodes to respect dependencies
+
+        The order is not unique, the result may vary, but it is guaranteed
+        that a node depending on another is not yielded before.
+        It assumes the graph has no cycle.
+        """
+        depends_per_node = defaultdict(int)
+        for __, tail in self.edges():
+            depends_per_node[tail] += 1
+
+        # the queue contains only elements for which all dependencies
+        # are resolved
+        queue = deque(self.root_vertices())
+        while queue:
+            vertex = queue.popleft()
+            yield vertex
+            for node in self._graph[vertex]:
+                depends_per_node[node] -= 1
+                if not depends_per_node[node]:
+                    queue.append(node)
+
+    def root_vertices(self):
+        """Returns the root vertices
+
+        meaning they do not depend on any other job.
+        """
+        dependency_vertices = set()
+        for dependencies in self._graph.values():
+            dependency_vertices.update(dependencies)
+        return set(self._graph.keys()) - dependency_vertices
+
+    def __repr__(self):
+        paths = [path for vertex in self.root_vertices() for path in self.paths(vertex)]
+        lines = []
+        for path in paths:
+            lines.append(" → ".join(repr(vertex) for vertex in path))
+        return "\n".join(lines)
+
+
+class DelayableGraph(Graph):
+    """Directed Graph for :class:`~Delayable` dependencies
+
+    It connects together the :class:`~Delayable`, :class:`~DelayableGroup` and
+    :class:`~DelayableChain` graphs, and creates then enqueued the jobs.
+    """
+
+    def _merge_graph(self, graph):
+        """Merge a graph in the current graph
+
+        It takes each vertex, which can be :class:`~Delayable`,
+        :class:`~DelayableChain` or :class:`~DelayableGroup`, and updates the
+        current graph with the edges between Delayable objects (connecting
+        heads and tails of the groups and chains), so that at the end, the
+        graph contains only Delayable objects and their links.
+        """
+        for vertex, neighbours in graph._graph.items():
+            tails = vertex._tail()
+            for tail in tails:
+                # connect the tails with the heads of each node
+                heads = {head for n in neighbours for head in n._head()}
+                self._graph.setdefault(tail, set()).update(heads)
+
+    def _connect_graphs(self):
+        """Visit the vertices' graphs and connect them, return the whole graph
+
+        Build a new graph, walk the vertices and their related vertices, merge
+        their graph in the new one, until we have visited all the vertices
+        """
+        graph = DelayableGraph()
+        graph._merge_graph(self)
+
+        seen = set()
+        visit_stack = deque([self])
+        while visit_stack:
+            current = visit_stack.popleft()
+            if current in seen:
+                continue
+
+            vertices = current.vertices()
+            for vertex in vertices:
+                vertex_graph = vertex._graph
+                graph._merge_graph(vertex_graph)
+                visit_stack.append(vertex_graph)
+
+            seen.add(current)
+
+        return graph
+
+    def _has_to_execute_directly(self, vertices):
+        """Used for tests to run tests directly instead of storing them
+
+        In tests, prefer to use
+        :func:`odoo.addons.queue_job.tests.common.trap_jobs`.
+        """
+        envs = {vertex.recordset.env for vertex in vertices}
+        for env in envs:
+            if must_run_without_delay(env):
+                return True
+        return False
+
+    @staticmethod
+    def _ensure_same_graph_uuid(jobs):
+        """Set the same graph uuid on all jobs of the same graph"""
+        jobs_count = len(jobs)
+        if jobs_count == 0:
+            raise ValueError("Expecting jobs")
+        elif jobs_count == 1:
+            if jobs[0].graph_uuid:
+                raise ValueError(
+                    "Job %s is a single job, it should not"
+                    " have a graph uuid" % (jobs[0],)
+                )
+        else:
+            graph_uuids = {job.graph_uuid for job in jobs if job.graph_uuid}
+            if len(graph_uuids) > 1:
+                raise ValueError("Jobs cannot have dependencies between several graphs")
+            elif len(graph_uuids) == 1:
+                graph_uuid = graph_uuids.pop()
+            else:
+                graph_uuid = str(uuid.uuid4())
+            for job in jobs:
+                job.graph_uuid = graph_uuid
+
+    def delay(self):
+        """Build the whole graph, creates jobs and delay them"""
+        graph = self._connect_graphs()
+
+        vertices = graph.vertices()
+
+        for vertex in vertices:
+            vertex._build_job()
+
+        self._ensure_same_graph_uuid([vertex._generated_job for vertex in vertices])
+
+        if self._has_to_execute_directly(vertices):
+            self._execute_graph_direct(graph)
+            return
+
+        for vertex, neighbour in graph.edges():
+            neighbour._generated_job.add_depends({vertex._generated_job})
+
+        # If all the jobs of the graph have another job with the same identity,
+        # we do not create them. Maybe we should check that the found jobs are
+        # part of the same graph, but not sure it's really required...
+        # Also, maybe we want to check only the root jobs.
+        existing_mapping = {}
+        for vertex in vertices:
+            if not vertex.identity_key:
+                continue
+            generated_job = vertex._generated_job
+            existing = generated_job.job_record_with_same_identity_key()
+            if not existing:
+                # at least one does not exist yet, we'll delay the whole graph
+                existing_mapping.clear()
+                break
+            existing_mapping[vertex] = existing
+
+        # We'll replace the generated jobs by the existing ones, so callers
+        # can retrieve the existing job in "_generated_job".
+        # existing_mapping contains something only if *all* the job with an
+        # identity have an existing one.
+        for vertex, existing in existing_mapping.items():
+            vertex._generated_job = existing
+            return
+
+        for vertex in vertices:
+            vertex._generated_job.store()
+
+    def _execute_graph_direct(self, graph):
+        for delayable in graph.topological_sort():
+            delayable._execute_direct()
+
+
+class DelayableChain:
+    """Chain of delayables to form a graph
+
+    Delayables can be other :class:`~Delayable`, :class:`~DelayableChain` or
+    :class:`~DelayableGroup` objects.
+
+    A chain means that jobs must be executed sequentially.
+    A job or a group of jobs depending on a group can be executed only after
+    the last job of the chain is done.
+
+    Chains can be connected to other Delayable, DelayableChain or
+    DelayableGroup objects by using :meth:`~done`.
+
+    A Chain is enqueued by calling :meth:`~delay`, which delays the whole
+    graph.
+    Important: :meth:`~delay` must be called on the top-level
+    delayable/chain/group object of the graph.
+    """
+
+    __slots__ = ("_graph", "__head", "__tail")
+
+    def __init__(self, *delayables):
+        self._graph = DelayableGraph()
+        iter_delayables = iter(delayables)
+        head = next(iter_delayables)
+        self.__head = head
+        self._graph.add_vertex(head)
+        for neighbour in iter_delayables:
+            self._graph.add_edge(head, neighbour)
+            head = neighbour
+        self.__tail = head
+
+    def _head(self):
+        return self.__head._tail()
+
+    def _tail(self):
+        return self.__tail._head()
+
+    def __repr__(self):
+        inner_graph = "\n\t".join(repr(self._graph).split("\n"))
+        return "DelayableChain(\n\t{}\n)".format(inner_graph)
+
+    def on_done(self, *delayables):
+        """Connects the current chain to other delayables/chains/groups
+
+        The delayables/chains/groups passed in the parameters will be executed
+        when the current Chain is done.
+        """
+        for delayable in delayables:
+            self._graph.add_edge(self.__tail, delayable)
+        return self
+
+    def delay(self):
+        """Delay the whole graph"""
+        self._graph.delay()
+
+
+class DelayableGroup:
+    """Group of delayables to form a graph
+
+    Delayables can be other :class:`~Delayable`, :class:`~DelayableChain` or
+    :class:`~DelayableGroup` objects.
+
+    A group means that jobs must be executed sequentially.
+    A job or a group of jobs depending on a group can be executed only after
+    the all the jobs of the group are done.
+
+    Groups can be connected to other Delayable, DelayableChain or
+    DelayableGroup objects by using :meth:`~done`.
+
+    A group is enqueued by calling :meth:`~delay`, which delays the whole
+    graph.
+    Important: :meth:`~delay` must be called on the top-level
+    delayable/chain/group object of the graph.
+    """
+
+    __slots__ = ("_graph", "_delayables")
+
+    def __init__(self, *delayables):
+        self._graph = DelayableGraph()
+        self._delayables = set(delayables)
+        for delayable in delayables:
+            self._graph.add_vertex(delayable)
+
+    def _head(self):
+        return itertools.chain.from_iterable(node._head() for node in self._delayables)
+
+    def _tail(self):
+        return itertools.chain.from_iterable(node._tail() for node in self._delayables)
+
+    def __repr__(self):
+        inner_graph = "\n\t".join(repr(self._graph).split("\n"))
+        return "DelayableGroup(\n\t{}\n)".format(inner_graph)
+
+    def on_done(self, *delayables):
+        """Connects the current group to other delayables/chains/groups
+
+        The delayables/chains/groups passed in the parameters will be executed
+        when the current Group is done.
+        """
+        for parent in self._delayables:
+            for child in delayables:
+                self._graph.add_edge(parent, child)
+        return self
+
+    def delay(self):
+        """Delay the whole graph"""
+        self._graph.delay()
+
+
+class Delayable:
+    """Unit of a graph, one Delayable will lead to an enqueued job
+
+    Delayables can have dependencies on each others, as well as dependencies on
+    :class:`~DelayableGroup` or :class:`~DelayableChain` objects.
+
+    This class will generally not be used directly, it is used internally
+    by :meth:`~odoo.addons.queue_job.models.base.Base.delayable`. Look
+    in the base model for more details.
+
+    Delayables can be connected to other Delayable, DelayableChain or
+    DelayableGroup objects by using :meth:`~done`.
+
+    Properties of the future job can be set using the :meth:`~set` method,
+    which always return ``self``::
+
+        delayable.set(priority=15).set({"max_retries": 5, "eta": 15}).delay()
+
+    It can be used for example to set properties dynamically.
+
+    A Delayable is enqueued by calling :meth:`delay()`, which delays the whole
+    graph.
+    Important: :meth:`delay()` must be called on the top-level
+    delayable/chain/group object of the graph.
+    """
+
+    _properties = (
+        "priority",
+        "eta",
+        "max_retries",
+        "description",
+        "channel",
+        "identity_key",
+    )
+    __slots__ = _properties + (
+        "recordset",
+        "_graph",
+        "_job_method",
+        "_job_args",
+        "_job_kwargs",
+        "_generated_job",
+    )
+
+    def __init__(
+        self,
+        recordset,
+        priority=None,
+        eta=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        self._graph = DelayableGraph()
+        self._graph.add_vertex(self)
+
+        self.recordset = recordset
+
+        self.priority = priority
+        self.eta = eta
+        self.max_retries = max_retries
+        self.description = description
+        self.channel = channel
+        self.identity_key = identity_key
+
+        self._job_method = None
+        self._job_args = ()
+        self._job_kwargs = {}
+
+        self._generated_job = None
+
+    def _head(self):
+        return [self]
+
+    def _tail(self):
+        return [self]
+
+    def __repr__(self):
+        return "Delayable({}.{}({}, {}))".format(
+            self.recordset,
+            self._job_method.__name__ if self._job_method else "",
+            self._job_args,
+            self._job_kwargs,
+        )
+
+    def __del__(self):
+        if not self._generated_job:
+            _logger.warning("Delayable %s was prepared but never delayed", self)
+
+    def _set_from_dict(self, properties):
+        for key, value in properties.items():
+            if key not in self._properties:
+                raise ValueError("No property %s" % (key,))
+            setattr(self, key, value)
+
+    def set(self, *args, **kwargs):
+        """Set job properties and return self
+
+        The values can be either a dictionary and/or keywork args
+        """
+        if args:
+            # args must be a dict
+            self._set_from_dict(*args)
+        self._set_from_dict(kwargs)
+        return self
+
+    def on_done(self, *delayables):
+        """Connects the current Delayable to other delayables/chains/groups
+
+        The delayables/chains/groups passed in the parameters will be executed
+        when the current Delayable is done.
+        """
+        for child in delayables:
+            self._graph.add_edge(self, child)
+        return self
+
+    def delay(self):
+        """Delay the whole graph"""
+        self._graph.delay()
+
+    def split(self, size, chain=False):
+        """Split the Delayables.
+
+        Use `DelayableGroup` or `DelayableChain`
+        if `chain` is True containing batches of size `size`
+        """
+        if not self._job_method:
+            raise ValueError("No method set on the Delayable")
+
+        total_records = len(self.recordset)
+
+        delayables = []
+        for index in range(0, total_records, size):
+            recordset = self.recordset[index : index + size]
+            delayable = Delayable(
+                recordset,
+                priority=self.priority,
+                eta=self.eta,
+                max_retries=self.max_retries,
+                description=self.description,
+                channel=self.channel,
+                identity_key=self.identity_key,
+            )
+            # Update the __self__
+            delayable._job_method = getattr(recordset, self._job_method.__name__)
+            delayable._job_args = self._job_args
+            delayable._job_kwargs = self._job_kwargs
+
+            delayables.append(delayable)
+
+        description = self.description or (
+            self._job_method.__doc__.splitlines()[0].strip()
+            if self._job_method.__doc__
+            else "{}.{}".format(self.recordset._name, self._job_method.__name__)
+        )
+        for index, delayable in enumerate(delayables):
+            delayable.set(
+                description="%s (split %s/%s)"
+                % (description, index + 1, len(delayables))
+            )
+
+        # Prevent warning on deletion
+        self._generated_job = True
+
+        return (DelayableChain if chain else DelayableGroup)(*delayables)
+
+    def _build_job(self):
+        if self._generated_job:
+            return self._generated_job
+        self._generated_job = Job(
+            self._job_method,
+            args=self._job_args,
+            kwargs=self._job_kwargs,
+            priority=self.priority,
+            max_retries=self.max_retries,
+            eta=self.eta,
+            description=self.description,
+            channel=self.channel,
+            identity_key=self.identity_key,
+        )
+        return self._generated_job
+
+    def _store_args(self, *args, **kwargs):
+        self._job_args = args
+        self._job_kwargs = kwargs
+        return self
+
+    def __getattr__(self, name):
+        if name in self.__slots__:
+            return super().__getattr__(name)
+        if name in self.recordset:
+            raise AttributeError(
+                "only methods can be delayed (%s called on %s)" % (name, self.recordset)
+            )
+        recordset_method = getattr(self.recordset, name)
+        self._job_method = recordset_method
+        return self._store_args
+
+    def _execute_direct(self):
+        assert self._generated_job
+        self._generated_job.perform()
+
+
+class DelayableRecordset:
+    """Allow to delay a method for a recordset (shortcut way)
+
+    Usage::
+
+        delayable = DelayableRecordset(recordset, priority=20)
+        delayable.method(args, kwargs)
+
+    The method call will be processed asynchronously in the job queue, with
+    the passed arguments.
+
+    This class will generally not be used directly, it is used internally
+    by :meth:`~odoo.addons.queue_job.models.base.Base.with_delay`
+    """
+
+    __slots__ = ("delayable",)
+
+    def __init__(
+        self,
+        recordset,
+        priority=None,
+        eta=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        self.delayable = Delayable(
+            recordset,
+            priority=priority,
+            eta=eta,
+            max_retries=max_retries,
+            description=description,
+            channel=channel,
+            identity_key=identity_key,
+        )
+
+    @property
+    def recordset(self):
+        return self.delayable.recordset
+
+    def __getattr__(self, name):
+        def _delay_delayable(*args, **kwargs):
+            getattr(self.delayable, name)(*args, **kwargs).delay()
+            return self.delayable._generated_job
+
+        return _delay_delayable
+
+    def __str__(self):
+        return "DelayableRecordset(%s%s)" % (
+            self.delayable.recordset._name,
+            getattr(self.delayable.recordset, "_ids", ""),
+        )
+
+    __repr__ = __str__

odoo-bringout-oca-queue-queue_job/queue_job/exception.py

@@ -0,0 +1,43 @@
+# Copyright 2012-2016 Camptocamp
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+
+class BaseQueueJobError(Exception):
+    """Base queue job error"""
+
+
+class JobError(BaseQueueJobError):
+    """A job had an error"""
+
+
+class NoSuchJobError(JobError):
+    """The job does not exist."""
+
+
+class FailedJobError(JobError):
+    """A job had an error having to be resolved."""
+
+
+class RetryableJobError(JobError):
+    """A job had an error but can be retried.
+
+    The job will be retried after the given number of seconds.  If seconds is
+    empty, it will be retried according to the ``retry_pattern`` of the job or
+    by :const:`odoo.addons.queue_job.job.RETRY_INTERVAL` if nothing is defined.
+
+    If ``ignore_retry`` is True, the retry counter will not be increased.
+    """
+
+    def __init__(self, msg, seconds=None, ignore_retry=False):
+        super().__init__(msg)
+        self.seconds = seconds
+        self.ignore_retry = ignore_retry
+
+
+# TODO: remove support of NothingToDo: too dangerous
+class NothingToDoJob(JobError):
+    """The Job has nothing to do."""
+
+
+class ChannelNotFound(BaseQueueJobError):
+    """A channel could not be found"""

odoo-bringout-oca-queue-queue_job/queue_job/fields.py

@@ -0,0 +1,123 @@
+# copyright 2016 Camptocamp
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import json
+from datetime import date, datetime
+
+import dateutil
+import lxml
+
+from odoo import fields, models
+from odoo.tools.func import lazy
+
+
+class JobSerialized(fields.Field):
+    """Provide the storage for job fields stored as json
+
+    A base_type must be set, it must be dict, list or tuple.
+    When the field is not set, the json will be the corresponding
+    json string ("{}" or "[]").
+
+    Support for some custom types has been added to the json decoder/encoder
+    (see JobEncoder and JobDecoder).
+    """
+
+    type = "job_serialized"
+    column_type = ("text", "text")
+
+    _base_type = None
+
+    # these are the default values when we convert an empty value
+    _default_json_mapping = {
+        dict: "{}",
+        list: "[]",
+        tuple: "[]",
+        models.BaseModel: lambda env: json.dumps(
+            {"_type": "odoo_recordset", "model": "base", "ids": [], "uid": env.uid}
+        ),
+    }
+
+    def __init__(self, string=fields.Default, base_type=fields.Default, **kwargs):
+        super().__init__(string=string, _base_type=base_type, **kwargs)
+
+    def _setup_attrs(self, model, name):  # pylint: disable=missing-return
+        super()._setup_attrs(model, name)
+        if self._base_type not in self._default_json_mapping:
+            raise ValueError("%s is not a supported base type" % (self._base_type))
+
+    def _base_type_default_json(self, env):
+        default_json = self._default_json_mapping.get(self._base_type)
+        if not isinstance(default_json, str):
+            default_json = default_json(env)
+        return default_json
+
+    def convert_to_column(self, value, record, values=None, validate=True):
+        return self.convert_to_cache(value, record, validate=validate)
+
+    def convert_to_cache(self, value, record, validate=True):
+        # cache format: json.dumps(value) or None
+        if isinstance(value, self._base_type):
+            return json.dumps(value, cls=JobEncoder)
+        else:
+            return value or None
+
+    def convert_to_record(self, value, record):
+        default = self._base_type_default_json(record.env)
+        return json.loads(value or default, cls=JobDecoder, env=record.env)
+
+
+class JobEncoder(json.JSONEncoder):
+    """Encode Odoo recordsets so that we can later recompose them"""
+
+    def _get_record_context(self, obj):
+        return obj._job_prepare_context_before_enqueue()
+
+    def default(self, obj):
+        if isinstance(obj, models.BaseModel):
+            return {
+                "_type": "odoo_recordset",
+                "model": obj._name,
+                "ids": obj.ids,
+                "uid": obj.env.uid,
+                "su": obj.env.su,
+                "context": self._get_record_context(obj),
+            }
+        elif isinstance(obj, datetime):
+            return {"_type": "datetime_isoformat", "value": obj.isoformat()}
+        elif isinstance(obj, date):
+            return {"_type": "date_isoformat", "value": obj.isoformat()}
+        elif isinstance(obj, lxml.etree._Element):
+            return {
+                "_type": "etree_element",
+                "value": lxml.etree.tostring(obj, encoding=str),
+            }
+        elif isinstance(obj, lazy):
+            return obj._value
+        return json.JSONEncoder.default(self, obj)
+
+
+class JobDecoder(json.JSONDecoder):
+    """Decode json, recomposing recordsets"""
+
+    def __init__(self, *args, **kwargs):
+        env = kwargs.pop("env")
+        super().__init__(object_hook=self.object_hook, *args, **kwargs)
+        assert env
+        self.env = env
+
+    def object_hook(self, obj):
+        if "_type" not in obj:
+            return obj
+        type_ = obj["_type"]
+        if type_ == "odoo_recordset":
+            model = self.env(user=obj.get("uid"), su=obj.get("su"))[obj["model"]]
+            if obj.get("context"):
+                model = model.with_context(**obj.get("context"))
+            return model.browse(obj["ids"])
+        elif type_ == "datetime_isoformat":
+            return dateutil.parser.parse(obj["value"])
+        elif type_ == "date_isoformat":
+            return dateutil.parser.parse(obj["value"]).date()
+        elif type_ == "etree_element":
+            return lxml.etree.fromstring(obj["value"])
+        return obj

odoo-bringout-oca-queue-queue_job/queue_job/i18n/bs.po

@@ -0,0 +1,940 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 16.0\n"
+"Report-Msgid-Bugs-To: \n"
+"Last-Translator: \n"
+"Language-Team: \n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: \n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr "Pristup Odbijen"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr "Potrebna akcija"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr "Aktivnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr "Dekoracija iznimke aktivnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr "Status aktivnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr "Ikona tipa aktivnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr "Argumenti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr "Broj priloga"
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr "AutoVacuum red poslova"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr "Osnova"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr "Otkaži"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr "Otkaži sve odabrane poslove"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr "Otkaži posao"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr "Otkaži poslove"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr "Otkazan"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr "Otkazao %s"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr "Ne možete promijeniti glavni kanal"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr "Ne možete ukloniti glavni kanal"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr "Kanal"
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr "Potpuno ime kanala mora biti jedinstveno"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr "Kanali"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr "Preduzeće"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr "Potpuno ime metode"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr "Puni naziv"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr "Datum kreiranja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr "Kreirao"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr "Datum kreiranja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr "Kreirano"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr "Trenutni pokušaj"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr "Trenutni pokušaj / maks. pokušaja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr "Datum otkazivanja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr "Datum završetka"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr "Ovisnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr "Grafik ovisnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr "Opis"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr "Prikazani naziv"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr "Gotovo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr "Vrijeme stavljanja u red"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr "Stavljen u red"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr "Opis"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr "Informacije o iznimci"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr "Informacije o iznimci"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr "Poruka iznimke"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr "Poruka iznimke"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr "Iznimka:"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr "Izvrši tek nakon"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr "Vrijeme izvršavanja (prosj.)"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr "Neuspješan"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr "Tip polja"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr "Polja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr "Pratioci"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr "Pratioci (Partneri)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr "Font awesome ikona npr. fa-tasks"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr "Dijagram"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr "Grafički poslovi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr "Broj poslova grafika"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr "UUID grafika"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr "Grupiši po"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr "Ima poruku"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr "ID"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr "Ikona"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr "Ikona za prikaz iznimki."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr "Ključ identiteta"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr "Ako je zakačeno, nove poruke će zahtjevati vašu pažnju"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr "Ako je označeno neke poruke mogu imati grešku u dostavi."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr "Neispravna funkcija posla: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr "Pratilac"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr "Kanali poslova"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr "Funkcija posla"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr "Funkcije posla"
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr "Red poslova"
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr "Upravljač reda poslova"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+msgid "Job Serialized"
+msgstr "Serijalizovani posao"
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr "Posao neuspješan"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr "Posao prekinut i postavljen na završeno: nema šta da se radi."
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr "Zadaci"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr "Poslovi za grafik %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr "Kwargs"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr "Zadnjih 24 sata"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr "Posljednih 30 dana"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr "Posljednjih 7 dana"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr "Zadnje mijenjano"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr "Zadnji ažurirao"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr "Zadnje ažurirano"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr "Glavna zakačka"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr "Ručno postavljen na završeno od %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr "Maks. pokušaja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr "Greška pri isporuci poruke"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr "Poruke"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+msgid "Method"
+msgstr "Metoda"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr "Ime metode"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr "Model"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr "Model {} nije pronađen"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr "Rok za moju aktivnost"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr "Naziv:"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr "Krajnji rok za sljedeću aktivnost"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr "Pregled sljedeće aktivnosti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr "Tip sljedeće aktivnosti"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr "Nema dostupne akcije za ovaj posao"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr "Nije dozvoljeno mijenjanje polja: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr "Broj akcija"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr "Broj grešaka"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr "Broj poruka koje zahtijevaju aktivnost"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr "Broj poruka sa greškama pri isporuci"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr "Roditeljski kanal"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr "Potreban je roditeljski kanal."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number of of seconds to postpone the next execution. Setting the number of seconds to a 2-element tuple or list will randomize the retry interval between the 2 values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr "Na čekanju"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr "Prioritet"
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr "Red"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr "Red poslova"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr "Zaključavanje reda poslova"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr "Poslovi reda morah biti kreirani pozivom 'with_delay()'."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr "Zapis"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+msgid "Record(s)"
+msgstr "Zapis(i)"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr "Povezano"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+msgid "Related Action"
+msgstr "Povezana akcija"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr "Povezana akcija (serijalizovana)"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr "Povezani zapis"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr "Povezani zapisi"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr "Preostalo dana za izvršavanje"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr "Interval uklanjanja"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr "Vrati u red"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr "Vrati posao u red"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr "Vrati poslove u red"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr "Odgovorni korisnik"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr "Rezultat"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr "Rezultati"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr "Uzorak ponovnog pokušaja"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr "Uzorak ponovnog pokušaja (serijalizovan)"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr "Postavi sve odabrane poslove na završeno"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr "Označi poslove kao završene"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr "Postavi poslove na završeno"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr "Postavi na 'Završeno'"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr "Postavi na završeno"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr "Jedinstveni dijeljeni identifikator grafika. Prazan za pojedinačni posao."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr "Početni datum"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr "Započeto"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr "Status"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr "Zadatak"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default action is to open the view of the record related to the job. Configured as a dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr "Odabrani poslovi će biti otkazani."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr "Odabrani poslovi će biti vraćeni u red."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr "Odabrani poslovi će biti postavljeni na završeno."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr "Vrijeme (s)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr "Vrijeme potrebno za izvršavanje ovog posla u sekundama. Prosjek kad je grupisano."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr "Vrsta aktivnosti iznimke na zapisu."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr "UUID"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", \"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr "ID korisnika"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr "Čeka ovisnosti"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr "Čarobnjak za vraćanje odabranog skupa poslova u red"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr "PID radnika"

odoo-bringout-oca-queue-queue_job/queue_job/i18n/ca.po

@@ -0,0 +1,958 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 16.0\n"
+"Report-Msgid-Bugs-To: \n"
+"PO-Revision-Date: 2025-07-29 07:25+0000\n"
+"Last-Translator: Enric Tobella <etobella@creublanca.es>\n"
+"Language-Team: none\n"
+"Language: ca\n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: nplurals=2; plural=n != 1;\n"
+"X-Generator: Weblate 5.10.4\n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. "
+"retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+"<br/>\n"
+"                             <span class=\"oe_grey oe_inline\"> Si el máx. "
+"reintents es 0, el nombre de reintents es infinit.</span>"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr "Accés denegat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr "Acció requerida"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr "Activitats"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr "Decoració de l'activitat d'exepció"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr "Estat de l'activitat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr "Icona del tipus d'activitat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr "Arguments"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr "Nombre d'adjunts"
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr "Buidat automàtic de la cua de Treballs"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr "Base"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr "Cancel·lar"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr "Cancel·lar tots els treballs seleccionats"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr "Cancel·lar treball"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr "Cancel·lar treballs"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr "Cancel·lat"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr "Cancel·lat per %s"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr "No es pot cambiar el canal arrel"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr "No es pot eliminar el canal arrel"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr "Canal"
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr "El nom complet del canal ha de ser únic"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr "Canals"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr "Companyia"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr "Nom complet del métode"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr "Nom complet"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr "Data de creació"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr "Creat per"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr "Data de creació"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr "Creat el"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr "Intent actual"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr "Intent actual / reintents màx."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr "Data de cancel·lació"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr "Data de realització"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr "Dependències"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr "Gràfic de dependència"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr "Descripció"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr "Nom a mostrar"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr "Realitzat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr "Encua el treball"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr "Encuat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr "Exepció"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr "Gràfic dels treballs"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr "Nombre de gràfics de treballs"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr "UUID del gràfic"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr "Agrupar per"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr "Té missatges"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr "Icona"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr "Icona per indicar una activitat d'excepció."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr "Clau identificadora"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr "Si està marcat, nous missatges requereixen la teva atenció."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr "Si està marcat, alguns missatges tenen error d'enviament."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr "Funció de treball invàlida: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr "Es seguidor"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr "Canals de treball"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr "Funció de treball"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr "Funcions de treball"
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr "Cua de treballs"
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr "Gestor de la Cua de treballs"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+msgid "Job Serialized"
+msgstr "Treball seralitzat"
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr "Treball fallit"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr "Treball interromput i marcat com a realitzat: res a realitzar."
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr "Treballs"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr "Gràfic de treball %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr "Kwargs"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr "Últimes 24 hores"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr "Últims 30 dies"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr "Últims 7 dies"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr "Última modificació el"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr "Última actualització per"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr "Última actualització el"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr "Adjunt principal"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr "Marcat manualment com realitzat per %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr "Màx. reintents"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr "Error d'enviament del missatge"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr "Missatges"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+msgid "Method"
+msgstr "Mètode"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr "Nom del mètode"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr "Model"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr "Model {} no trobat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr "Data límit de la meva activitat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr "Nom"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr "Data límit de la següent activitat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr "Resum de la següent activitat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr "Tipus de la següent activitat"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr "No hi ha accions disponibles per aquest treball"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr "No està permés cambiar els camps: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr "Nombre d'accions"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr "Nombre d'errors"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr "Nombre de missatges que requereixen accions"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr "Nombre de missatges amb error d'enviament"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr "Canal pare"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr "Canal pare obligatori."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number "
+"of of seconds to postpone the next execution. Setting the number of seconds "
+"to a 2-element tuple or list will randomize the retry interval between the 2 "
+"values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr "Pendent"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr "Prioritat"
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr "Cua"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr "Cua de treballs"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr "Els treballs en cua es creen mitjançant la funció 'with_delay()'."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr "Registre"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+msgid "Record(s)"
+msgstr "Registre(s)"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr "Relacionat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+msgid "Related Action"
+msgstr "Acció relacionada"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr "Acció relacionada (en serie)"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr "Registre relacionat"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr "Registres relacionats"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr "Dies restants per executar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr "Interval d'eliminació"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr "Reencua"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr "Reencua el treball"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr "Reencua el treball"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr "Usuari responsable"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr "Resultat"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr "Resultats"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr "Patró de reintents"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr "Patró de reintents (serialitzat)"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr "Marcar tots els treballs seleccionats com realitzats"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr "Marcar treballs com realitzats"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr "Marcar treballs com realitzats"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr "Marcar com 'Realitzat'"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr "Marcar com realitzat"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr "Identificador únic del gràfic. Buit per a un únic treball."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+"Ha sorgit un problema durant l'execució del treball %s. Més detalls a la "
+"secció 'Informació sobre l'exepció'."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr "Data d'inici"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr "Iniciat"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr "Estat"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr "Tasca"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default "
+"action is to open the view of the record related to the job. Configured as a "
+"dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+"El treball fallarà si arriba al nombre de reintents màxim.\n"
+"Els reintents són infinits quan es deixa buit."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr "Els treballs seleccionats seran cancel·lats."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr "Els treballs seleccionats es tornaran a posar en cua."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr "Els treballs seleccionats es marcaran com realitzats."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr "Temps (s)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr ""
+"Temps necessari per executar el treball en segons. Mitjana quan s'agrupa."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr "Tipus d'acitivitat de l'exepció en el registre."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr "UUID"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr "ID de l'usuari"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr "Esperant dependències"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr "Assistent per tornar a posar en cua una selecció de treballs"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr "PID del treballador"

odoo-bringout-oca-queue-queue_job/queue_job/i18n/it.po

@@ -0,0 +1,999 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 16.0\n"
+"Report-Msgid-Bugs-To: \n"
+"PO-Revision-Date: 2025-02-27 11:06+0000\n"
+"Last-Translator: mymage <stefano.consolaro@mymage.it>\n"
+"Language-Team: none\n"
+"Language: it\n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: nplurals=2; plural=n != 1;\n"
+"X-Generator: Weblate 5.6.2\n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. "
+"retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> Se il massimo "
+"di tentativi è 0, il numero di tentativi è infinito.</span>"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr "Accesso negato"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr "Azione richiesta"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr "Attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr "Decorazione eccezione attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr "Stato attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr "Icona tipo attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr "Argomenti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr "Conteggio allegati"
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr "Auto pulizia coda lavoro"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr "Base"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr "Annulla"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr "Annulla tutti i lavori selezionati"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr "Annulla lavoro"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr "Annulla lavori"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr "Annullata"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr "Annullata da %s"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr "Non si può cambiare il canale radice"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr "Non si può rimuovere il canale radice"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr "Canale"
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr "Il nome completo del canale deve essere univoco"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr "Canali"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr "Azienda"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr "Nome completo metodo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr "Nome completo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr "Data creazione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr "Creato da"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr "Data creazione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr "Creato il"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr "Tentativo attuale"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr "Tentativo attuale / massimo tentativi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr "Data annullamento"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr "Data completamento"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr "Dipendenze"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr "Grafico dipendenza"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr "Descrizione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr "Nome visualizzato"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr "Completata"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr "Ora accodamento"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr "In coda"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr "Eccezione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr "Informazioni eccezione"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr "Informazioni eccezione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr "Messaggio eccezione"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr "Messaggio eccezione"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr "Eccezione:"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr "Eseguire solo dopo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr "Tempo esecuzione (medio)"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr "Fallito"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr "Tipo campo"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr "Campi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr "Seguito da"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr "Seguito da (partner)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr "Icona Font Awesome es. fa-tasks"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr "Grafico"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr "Grafico lavori"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr "Grafico conteggio lavori"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr "Grafico UUID"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr "Raggruppa per"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr "Ha un messaggio"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr "ID"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr "Icona"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr "Icona per indicare un'attività eccezione."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr "Chiave identità"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr "Se selezionata, nuovi messaggi richiedono attenzione."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr "Se selezionata, alcuni messaggi hanno un errore di consegna."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr "Funzione lavoro non valida: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr "Segue"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr "Canali lavoro"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr "Funzione lavoro"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr "Funzioni lavoro"
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr "Coda lavoro"
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr "Gestore coda lavoro"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+msgid "Job Serialized"
+msgstr "Lavoro serializzato"
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr "Lavro fallito"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr "Lavoro interrotto e impostato a completato: nulla da fare."
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr "Lavori"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr "Lavori per grafico %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr "Kwargs"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr "Ultime 24 ore"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr "Ultimi 30 giorni"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr "Ultimi 7 giorni"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr "Ultima modifica il"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr "Ultimo aggiornamento di"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr "Ultimo aggiornamento il"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr "Allegato principale"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr "Impostato manualmente a completato da %s"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr "Massimo tentativi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr "Errore di consegna messaggio"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr "Messaggi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+msgid "Method"
+msgstr "Metodo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr "Nome metodo"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr "Modello"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr "Modello {} non trovato"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr "Scadenza mia attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr "Nome"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr "Scadenza prossima attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr "Riepilogo prossima attività"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr "Tipo prossima attività"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr "Nessuna azione disponibile per questo lavoro"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr "Non autorizzato a modificare i campi: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr "Numero di azioni"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr "Numero di errori"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr "Numero di messaggi che richiedono un'azione"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr "Numero di messaggi con errore di consegna"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr "Canale padre"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr "Richiesto canale padre."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number "
+"of of seconds to postpone the next execution. Setting the number of seconds "
+"to a 2-element tuple or list will randomize the retry interval between the 2 "
+"values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+"Schema derivante dal conteggio dei tentativi degli errori ripetibili, numero "
+"di secondi per ritardare l'esecuzione successiva. Impostando il numero di "
+"secondi ad una tupla di due elementi o un elenco renderà causale "
+"l'intervallo tra i tentativi tra i due valori.\n"
+"Esempio: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Esempio: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"Vedere la descrizione del modulo per i dettagli."
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr "In attesa"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr "Priorità"
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr "Coda"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr "Lavoro in coda"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr "Blocco coda lavoro"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr "Il lavoro in coda deve essere creato chiamando 'with_delay()'."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr "Record"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+msgid "Record(s)"
+msgstr "Record"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr "Collegato"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+msgid "Related Action"
+msgstr "Azione collegata"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr "Azione collegata (serializzata)"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr "Record collegato"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr "Record collegati"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr "Giorni rimanenti all'esecuzione"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr "Intervallo rimozione"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr "Rimetti in coda"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr "Riaccoda lavoro"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr "Riaccoda lavori"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr "Utente responsabile"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr "Risultato"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr "Risultati"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr "Riprova schema"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr "Riprova schema (serializzato)"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr "Imposta a completati tutti i lavori selezionati"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr "Imposta i lavori a completato"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr "Imposta i lavori a completato"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr "Imposta come 'Completato'"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr "Imposta a completato"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr ""
+"Singolo identificatore condiviso di un grafico. Vuoto per un lavoro singolo."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+"Qualcosa è andato male durante l'esecuzione del lavoro %s. Maggiori dettagli "
+"nella sezione 'informazioni eccezione'."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr "Data inizio"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr "Iniziato"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr "Stato"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+"Stato in base alle attività\n"
+"Scaduto: la data richiesta è trascorsa\n"
+"Oggi: la data attività è oggi\n"
+"Pianificato: attività future."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr "Lavoro"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default "
+"action is to open the view of the record related to the job. Configured as a "
+"dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+"L'azione quando si usa il pulsante 'Azione collegata' in un lavoro. L'azione "
+"predefinita è di aprire la vista del record collegato al lavoro. Configrata "
+"come dizionari con chiavi opzionali: enable, func_name, kwargs.\n"
+"Vedere la descrizione del modulo per i dettagli."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+"Il lavoro fallirà se il numero di tentativi raggiunge il massimo.\n"
+"I tentativi sono infiniti quando vuoto."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr "I lavori selezionati verranno annullati."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr "I lavori selezionati verranno riaccodati."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr "I lavori selezionati verranno impostati a completato."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr "Ora (e)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr ""
+"Tempo in secondi richiesto per eseguire il lavoro. Medio quando raggruppati."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr "Tipo di attività eccezione sul record."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr "UUID"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+"Formato inaspettato di azione colegata per {}.\n"
+"Esempio di formato valido:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+"Formatto inatteso dello schema del nuovo tentativo per {}.\n"
+"Esempio di formati validi:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr "ID utente"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr "Attesa dipendenze"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr "Procedura guidata per riaccodare una selezione di lavori"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr "PID worker"
+
+#, python-format
+#~ msgid "If both parameters are 0, ALL jobs will be requeued!"
+#~ msgstr "Se entrambi i parametri sono 0, tutti i lavori verranno riaccodati!"
+
+#~ msgid "Jobs Garbage Collector"
+#~ msgstr "Garbage collector lavori"
+
+#, python-format
+#~ msgid ""
+#~ "Unexpected format of Retry Pattern for {}.\n"
+#~ "Example of valid format:\n"
+#~ "{{1: 300, 5: 600, 10: 1200, 15: 3000}}"
+#~ msgstr ""
+#~ "Formato inaspettato di schema tentativo per {}.\n"
+#~ "Esempio di formato valido:\n"
+#~ "{{1: 300, 5: 600, 10: 1200, 15: 3000}}"

odoo-bringout-oca-queue-queue_job/queue_job/i18n/queue_job.pot

@@ -0,0 +1,940 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 16.0\n"
+"Report-Msgid-Bugs-To: \n"
+"Last-Translator: \n"
+"Language-Team: \n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: \n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr ""
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+msgid "Job Serialized"
+msgstr ""
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+msgid "Method"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number of of seconds to postpone the next execution. Setting the number of seconds to a 2-element tuple or list will randomize the retry interval between the 2 values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+msgid "Record(s)"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+msgid "Related Action"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default action is to open the view of the record related to the job. Configured as a dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", \"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr ""

odoo-bringout-oca-queue-queue_job/queue_job/i18n/tr.po

@@ -0,0 +1,989 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 16.0\n"
+"Report-Msgid-Bugs-To: \n"
+"PO-Revision-Date: 2025-06-13 15:27+0000\n"
+"Last-Translator: Betül Öğmen <betulo@eska.biz>\n"
+"Language-Team: none\n"
+"Language: tr\n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: nplurals=2; plural=n != 1;\n"
+"X-Generator: Weblate 5.10.4\n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. "
+"retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> Eğer maks. "
+"deneme sayısı 0 ise, deneme sayısı sonsuz olur.</span>"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr "Erişim Engellendi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr "Eylem Gerekli"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr "Aktiviteler"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr "Aktivite İstisna Dekorasyonu"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr "Aktivite Durumu"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr "Aktivite Türü Simgesi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr "Argümanlar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr "Ek Sayısı"
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr "Otomatik Temizleme İş Kuyruğu"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr "Temel"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr "İptal"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr "Tüm seçili işleri iptal et"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr "İşi iptal et"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr "İşleri iptal et"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr "İptal Edildi"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr "%s tarafından iptal edildi"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr "Kök kanal değiştirilemez"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr "Kök kanal silinemez"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr "Kanal"
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr "Kanal tam adı benzersiz olmalıdır"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr "Kanallar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr "Şirket"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr "Tam Metot Adı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr "Tam Adı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr "Oluşturulma Tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr "Oluşturan"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr "Oluşturulma tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr "Oluşturuldu"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr "Şu anki deneme"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr "Şu anki deneme / maks. deneme"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr "İptal Edilme Tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr "Tamamlanma Tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr "Bağımlılıklar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr "Bağımlılık Grafiği"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr "Açıklama"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr "Görünüm Adı"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr "Tamamlandı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr "Sıraya Alınma Zamanı"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr "Sıraya Alındı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr "İstisna"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr "İstisna Bilgisi"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr "İstisna Bilgisi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr "İstisna Mesajı"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr "İstisna mesajı"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr "İstisna:"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr "Bundan sonra çalıştır"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr "Çalıştırma Zamanı (ort)"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr "Başarısız"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr "Alan Tipi"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr "Alanlar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr "Takipçiler"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr "Takipçiler (İş Ortakları)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr "Font awesome simgeleri ör. fa-tasks"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr "Grafik"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr "Grafiğin İşleri"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr "Grafiğin İş Sayısı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr "Grafik UUID"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr "Gruplandı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr "Mesajı Var"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr "ID"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr "Simge"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr "İstisna etkinliğini gösteren simge."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr "Benzersiz Anahtar"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr "İşaretlenirse, sizi bekleyen mesajlar var."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr "İşaretlenirse, bazı mesajlar teslimat hatası içerir."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr "Geçersiz iş fonksiyonu: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr "Takipçi"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr "İş Kanalları"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr "İş Fonksiyonu"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr "İş Fonksiyonları"
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr "İş Kuyruğu"
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr "İş Kuyruğu Yöneticisi"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+msgid "Job Serialized"
+msgstr "Serileştirilmiş İş"
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr "İş başarısız oldu"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr "İş yarıda kesildi ve bitti olarak ayarlandı: yapılacak bir şey yok."
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr "İşler"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr "%s grafiğinin işleri"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr "Son 24 saat"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr "Son 30 gün"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr "Son 7 gün"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr "Son Değiştirme"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr "Son Güncelleyen"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr "Son Güncelleme"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr "Ana Ek"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr "%s tarafından tamamlandı olarak ayarlandı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr "Maks. deneme"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr "Mesaj Teslimat hatası"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr "Mesajlar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+msgid "Method"
+msgstr "Yöntem"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr "Yöntem Adı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr "Model {} bulunamadı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr "Aktivite Son Tarihim"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr "Ad"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr "Sonraki Aktivite Son Tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr "Sonraki Aktivite Özeti"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr "Sonraki Aktivite Türü"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr "Bu iş için uygun bir eylem yok"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr "Alan(lar)ı değiştirme izni yok: {}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr "Eylem Sayısı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr "Hata sayısı"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr "Eylem gerektiren mesaj sayısı"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr "Teslimat hatası içeren mesaj sayısı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr "Üst Kanal"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr "Üst kanal gerekli."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number "
+"of of seconds to postpone the next execution. Setting the number of seconds "
+"to a 2-element tuple or list will randomize the retry interval between the 2 "
+"values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+"Yeniden denenebilir hatalarda yeniden deneme sayısından, bir sonraki "
+"çalışmanın ertelenmesi için saniye sayısını ifade eden desen. Saniye "
+"sayısını 2 elemanlı bir demet veya liste olarak ayarlama, yeniden deneme "
+"aralığını 2 değer arasında rastgele hale getirir.\n"
+"Örneğin: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Örneğin: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"Ayrıntılar için modül açıklamasına bakınız."
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr "Beklemede"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr "Öncelik"
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr "Sıra"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr "Kuyruk İşi"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr "Kuyruk İş Kilidi"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr "Kuyruk işleri 'with_delay()' çağrılarak oluşturulmalıdır."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr "Kayıt"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+msgid "Record(s)"
+msgstr "Kayıt(lar)"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr "İlgili"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+msgid "Related Action"
+msgstr "İlgili Eylem"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr "İlgili Eylem (serileştirilmiş)"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr "İlgili Kayıt"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr "İlgili Kayıtlar"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr "Çalıştırılacak kalan günler"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr "Kaldırma Aralığı"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr "Yeniden sıraya al"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr "İşi yeniden sıraya al"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr "İşleri Tekrar Sıraya Al"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr "Sorumlu Kullanıcı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr "Sonuç"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr "Sonuçlar"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr "Tekrar Şablonu"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr "Tekrar Şablonu (serileştirilmiş)"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr "Seçili tüm işleri tamamlandı olarak işaretle"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr "İşleri tamamlandı olarak işaretle"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr "İşleri tamamlandı olarak işaretle"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr "'Tamamlandı' olarak işaretle"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr "Tamamlandı olarak işaretle"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr "Bir grafiğin paylaşılan tanımlayıcısı. Tek işler için değeri boştur."
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+"Bu işi yaparken bir şeyler ters gitti %s. 'İstisna Bilgisi' kısmında daha "
+"fazla detaya erişebilirsiniz."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr "Başlama Tarihi"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr "Başladı"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr "Durum"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+"Aktivitelere dayalı durum\n"
+"Geçikmiş: Son tarih zaten geçti\n"
+"Bugün: Aktivite tarihi bugün\n"
+"Planlandı: Gelecekteki aktiviteler."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr "Görev"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default "
+"action is to open the view of the record related to the job. Configured as a "
+"dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+"İşteki *İlgili Eylem* düğmesi kullanıldığında gerçekleşen eylem. Varsayılan "
+"eylem, işle ilişkili kaydın görünümünü açmaktır. İsteğe bağlı anahtarlar ile "
+"yapılandırılmış bir sözlük: etkinleştir, func_name, kwargs.\n"
+"Ayrıntılar için modül açıklamasına bakınız."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+"Eğer tekrar sayısı maks. deneme sayısına ulaşırsa iş başarısız olacaktır.\n"
+"Boş olduğunda sonsuz tekrar yapar."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr "Seçilen işler iptal edilecektir."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr "Seçilen işler tekrar kuyruğa alınacaktır."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr "Seçilen işler tamamlandı olarak ayarlanacaktır."
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr "Süre (sn)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr ""
+"Saniye cinsinden bu işi yapmak için gereken süre. Gruplandığında ortalaması "
+"alınır."
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr "Kayıttaki istisna aktivitesinin türü."
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr "UUID"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+"İlgili eylem için beklenmeyen biçim {}.\n"
+"Doğru biçim örneği:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+"{} için beklenmeyen tekrarlama şablonu.\n"
+"Geçerli kullanım örnekleri:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr "Kullanıcı ID"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr "Bağımlılıklar Bekleniyor"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr "Seçilen işleri tekrar sıraya alan sihirbaz"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr "Çalışan Pid"
+
+#, python-format
+#~ msgid "If both parameters are 0, ALL jobs will be requeued!"
+#~ msgstr "Her iki parametre de 0 ise, TÜM işler tekrar sıraya alınacaktır!"
+
+#~ msgid "Jobs Garbage Collector"
+#~ msgstr "İş Çöp Toplayıcısı"

odoo-bringout-oca-queue-queue_job/queue_job/i18n/zh_CN.po

@@ -0,0 +1,990 @@
+# Translation of Odoo Server.
+# This file contains the translation of the following modules:
+# 	* queue_job
+#
+msgid ""
+msgstr ""
+"Project-Id-Version: Odoo Server 12.0\n"
+"Report-Msgid-Bugs-To: \n"
+"PO-Revision-Date: 2022-08-13 08:07+0000\n"
+"Last-Translator: Dong <dong@freshoo.cn>\n"
+"Language-Team: none\n"
+"Language: zh_CN\n"
+"MIME-Version: 1.0\n"
+"Content-Type: text/plain; charset=UTF-8\n"
+"Content-Transfer-Encoding: \n"
+"Plural-Forms: nplurals=1; plural=0;\n"
+"X-Generator: Weblate 4.3.2\n"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid ""
+"<br/>\n"
+"                            <span class=\"oe_grey oe_inline\"> If the max. "
+"retries is 0, the number of retries is infinite.</span>"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Access Denied"
+msgstr "拒绝访问"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction
+msgid "Action Needed"
+msgstr "前置操作"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_ids
+msgid "Activities"
+msgstr "活动"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_decoration
+msgid "Activity Exception Decoration"
+msgstr "活动异常装饰"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_state
+msgid "Activity State"
+msgstr "活动状态"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_icon
+msgid "Activity Type Icon"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__args
+msgid "Args"
+msgstr "位置参数"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_attachment_count
+msgid "Attachment Count"
+msgstr "附件数量"
+
+#. module: queue_job
+#: model:ir.actions.server,name:queue_job.ir_cron_autovacuum_queue_jobs_ir_actions_server
+#: model:ir.cron,cron_name:queue_job.ir_cron_autovacuum_queue_jobs
+msgid "AutoVacuum Job Queue"
+msgstr "自动清空作业队列"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_base
+msgid "Base"
+msgstr "基础"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Cancel"
+msgstr "取消"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_cancelled
+msgid "Cancel all selected jobs"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Cancel job"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "Cancel jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__cancelled
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Cancelled"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Cancelled by %s"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot change the root channel"
+msgstr "无法更改root频道"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Cannot remove the root channel"
+msgstr "无法删除root频道"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Channel"
+msgstr "频道"
+
+#. module: queue_job
+#: model:ir.model.constraint,message:queue_job.constraint_queue_job_channel_name_uniq
+msgid "Channel complete name must be unique"
+msgstr "频道完整名称必须是唯一的"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_channel
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_channel
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_channel_search
+msgid "Channels"
+msgstr "频道"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__company_id
+msgid "Company"
+msgstr "公司"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__channel_method_name
+msgid "Complete Method Name"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__complete_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__channel
+msgid "Complete Name"
+msgstr "完整名称"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_created
+msgid "Created Date"
+msgstr "创建日期"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_uid
+msgid "Created by"
+msgstr "创建者"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Created date"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__create_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__create_date
+msgid "Created on"
+msgstr "创建时间"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__retry
+msgid "Current try"
+msgstr "当前尝试"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Current try / max. retries"
+msgstr "当前尝试/最大重试次数"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_cancelled
+msgid "Date Cancelled"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_done
+msgid "Date Done"
+msgstr "完成日期"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Dependencies"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__dependency_graph
+msgid "Dependency Graph"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__name
+msgid "Description"
+msgstr "说明"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__display_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__display_name
+msgid "Display Name"
+msgstr "显示名称"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__done
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Done"
+msgstr "完成"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_enqueued
+msgid "Enqueue Time"
+msgstr "排队时间"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__enqueued
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Enqueued"
+msgstr "排队"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_name
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_info
+msgid "Exception Info"
+msgstr "异常信息"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception Information"
+msgstr "异常信息"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exc_message
+msgid "Exception Message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Exception message"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Exception:"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__eta
+msgid "Execute only after"
+msgstr "仅在此之后执行"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__exec_time
+msgid "Execution Time (avg)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__failed
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Failed"
+msgstr "失败"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_ir_model_fields__ttype
+msgid "Field Type"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_ir_model_fields
+msgid "Fields"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_follower_ids
+msgid "Followers"
+msgstr "关注者"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_partner_ids
+msgid "Followers (Partners)"
+msgstr "关注者(业务伙伴)"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_type_icon
+msgid "Font awesome icon e.g. fa-tasks"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Graph"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Graph Jobs"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_jobs_count
+msgid "Graph Jobs Count"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__graph_uuid
+msgid "Graph UUID"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Group By"
+msgstr "分组"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__has_message
+msgid "Has Message"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__id
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__id
+msgid "ID"
+msgstr "ID"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon"
+msgstr "图标"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_icon
+msgid "Icon to indicate an exception activity."
+msgstr "指示异常活动的图标。"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__identity_key
+msgid "Identity Key"
+msgstr "身份密钥"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction
+msgid "If checked, new messages require your attention."
+msgstr "确认后, 出现提示消息。"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error
+msgid "If checked, some messages have a delivery error."
+msgstr "如果勾选此项， 某些消息将会产生传递错误。"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Invalid job function: {}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_is_follower
+msgid "Is Follower"
+msgstr "关注者"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_channel
+msgid "Job Channels"
+msgstr "作业频道"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__job_function_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Job Function"
+msgstr "作业函数"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job_function
+#: model:ir.model,name:queue_job.model_queue_job_function
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__job_function_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_function
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_function_search
+msgid "Job Functions"
+msgstr "作业函数"
+
+#. module: queue_job
+#: model:ir.module.category,name:queue_job.module_category_queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue_job_root
+msgid "Job Queue"
+msgstr "作业队列"
+
+#. module: queue_job
+#: model:res.groups,name:queue_job.group_queue_job_manager
+msgid "Job Queue Manager"
+msgstr "作业队列管理员"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__ir_model_fields__ttype__job_serialized
+#, fuzzy
+msgid "Job Serialized"
+msgstr "作业失败"
+
+#. module: queue_job
+#: model:mail.message.subtype,name:queue_job.mt_job_failed
+msgid "Job failed"
+msgstr "作业失败"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/controllers/main.py:0
+#, python-format
+msgid "Job interrupted and set to Done: nothing to do."
+msgstr "作业中断并设置为已完成：无需执行任何操作。"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__job_ids
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__job_ids
+#: model:ir.ui.menu,name:queue_job.menu_queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_graph
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_pivot
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Jobs"
+msgstr "作业"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Jobs for graph %s"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__kwargs
+msgid "Kwargs"
+msgstr "关键字参数"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 24 hours"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 30 days"
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Last 7 days"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done____last_update
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job____last_update
+msgid "Last Modified on"
+msgstr "最后修改日"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_uid
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_uid
+msgid "Last Updated by"
+msgstr "最后更新者"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_cancelled__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_jobs_to_done__write_date
+#: model:ir.model.fields,field_description:queue_job.field_queue_requeue_job__write_date
+msgid "Last Updated on"
+msgstr "最后更新时间"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_main_attachment_id
+msgid "Main Attachment"
+msgstr "附件"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Manually set to done by %s"
+msgstr "由%s手动设置为完成"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__max_retries
+msgid "Max. retries"
+msgstr "最大重试次数"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error
+msgid "Message Delivery error"
+msgstr "消息递送错误"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_ids
+msgid "Messages"
+msgstr "消息"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__method
+#, fuzzy
+msgid "Method"
+msgstr "方法名称"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__method_name
+msgid "Method Name"
+msgstr "方法名称"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__model_name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__model_id
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Model"
+msgstr "模型"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid "Model {} not found"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__my_activity_date_deadline
+msgid "My Activity Deadline"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__name
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__name
+msgid "Name"
+msgstr "名称"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_date_deadline
+msgid "Next Activity Deadline"
+msgstr "下一活动截止日期"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_summary
+msgid "Next Activity Summary"
+msgstr "下一活动摘要"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_type_id
+msgid "Next Activity Type"
+msgstr "下一活动类型"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "No action available for this job"
+msgstr "此作业无法执行任何操作"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Not allowed to change field(s): {}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of Actions"
+msgstr "操作次数"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of errors"
+msgstr "错误数量"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_needaction_counter
+msgid "Number of messages requiring action"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__message_has_error_counter
+msgid "Number of messages with delivery error"
+msgstr "递送错误消息数量"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__parent_id
+msgid "Parent Channel"
+msgstr "父频道"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_channel.py:0
+#, python-format
+msgid "Parent channel required."
+msgstr "父频道必填。"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_retry_pattern
+msgid ""
+"Pattern expressing from the count of retries on retryable errors, the number "
+"of of seconds to postpone the next execution. Setting the number of seconds "
+"to a 2-element tuple or list will randomize the retry interval between the 2 "
+"values.\n"
+"Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+"Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__pending
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Pending"
+msgstr "等待"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__priority
+msgid "Priority"
+msgstr "优先级"
+
+#. module: queue_job
+#: model:ir.ui.menu,name:queue_job.menu_queue
+msgid "Queue"
+msgstr "队列"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_lock__queue_job_id
+msgid "Queue Job"
+msgstr "队列作业"
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_job_lock
+msgid "Queue Job Lock"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Queue jobs must be created by calling 'with_delay()'."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__record_ids
+msgid "Record"
+msgstr "记录"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__records
+#, fuzzy
+msgid "Record(s)"
+msgstr "记录"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Related"
+msgstr "相关的"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_related_action
+#, fuzzy
+msgid "Related Action"
+msgstr "相关记录"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__related_action
+msgid "Related Action (serialized)"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Record"
+msgstr "相关记录"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid "Related Records"
+msgstr "相关记录"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_tree
+msgid "Remaining days to execute"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_channel__removal_interval
+msgid "Removal Interval"
+msgstr "清除间隔"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue"
+msgstr "重新排队"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Requeue Job"
+msgstr "重新排队作业"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_requeue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "Requeue Jobs"
+msgstr "重新排队作业"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__activity_user_id
+msgid "Responsible User"
+msgstr "负责的用户"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__result
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Result"
+msgstr "结果"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Results"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__edit_retry_pattern
+msgid "Retry Pattern"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job_function__retry_pattern
+msgid "Retry Pattern (serialized)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_jobs_to_done
+msgid "Set all selected jobs to done"
+msgstr "将所有选定的作业设置为完成"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set jobs done"
+msgstr "设置作业完成"
+
+#. module: queue_job
+#: model:ir.actions.act_window,name:queue_job.action_set_jobs_done
+msgid "Set jobs to done"
+msgstr "将作业设置为完成"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Set to 'Done'"
+msgstr "设置为“完成”"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "Set to done"
+msgstr "设置为完成"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__graph_uuid
+msgid "Single shared identifier of a Graph. Empty for a single job."
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job.py:0
+#, python-format
+msgid ""
+"Something bad happened during the execution of job %s. More details in the "
+"'Exception Information' section."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__date_started
+msgid "Start Date"
+msgstr "开始日期"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__started
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Started"
+msgstr "开始"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__state
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "State"
+msgstr "状态"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_state
+msgid ""
+"Status based on activities\n"
+"Overdue: Due date is already passed\n"
+"Today: Activity date is today\n"
+"Planned: Future activities."
+msgstr ""
+"基于活动的状态\n"
+"逾期：已经超过截止日期\n"
+"现今：活动日期是当天\n"
+"计划：未来的活动。"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__func_string
+msgid "Task"
+msgstr "任务"
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job_function__edit_related_action
+msgid ""
+"The action when the button *Related Action* is used on a job. The default "
+"action is to open the view of the record related to the job. Configured as a "
+"dictionary with optional keys: enable, func_name, kwargs.\n"
+"See the module description for details."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__max_retries
+msgid ""
+"The job will fail if the number of tries reach the max. retries.\n"
+"Retries are infinite when empty."
+msgstr ""
+"如果尝试次数达到最大重试次数，作业将失败。\n"
+"空的时候重试是无限的。"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_cancelled
+msgid "The selected jobs will be cancelled."
+msgstr ""
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_requeue_job
+msgid "The selected jobs will be requeued."
+msgstr "所选作业将重新排队。"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_set_jobs_done
+msgid "The selected jobs will be set to done."
+msgstr "所选作业将设置为完成。"
+
+#. module: queue_job
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_form
+msgid "Time (s)"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__exec_time
+msgid "Time required to execute this job in seconds. Average when grouped."
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,help:queue_job.field_queue_job__activity_exception_decoration
+msgid "Type of the exception activity on record."
+msgstr "记录的异常活动的类型。"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__uuid
+msgid "UUID"
+msgstr "UUID"
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Related Action for {}.\n"
+"Example of valid format:\n"
+"{{\"enable\": True, \"func_name\": \"related_action_foo\", "
+"\"kwargs\" {{\"limit\": 10}}}}"
+msgstr ""
+
+#. module: queue_job
+#. odoo-python
+#: code:addons/queue_job/models/queue_job_function.py:0
+#, python-format
+msgid ""
+"Unexpected format of Retry Pattern for {}.\n"
+"Example of valid formats:\n"
+"{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+"{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__user_id
+msgid "User ID"
+msgstr "用户"
+
+#. module: queue_job
+#: model:ir.model.fields.selection,name:queue_job.selection__queue_job__state__wait_dependencies
+#: model_terms:ir.ui.view,arch_db:queue_job.view_queue_job_search
+msgid "Wait Dependencies"
+msgstr ""
+
+#. module: queue_job
+#: model:ir.model,name:queue_job.model_queue_requeue_job
+msgid "Wizard to requeue a selection of jobs"
+msgstr "重新排队向导所选的作业"
+
+#. module: queue_job
+#: model:ir.model.fields,field_description:queue_job.field_queue_job__worker_pid
+msgid "Worker Pid"
+msgstr ""
+
+#, fuzzy, python-format
+#~ msgid "If both parameters are 0, ALL jobs will be requeued!"
+#~ msgstr "所选作业将重新排队。"
+
+#, python-format
+#~ msgid ""
+#~ "Something bad happened during the execution of the job. More details in "
+#~ "the 'Exception Information' section."
+#~ msgstr ""
+#~ "在执行作业期间发生了一些不好的事情。有关详细信息，请参见“异常信息”部分。"
+
+#~ msgid "SMS Delivery error"
+#~ msgstr "短信传递错误"
+
+#~ msgid "Number of messages which requires an action"
+#~ msgstr "需要操作消息数量"
+
+#~ msgid ""
+#~ "<span class=\"oe_grey oe_inline\"> If the max. retries is 0, the number "
+#~ "of retries is infinite.</span>"
+#~ msgstr ""
+#~ "<span class=\"oe_grey oe_inline\">如果最大重试次数是0，则重试次数是无限"
+#~ "的。</span>"
+
+#~ msgid "Override Channel"
+#~ msgstr "覆盖频道"
+
+#~ msgid "Number of unread messages"
+#~ msgstr "未读消息数量"

odoo-bringout-oca-queue-queue_job/queue_job/job.py

@@ -0,0 +1,962 @@
+# Copyright 2013-2020 Camptocamp
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import hashlib
+import inspect
+import logging
+import os
+import sys
+import uuid
+import weakref
+from datetime import datetime, timedelta
+from functools import total_ordering
+from random import randint
+
+import odoo
+
+from .exception import FailedJobError, NoSuchJobError, RetryableJobError
+
+WAIT_DEPENDENCIES = "wait_dependencies"
+PENDING = "pending"
+ENQUEUED = "enqueued"
+CANCELLED = "cancelled"
+DONE = "done"
+STARTED = "started"
+FAILED = "failed"
+
+STATES = [
+    (WAIT_DEPENDENCIES, "Wait Dependencies"),
+    (PENDING, "Pending"),
+    (ENQUEUED, "Enqueued"),
+    (STARTED, "Started"),
+    (DONE, "Done"),
+    (CANCELLED, "Cancelled"),
+    (FAILED, "Failed"),
+]
+
+DEFAULT_PRIORITY = 10  # used by the PriorityQueue to sort the jobs
+DEFAULT_MAX_RETRIES = 5
+RETRY_INTERVAL = 10 * 60  # seconds
+
+_logger = logging.getLogger(__name__)
+
+
+# TODO remove in 15.0 or 16.0, used to keep compatibility as the
+# class has been moved in 'delay'.
+def DelayableRecordset(*args, **kwargs):
+    # prevent circular import
+    from .delay import DelayableRecordset as dr
+
+    _logger.warning(
+        "DelayableRecordset moved from the queue_job.job"
+        " to the queue_job.delay python module"
+    )
+    return dr(*args, **kwargs)
+
+
+def identity_exact(job_):
+    """Identity function using the model, method and all arguments as key
+
+    When used, this identity key will have the effect that when a job should be
+    created and a pending job with the exact same recordset and arguments, the
+    second will not be created.
+
+    It should be used with the ``identity_key`` argument:
+
+    .. python::
+
+        from odoo.addons.queue_job.job import identity_exact
+
+        # [...]
+            delayable = self.with_delay(identity_key=identity_exact)
+            delayable.export_record(force=True)
+
+    Alternative identity keys can be built using the various fields of the job.
+    For example, you could compute a hash using only some arguments of
+    the job.
+
+    .. python::
+
+        def identity_example(job_):
+            hasher = hashlib.sha1()
+            hasher.update(job_.model_name)
+            hasher.update(job_.method_name)
+            hasher.update(str(sorted(job_.recordset.ids)))
+            hasher.update(str(job_.args[1]))
+            hasher.update(str(job_.kwargs.get('foo', '')))
+            return hasher.hexdigest()
+
+    Usually you will probably always want to include at least the name of the
+    model and method.
+    """
+    hasher = identity_exact_hasher(job_)
+    return hasher.hexdigest()
+
+
+def identity_exact_hasher(job_):
+    """Prepare hasher object for identity_exact."""
+    hasher = hashlib.sha1()
+    hasher.update(job_.model_name.encode("utf-8"))
+    hasher.update(job_.method_name.encode("utf-8"))
+    hasher.update(str(sorted(job_.recordset.ids)).encode("utf-8"))
+    hasher.update(str(job_.args).encode("utf-8"))
+    hasher.update(str(sorted(job_.kwargs.items())).encode("utf-8"))
+    return hasher
+
+
+@total_ordering
+class Job:
+    """A Job is a task to execute. It is the in-memory representation of a job.
+
+    Jobs are stored in the ``queue.job`` Odoo Model, but they are handled
+    through this class.
+
+    .. attribute:: uuid
+
+        Id (UUID) of the job.
+
+    .. attribute:: graph_uuid
+
+        Shared UUID of the job's graph. Empty if the job is a single job.
+
+    .. attribute:: state
+
+        State of the job, can pending, enqueued, started, done or failed.
+        The start state is pending and the final state is done.
+
+    .. attribute:: retry
+
+        The current try, starts at 0 and each time the job is executed,
+        it increases by 1.
+
+    .. attribute:: max_retries
+
+        The maximum number of retries allowed before the job is
+        considered as failed.
+
+    .. attribute:: args
+
+        Arguments passed to the function when executed.
+
+    .. attribute:: kwargs
+
+        Keyword arguments passed to the function when executed.
+
+    .. attribute:: description
+
+        Human description of the job.
+
+    .. attribute:: func
+
+        The python function itself.
+
+    .. attribute:: model_name
+
+        Odoo model on which the job will run.
+
+    .. attribute:: priority
+
+        Priority of the job, 0 being the higher priority.
+
+    .. attribute:: date_created
+
+        Date and time when the job was created.
+
+    .. attribute:: date_enqueued
+
+        Date and time when the job was enqueued.
+
+    .. attribute:: date_started
+
+        Date and time when the job was started.
+
+    .. attribute:: date_done
+
+        Date and time when the job was done.
+
+    .. attribute:: result
+
+        A description of the result (for humans).
+
+    .. attribute:: exc_name
+
+        Exception error name when the job failed.
+
+    .. attribute:: exc_message
+
+        Exception error message when the job failed.
+
+    .. attribute:: exc_info
+
+        Exception information (traceback) when the job failed.
+
+    .. attribute:: user_id
+
+        Odoo user id which created the job
+
+    .. attribute:: eta
+
+        Estimated Time of Arrival of the job. It will not be executed
+        before this date/time.
+
+    .. attribute:: recordset
+
+        Model recordset when we are on a delayed Model method
+
+    .. attribute::channel
+
+        The complete name of the channel to use to process the job. If
+        provided it overrides the one defined on the job's function.
+
+    .. attribute::identity_key
+
+        A key referencing the job, multiple job with the same key will not
+        be added to a channel if the existing job with the same key is not yet
+        started or executed.
+
+    """
+
+    @classmethod
+    def load(cls, env, job_uuid):
+        """Read a single job from the Database
+
+        Raise an error if the job is not found.
+        """
+        stored = cls.db_records_from_uuids(env, [job_uuid])
+        if not stored:
+            raise NoSuchJobError(
+                "Job %s does no longer exist in the storage." % job_uuid
+            )
+        return cls._load_from_db_record(stored)
+
+    @classmethod
+    def load_many(cls, env, job_uuids):
+        """Read jobs in batch from the Database
+
+        Jobs not found are ignored.
+        """
+        recordset = cls.db_records_from_uuids(env, job_uuids)
+        return {cls._load_from_db_record(record) for record in recordset}
+
+    def add_lock_record(self):
+        """
+        Create row in db to be locked while the job is being performed.
+        """
+        self.env.cr.execute(
+            """
+            INSERT INTO
+                queue_job_lock (id, queue_job_id)
+            SELECT
+                id, id
+            FROM
+                queue_job
+            WHERE
+                uuid = %s
+            ON CONFLICT(id)
+            DO NOTHING;
+        """,
+            [self.uuid],
+        )
+
+    def lock(self):
+        """
+        Lock row of job that is being performed
+
+        If a job cannot be locked,
+        it means that the job wasn't started,
+        a RetryableJobError is thrown.
+        """
+        self.env.cr.execute(
+            """
+            SELECT
+                *
+            FROM
+                queue_job_lock
+            WHERE
+                queue_job_id in (
+                    SELECT
+                        id
+                    FROM
+                        queue_job
+                    WHERE
+                        uuid = %s
+                        AND state='started'
+                )
+            FOR UPDATE;
+        """,
+            [self.uuid],
+        )
+
+        # 1 job should be locked
+        if 1 != len(self.env.cr.fetchall()):
+            raise RetryableJobError(
+                f"Trying to lock job that wasn't started, uuid: {self.uuid}"
+            )
+
+    @classmethod
+    def _load_from_db_record(cls, job_db_record):
+        stored = job_db_record
+
+        args = stored.args
+        kwargs = stored.kwargs
+        method_name = stored.method_name
+
+        recordset = stored.records
+        method = getattr(recordset, method_name)
+
+        eta = None
+        if stored.eta:
+            eta = stored.eta
+
+        job_ = cls(
+            method,
+            args=args,
+            kwargs=kwargs,
+            priority=stored.priority,
+            eta=eta,
+            job_uuid=stored.uuid,
+            description=stored.name,
+            channel=stored.channel,
+            identity_key=stored.identity_key,
+        )
+
+        if stored.date_created:
+            job_.date_created = stored.date_created
+
+        if stored.date_enqueued:
+            job_.date_enqueued = stored.date_enqueued
+
+        if stored.date_started:
+            job_.date_started = stored.date_started
+
+        if stored.date_done:
+            job_.date_done = stored.date_done
+
+        if stored.date_cancelled:
+            job_.date_cancelled = stored.date_cancelled
+
+        job_.state = stored.state
+        job_.graph_uuid = stored.graph_uuid if stored.graph_uuid else None
+        job_.result = stored.result if stored.result else None
+        job_.exc_info = stored.exc_info if stored.exc_info else None
+        job_.retry = stored.retry
+        job_.max_retries = stored.max_retries
+        if stored.company_id:
+            job_.company_id = stored.company_id.id
+        job_.identity_key = stored.identity_key
+        job_.worker_pid = stored.worker_pid
+
+        job_.__depends_on_uuids.update(stored.dependencies.get("depends_on", []))
+        job_.__reverse_depends_on_uuids.update(
+            stored.dependencies.get("reverse_depends_on", [])
+        )
+        return job_
+
+    def job_record_with_same_identity_key(self):
+        """Check if a job to be executed with the same key exists."""
+        existing = (
+            self.env["queue.job"]
+            .sudo()
+            .search(
+                [
+                    ("identity_key", "=", self.identity_key),
+                    ("state", "in", [WAIT_DEPENDENCIES, PENDING, ENQUEUED]),
+                ],
+                limit=1,
+            )
+        )
+        return existing
+
+    # TODO to deprecate (not called anymore)
+    @classmethod
+    def enqueue(
+        cls,
+        func,
+        args=None,
+        kwargs=None,
+        priority=None,
+        eta=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        """Create a Job and enqueue it in the queue. Return the job uuid.
+
+        This expects the arguments specific to the job to be already extracted
+        from the ones to pass to the job function.
+
+        If the identity key is the same than the one in a pending job,
+        no job is created and the existing job is returned
+
+        """
+        new_job = cls(
+            func=func,
+            args=args,
+            kwargs=kwargs,
+            priority=priority,
+            eta=eta,
+            max_retries=max_retries,
+            description=description,
+            channel=channel,
+            identity_key=identity_key,
+        )
+        return new_job._enqueue_job()
+
+    # TODO to deprecate (not called anymore)
+    def _enqueue_job(self):
+        if self.identity_key:
+            existing = self.job_record_with_same_identity_key()
+            if existing:
+                _logger.debug(
+                    "a job has not been enqueued due to having "
+                    "the same identity key (%s) than job %s",
+                    self.identity_key,
+                    existing.uuid,
+                )
+                return Job._load_from_db_record(existing)
+        self.store()
+        _logger.debug(
+            "enqueued %s:%s(*%r, **%r) with uuid: %s",
+            self.recordset,
+            self.method_name,
+            self.args,
+            self.kwargs,
+            self.uuid,
+        )
+        return self
+
+    @staticmethod
+    def db_record_from_uuid(env, job_uuid):
+        # TODO remove in 15.0 or 16.0
+        _logger.debug("deprecated, use 'db_records_from_uuids")
+        return Job.db_records_from_uuids(env, [job_uuid])
+
+    @staticmethod
+    def db_records_from_uuids(env, job_uuids):
+        model = env["queue.job"].sudo()
+        record = model.search([("uuid", "in", tuple(job_uuids))])
+        return record.with_env(env).sudo()
+
+    def __init__(
+        self,
+        func,
+        args=None,
+        kwargs=None,
+        priority=None,
+        eta=None,
+        job_uuid=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        """Create a Job
+
+        :param func: function to execute
+        :type func: function
+        :param args: arguments for func
+        :type args: tuple
+        :param kwargs: keyworkd arguments for func
+        :type kwargs: dict
+        :param priority: priority of the job,
+                         the smaller is the higher priority
+        :type priority: int
+        :param eta: the job can be executed only after this datetime
+                           (or now + timedelta)
+        :type eta: datetime or timedelta
+        :param job_uuid: UUID of the job
+        :param max_retries: maximum number of retries before giving up and set
+            the job state to 'failed'. A value of 0 means infinite retries.
+        :param description: human description of the job. If None, description
+            is computed from the function doc or name
+        :param channel: The complete channel name to use to process the job.
+        :param identity_key: A hash to uniquely identify a job, or a function
+                             that returns this hash (the function takes the job
+                             as argument)
+        """
+        if args is None:
+            args = ()
+        if isinstance(args, list):
+            args = tuple(args)
+        assert isinstance(args, tuple), "%s: args are not a tuple" % args
+        if kwargs is None:
+            kwargs = {}
+
+        assert isinstance(kwargs, dict), "%s: kwargs are not a dict" % kwargs
+
+        if not _is_model_method(func):
+            raise TypeError("Job accepts only methods of Models")
+
+        recordset = func.__self__
+        env = recordset.env
+        self.method_name = func.__name__
+        self.recordset = recordset
+
+        self.env = env
+        self.job_model = self.env["queue.job"]
+        self.job_model_name = "queue.job"
+
+        self.job_config = (
+            self.env["queue.job.function"].sudo().job_config(self.job_function_name)
+        )
+
+        self.state = PENDING
+
+        self.retry = 0
+        if max_retries is None:
+            self.max_retries = DEFAULT_MAX_RETRIES
+        else:
+            self.max_retries = max_retries
+
+        self._uuid = job_uuid
+        self.graph_uuid = None
+
+        self.args = args
+        self.kwargs = kwargs
+
+        self.__depends_on_uuids = set()
+        self.__reverse_depends_on_uuids = set()
+        self._depends_on = set()
+        self._reverse_depends_on = weakref.WeakSet()
+
+        self.priority = priority
+        if self.priority is None:
+            self.priority = DEFAULT_PRIORITY
+
+        self.date_created = datetime.now()
+        self._description = description
+
+        if isinstance(identity_key, str):
+            self._identity_key = identity_key
+            self._identity_key_func = None
+        else:
+            # we'll compute the key on the fly when called
+            # from the function
+            self._identity_key = None
+            self._identity_key_func = identity_key
+
+        self.date_enqueued = None
+        self.date_started = None
+        self.date_done = None
+        self.date_cancelled = None
+
+        self.result = None
+        self.exc_name = None
+        self.exc_message = None
+        self.exc_info = None
+
+        if "company_id" in env.context:
+            company_id = env.context["company_id"]
+        else:
+            company_id = env.company.id
+        self.company_id = company_id
+        self._eta = None
+        self.eta = eta
+        self.channel = channel
+        self.worker_pid = None
+
+    def add_depends(self, jobs):
+        if self in jobs:
+            raise ValueError("job cannot depend on itself")
+        self.__depends_on_uuids |= {j.uuid for j in jobs}
+        self._depends_on.update(jobs)
+        for parent in jobs:
+            parent.__reverse_depends_on_uuids.add(self.uuid)
+            parent._reverse_depends_on.add(self)
+        if any(j.state != DONE for j in jobs):
+            self.state = WAIT_DEPENDENCIES
+
+    def perform(self):
+        """Execute the job.
+
+        The job is executed with the user which has initiated it.
+        """
+        self.retry += 1
+        try:
+            self.result = self.func(*tuple(self.args), **self.kwargs)
+        except RetryableJobError as err:
+            if err.ignore_retry:
+                self.retry -= 1
+                raise
+            elif not self.max_retries:  # infinite retries
+                raise
+            elif self.retry >= self.max_retries:
+                type_, value, traceback = sys.exc_info()
+                # change the exception type but keep the original
+                # traceback and message:
+                # http://blog.ianbicking.org/2007/09/12/re-raising-exceptions/
+                new_exc = FailedJobError(
+                    "Max. retries (%d) reached: %s" % (self.max_retries, value or type_)
+                )
+                raise new_exc from err
+            raise
+
+        return self.result
+
+    def _get_common_dependent_jobs_query(self):
+        return """
+            UPDATE queue_job
+            SET state = %s
+            FROM (
+            SELECT child.id, array_agg(parent.state) as parent_states
+            FROM queue_job job
+            JOIN LATERAL
+              json_array_elements_text(
+                  job.dependencies::json->'reverse_depends_on'
+              ) child_deps ON true
+            JOIN queue_job child
+            ON child.graph_uuid = job.graph_uuid
+            AND child.uuid = child_deps
+            JOIN LATERAL
+                json_array_elements_text(
+                  child.dependencies::json->'depends_on'
+                ) parent_deps ON true
+            JOIN queue_job parent
+            ON parent.graph_uuid = job.graph_uuid
+            AND parent.uuid = parent_deps
+            WHERE job.uuid = %s
+            GROUP BY child.id
+            ) jobs
+            WHERE
+            queue_job.id = jobs.id
+            AND %s = ALL(jobs.parent_states)
+            AND state = %s;
+        """
+
+    def enqueue_waiting(self):
+        sql = self._get_common_dependent_jobs_query()
+        self.env.cr.execute(sql, (PENDING, self.uuid, DONE, WAIT_DEPENDENCIES))
+        self.env["queue.job"].invalidate_model(["state"])
+
+    def cancel_dependent_jobs(self):
+        sql = self._get_common_dependent_jobs_query()
+        self.env.cr.execute(sql, (CANCELLED, self.uuid, CANCELLED, WAIT_DEPENDENCIES))
+        self.env["queue.job"].invalidate_model(["state"])
+
+    def store(self):
+        """Store the Job"""
+        job_model = self.env["queue.job"]
+        # The sentinel is used to prevent edition sensitive fields (such as
+        # method_name) from RPC methods.
+        edit_sentinel = job_model.EDIT_SENTINEL
+
+        db_record = self.db_record()
+        if db_record:
+            db_record.with_context(_job_edit_sentinel=edit_sentinel).write(
+                self._store_values()
+            )
+        else:
+            job_model.with_context(_job_edit_sentinel=edit_sentinel).sudo().create(
+                self._store_values(create=True)
+            )
+
+    def _store_values(self, create=False):
+        vals = {
+            "state": self.state,
+            "priority": self.priority,
+            "retry": self.retry,
+            "max_retries": self.max_retries,
+            "exc_name": self.exc_name,
+            "exc_message": self.exc_message,
+            "exc_info": self.exc_info,
+            "company_id": self.company_id,
+            "result": str(self.result) if self.result else False,
+            "date_enqueued": False,
+            "date_started": False,
+            "date_done": False,
+            "exec_time": False,
+            "date_cancelled": False,
+            "eta": False,
+            "identity_key": False,
+            "worker_pid": self.worker_pid,
+            "graph_uuid": self.graph_uuid,
+        }
+
+        if self.date_enqueued:
+            vals["date_enqueued"] = self.date_enqueued
+        if self.date_started:
+            vals["date_started"] = self.date_started
+        if self.date_done:
+            vals["date_done"] = self.date_done
+        if self.exec_time:
+            vals["exec_time"] = self.exec_time
+        if self.date_cancelled:
+            vals["date_cancelled"] = self.date_cancelled
+        if self.eta:
+            vals["eta"] = self.eta
+        if self.identity_key:
+            vals["identity_key"] = self.identity_key
+
+        dependencies = {
+            "depends_on": [parent.uuid for parent in self.depends_on],
+            "reverse_depends_on": [
+                children.uuid for children in self.reverse_depends_on
+            ],
+        }
+        vals["dependencies"] = dependencies
+
+        if create:
+            vals.update(
+                {
+                    "user_id": self.env.uid,
+                    "channel": self.channel,
+                    # The following values must never be modified after the
+                    # creation of the job
+                    "uuid": self.uuid,
+                    "name": self.description,
+                    "func_string": self.func_string,
+                    "date_created": self.date_created,
+                    "model_name": self.recordset._name,
+                    "method_name": self.method_name,
+                    "job_function_id": self.job_config.job_function_id,
+                    "channel_method_name": self.job_function_name,
+                    "records": self.recordset,
+                    "args": self.args,
+                    "kwargs": self.kwargs,
+                }
+            )
+
+        vals_from_model = self._store_values_from_model()
+        # Sanitize values: make sure you cannot screw core values
+        vals_from_model = {k: v for k, v in vals_from_model.items() if k not in vals}
+        vals.update(vals_from_model)
+        return vals
+
+    def _store_values_from_model(self):
+        vals = {}
+        value_handlers_candidates = (
+            "_job_store_values_for_" + self.method_name,
+            "_job_store_values",
+        )
+        for candidate in value_handlers_candidates:
+            handler = getattr(self.recordset, candidate, None)
+            if handler is not None:
+                vals = handler(self)
+        return vals
+
+    @property
+    def func_string(self):
+        model = repr(self.recordset)
+        args = [repr(arg) for arg in self.args]
+        kwargs = ["{}={!r}".format(key, val) for key, val in self.kwargs.items()]
+        all_args = ", ".join(args + kwargs)
+        return "{}.{}({})".format(model, self.method_name, all_args)
+
+    def __eq__(self, other):
+        return self.uuid == other.uuid
+
+    def __hash__(self):
+        return self.uuid.__hash__()
+
+    def sorting_key(self):
+        return self.eta, self.priority, self.date_created, self.seq
+
+    def __lt__(self, other):
+        if self.eta and not other.eta:
+            return True
+        elif not self.eta and other.eta:
+            return False
+        return self.sorting_key() < other.sorting_key()
+
+    def db_record(self):
+        return self.db_records_from_uuids(self.env, [self.uuid])
+
+    @property
+    def func(self):
+        recordset = self.recordset.with_context(job_uuid=self.uuid)
+        return getattr(recordset, self.method_name)
+
+    @property
+    def job_function_name(self):
+        func_model = self.env["queue.job.function"].sudo()
+        return func_model.job_function_name(self.recordset._name, self.method_name)
+
+    @property
+    def identity_key(self):
+        if self._identity_key is None:
+            if self._identity_key_func:
+                self._identity_key = self._identity_key_func(self)
+        return self._identity_key
+
+    @identity_key.setter
+    def identity_key(self, value):
+        if isinstance(value, str):
+            self._identity_key = value
+            self._identity_key_func = None
+        else:
+            # we'll compute the key on the fly when called
+            # from the function
+            self._identity_key = None
+            self._identity_key_func = value
+
+    @property
+    def depends_on(self):
+        if not self._depends_on:
+            self._depends_on = Job.load_many(self.env, self.__depends_on_uuids)
+        return self._depends_on
+
+    @property
+    def reverse_depends_on(self):
+        if not self._reverse_depends_on:
+            self._reverse_depends_on = Job.load_many(
+                self.env, self.__reverse_depends_on_uuids
+            )
+        return set(self._reverse_depends_on)
+
+    @property
+    def description(self):
+        if self._description:
+            return self._description
+        elif self.func.__doc__:
+            return self.func.__doc__.splitlines()[0].strip()
+        else:
+            return "{}.{}".format(self.model_name, self.func.__name__)
+
+    @property
+    def uuid(self):
+        """Job ID, this is an UUID"""
+        if self._uuid is None:
+            self._uuid = str(uuid.uuid4())
+        return self._uuid
+
+    @property
+    def model_name(self):
+        return self.recordset._name
+
+    @property
+    def user_id(self):
+        return self.recordset.env.uid
+
+    @property
+    def eta(self):
+        return self._eta
+
+    @eta.setter
+    def eta(self, value):
+        if not value:
+            self._eta = None
+        elif isinstance(value, timedelta):
+            self._eta = datetime.now() + value
+        elif isinstance(value, int):
+            self._eta = datetime.now() + timedelta(seconds=value)
+        else:
+            self._eta = value
+
+    @property
+    def channel(self):
+        return self._channel or self.job_config.channel
+
+    @channel.setter
+    def channel(self, value):
+        self._channel = value
+
+    @property
+    def exec_time(self):
+        if self.date_done and self.date_started:
+            return (self.date_done - self.date_started).total_seconds()
+        return None
+
+    def set_pending(self, result=None, reset_retry=True):
+        if any(j.state != DONE for j in self.depends_on):
+            self.state = WAIT_DEPENDENCIES
+        else:
+            self.state = PENDING
+        self.date_enqueued = None
+        self.date_started = None
+        self.date_done = None
+        self.worker_pid = None
+        self.date_cancelled = None
+        if reset_retry:
+            self.retry = 0
+        if result is not None:
+            self.result = result
+
+    def set_enqueued(self):
+        self.state = ENQUEUED
+        self.date_enqueued = datetime.now()
+        self.date_started = None
+        self.worker_pid = None
+
+    def set_started(self):
+        self.state = STARTED
+        self.date_started = datetime.now()
+        self.worker_pid = os.getpid()
+        self.add_lock_record()
+
+    def set_done(self, result=None):
+        self.state = DONE
+        self.exc_name = None
+        self.exc_info = None
+        self.date_done = datetime.now()
+        if result is not None:
+            self.result = result
+
+    def set_cancelled(self, result=None):
+        self.state = CANCELLED
+        self.date_cancelled = datetime.now()
+        if result is not None:
+            self.result = result
+
+    def set_failed(self, **kw):
+        self.state = FAILED
+        for k, v in kw.items():
+            if v is not None:
+                setattr(self, k, v)
+
+    def __repr__(self):
+        return "<Job %s, priority:%d>" % (self.uuid, self.priority)
+
+    def _get_retry_seconds(self, seconds=None):
+        retry_pattern = self.job_config.retry_pattern
+        if not seconds and retry_pattern:
+            # ordered from higher to lower count of retries
+            patt = sorted(retry_pattern.items(), key=lambda t: t[0])
+            seconds = RETRY_INTERVAL
+            for retry_count, postpone_seconds in patt:
+                if self.retry >= retry_count:
+                    seconds = postpone_seconds
+                else:
+                    break
+        elif not seconds:
+            seconds = RETRY_INTERVAL
+        if isinstance(seconds, (list, tuple)):
+            seconds = randint(seconds[0], seconds[1])
+        return seconds
+
+    def postpone(self, result=None, seconds=None):
+        """Postpone the job
+
+        Write an estimated time arrival to n seconds
+        later than now. Used when an retryable exception
+        want to retry a job later.
+        """
+        eta_seconds = self._get_retry_seconds(seconds)
+        self.eta = timedelta(seconds=eta_seconds)
+        self.exc_name = None
+        self.exc_info = None
+        if result is not None:
+            self.result = result
+
+    def related_action(self):
+        record = self.db_record()
+        if not self.job_config.related_action_enable:
+            return None
+
+        funcname = self.job_config.related_action_func_name
+        if not funcname:
+            funcname = record._default_related_action
+        if not isinstance(funcname, str):
+            raise ValueError(
+                "related_action must be the name of the "
+                "method on queue.job as string"
+            )
+        action = getattr(record, funcname)
+        action_kwargs = self.job_config.related_action_kwargs
+        return action(**action_kwargs)
+
+
+def _is_model_method(func):
+    return inspect.ismethod(func) and isinstance(
+        func.__self__.__class__, odoo.models.MetaModel
+    )

odoo-bringout-oca-queue-queue_job/queue_job/jobrunner/__init__.py

@@ -0,0 +1,163 @@
+# Copyright (c) 2015-2016 ACSONE SA/NV (<http://acsone.eu>)
+# Copyright 2016 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import logging
+from threading import Thread
+import time
+
+from odoo.service import server
+from odoo.tools import config
+
+try:
+    from odoo.addons.server_environment import serv_config
+
+    if serv_config.has_section("queue_job"):
+        queue_job_config = serv_config["queue_job"]
+    else:
+        queue_job_config = {}
+except ImportError:
+    queue_job_config = config.misc.get("queue_job", {})
+
+
+from .runner import QueueJobRunner, _channels
+
+_logger = logging.getLogger(__name__)
+
+START_DELAY = 5
+
+
+# Here we monkey patch the Odoo server to start the job runner thread
+# in the main server process (and not in forked workers). This is
+# very easy to deploy as we don't need another startup script.
+
+
+class QueueJobRunnerThread(Thread):
+    def __init__(self):
+        Thread.__init__(self)
+        self.daemon = True
+        self.runner = QueueJobRunner.from_environ_or_config()
+
+    def run(self):
+        # sleep a bit to let the workers start at ease
+        time.sleep(START_DELAY)
+        self.runner.run()
+
+    def stop(self):
+        self.runner.stop()
+
+
+class WorkerJobRunner(server.Worker):
+    """Jobrunner workers"""
+
+    def __init__(self, multi):
+        super().__init__(multi)
+        self.watchdog_timeout = None
+        self.runner = QueueJobRunner.from_environ_or_config()
+        self._recover = False
+
+    def sleep(self):
+        pass
+
+    def signal_handler(self, sig, frame):  # pylint: disable=missing-return
+        _logger.debug("WorkerJobRunner (%s) received signal %s", self.pid, sig)
+        super().signal_handler(sig, frame)
+        self.runner.stop()
+
+    def process_work(self):
+        if self._recover:
+            _logger.info("WorkerJobRunner (%s) runner is reinitialized", self.pid)
+            self.runner = QueueJobRunner.from_environ_or_config()
+            self._recover = False
+        _logger.debug("WorkerJobRunner (%s) starting up", self.pid)
+        time.sleep(START_DELAY)
+        self.runner.run()
+
+    def signal_time_expired_handler(self, n, stack):
+        _logger.info(
+            "Worker (%d) CPU time limit (%s) reached.Stop gracefully and recover",
+            self.pid,
+            config["limit_time_cpu"],
+        )
+        self._recover = True
+        self.runner.stop()
+
+
+runner_thread = None
+
+
+def _is_runner_enabled():
+    return not _channels().strip().startswith("root:0")
+
+
+def _start_runner_thread(server_type):
+    global runner_thread
+    if not config["stop_after_init"]:
+        if _is_runner_enabled():
+            _logger.info("starting jobrunner thread (in %s)", server_type)
+            runner_thread = QueueJobRunnerThread()
+            runner_thread.start()
+        else:
+            _logger.info(
+                "jobrunner thread (in %s) NOT started, "
+                "because the root channel's capacity is set to 0",
+                server_type,
+            )
+
+
+orig_prefork__init__ = server.PreforkServer.__init__
+orig_prefork_process_spawn = server.PreforkServer.process_spawn
+orig_prefork_worker_pop = server.PreforkServer.worker_pop
+orig_threaded_start = server.ThreadedServer.start
+orig_threaded_stop = server.ThreadedServer.stop
+
+
+def prefork__init__(server, app):
+    res = orig_prefork__init__(server, app)
+    server.jobrunner = {}
+    return res
+
+
+def prefork_process_spawn(server):
+    orig_prefork_process_spawn(server)
+    if not hasattr(server, "jobrunner"):
+        # if 'queue_job' is not in server wide modules, PreforkServer is
+        # not initialized with a 'jobrunner' attribute, skip this
+        return
+    if not server.jobrunner and _is_runner_enabled():
+        server.worker_spawn(WorkerJobRunner, server.jobrunner)
+
+
+def prefork_worker_pop(server, pid):
+    res = orig_prefork_worker_pop(server, pid)
+    if not hasattr(server, "jobrunner"):
+        # if 'queue_job' is not in server wide modules, PreforkServer is
+        # not initialized with a 'jobrunner' attribute, skip this
+        return res
+    if pid in server.jobrunner:
+        server.jobrunner.pop(pid)
+    return res
+
+
+def threaded_start(server, *args, **kwargs):
+    res = orig_threaded_start(server, *args, **kwargs)
+    _start_runner_thread("threaded server")
+    return res
+
+
+def threaded_stop(server):
+    global runner_thread
+    if runner_thread:
+        runner_thread.stop()
+    res = orig_threaded_stop(server)
+    if runner_thread:
+        runner_thread.join()
+        runner_thread = None
+    return res
+
+
+server.PreforkServer.__init__ = prefork__init__
+server.PreforkServer.process_spawn = prefork_process_spawn
+server.PreforkServer.worker_pop = prefork_worker_pop
+server.ThreadedServer.start = threaded_start
+server.ThreadedServer.stop = threaded_stop

odoo-bringout-oca-queue-queue_job/queue_job/jobrunner/__main__.py

@@ -0,0 +1,13 @@
+import odoo
+
+from .runner import QueueJobRunner
+
+
+def main():
+    odoo.tools.config.parse_config()
+    runner = QueueJobRunner.from_environ_or_config()
+    runner.run()
+
+
+if __name__ == "__main__":
+    main()

odoo-bringout-oca-queue-queue_job/queue_job/jobrunner/runner.py

@@ -0,0 +1,618 @@
+# Copyright (c) 2015-2016 ACSONE SA/NV (<http://acsone.eu>)
+# Copyright 2015-2016 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+"""
+What is the job runner?
+-----------------------
+The job runner is the main process managing the dispatch of delayed jobs to
+available Odoo workers
+
+How does it work?
+-----------------
+
+* It starts as a thread in the Odoo main process or as a new worker
+* It receives postgres NOTIFY messages each time jobs are
+  added or updated in the queue_job table.
+* It maintains an in-memory priority queue of jobs that
+  is populated from the queue_job tables in all databases.
+* It does not run jobs itself, but asks Odoo to run them through an
+  anonymous ``/queue_job/runjob`` HTTP request. [1]_
+
+How to use it?
+--------------
+
+* Optionally adjust your configuration through environment variables:
+
+  - ``ODOO_QUEUE_JOB_CHANNELS=root:4`` (or any other channels
+    configuration), default ``root:1``.
+  - ``ODOO_QUEUE_JOB_SCHEME=https``, default ``http``.
+  - ``ODOO_QUEUE_JOB_HOST=load-balancer``, default ``http_interface``
+    or ``localhost`` if unset.
+  - ``ODOO_QUEUE_JOB_PORT=443``, default ``http_port`` or 8069 if unset.
+  - ``ODOO_QUEUE_JOB_HTTP_AUTH_USER=jobrunner``, default empty.
+  - ``ODOO_QUEUE_JOB_HTTP_AUTH_PASSWORD=s3cr3t``, default empty.
+  - ``ODOO_QUEUE_JOB_JOBRUNNER_DB_HOST=master-db``, default ``db_host``
+    or ``False`` if unset.
+  - ``ODOO_QUEUE_JOB_JOBRUNNER_DB_PORT=5432``, default ``db_port``
+    or ``False`` if unset.
+  - ``ODOO_QUEUE_JOB_JOBRUNNER_DB_USER=userdb``, default ``db_user``
+    or ``False`` if unset.
+  - ``ODOO_QUEUE_JOB_JOBRUNNER_DB_PASSWORD=passdb``, default ``db_password``
+    or ``False`` if unset.
+
+* Alternatively, configure the channels through the Odoo configuration
+  file, like:
+
+.. code-block:: ini
+
+  [queue_job]
+  channels = root:4
+  scheme = https
+  host = load-balancer
+  port = 443
+  http_auth_user = jobrunner
+  http_auth_password = s3cr3t
+  jobrunner_db_host = master-db
+  jobrunner_db_port = 5432
+  jobrunner_db_user = userdb
+  jobrunner_db_password = passdb
+
+* Or, if using ``anybox.recipe.odoo``, add this to your buildout configuration:
+
+.. code-block:: ini
+
+  [odoo]
+  recipe = anybox.recipe.odoo
+  (...)
+  queue_job.channels = root:4
+  queue_job.scheme = https
+  queue_job.host = load-balancer
+  queue_job.port = 443
+  queue_job.http_auth_user = jobrunner
+  queue_job.http_auth_password = s3cr3t
+
+* Start Odoo with ``--load=web,web_kanban,queue_job``
+  and ``--workers`` greater than 1 [2]_, or set the ``server_wide_modules``
+  option in The Odoo configuration file:
+
+.. code-block:: ini
+
+  [options]
+  (...)
+  workers = 4
+  server_wide_modules = web,web_kanban,queue_job
+  (...)
+
+* Or, if using ``anybox.recipe.odoo``:
+
+.. code-block:: ini
+
+  [odoo]
+  recipe = anybox.recipe.odoo
+  (...)
+  options.workers = 4
+  options.server_wide_modules = web,web_kanban,queue_job
+
+* Confirm the runner is starting correctly by checking the odoo log file:
+
+.. code-block:: none
+
+  ...INFO...queue_job.jobrunner.runner: starting
+  ...INFO...queue_job.jobrunner.runner: initializing database connections
+  ...INFO...queue_job.jobrunner.runner: queue job runner ready for db <dbname>
+  ...INFO...queue_job.jobrunner.runner: database connections ready
+
+* Create jobs (eg using base_import_async) and observe they
+  start immediately and in parallel.
+
+* Tip: to enable debug logging for the queue job, use
+  ``--log-handler=odoo.addons.queue_job:DEBUG``
+
+Caveat
+------
+
+* After creating a new database or installing queue_job on an
+  existing database, Odoo must be restarted for the runner to detect it.
+
+.. rubric:: Footnotes
+
+.. [1] From a security standpoint, it is safe to have an anonymous HTTP
+       request because this request only accepts to run jobs that are
+       enqueued.
+.. [2] It works with the threaded Odoo server too, although this way
+       of running Odoo is obviously not for production purposes.
+"""
+
+import datetime
+import logging
+import os
+import selectors
+import threading
+import time
+from contextlib import closing, contextmanager
+
+import psycopg2
+import requests
+from psycopg2.extensions import ISOLATION_LEVEL_AUTOCOMMIT
+
+import odoo
+from odoo.tools import config
+
+from . import queue_job_config
+from .channels import ENQUEUED, NOT_DONE, ChannelManager
+
+SELECT_TIMEOUT = 60
+ERROR_RECOVERY_DELAY = 5
+PG_ADVISORY_LOCK_ID = 2293787760715711918
+
+_logger = logging.getLogger(__name__)
+
+select = selectors.DefaultSelector
+
+
+class MasterElectionLost(Exception):
+    pass
+
+
+# Unfortunately, it is not possible to extend the Odoo
+# server command line arguments, so we resort to environment variables
+# to configure the runner (channels mostly).
+#
+# On the other hand, the odoo configuration file can be extended at will,
+# so we check it in addition to the environment variables.
+
+
+def _channels():
+    return (
+        os.environ.get("ODOO_QUEUE_JOB_CHANNELS")
+        or queue_job_config.get("channels")
+        or "root:1"
+    )
+
+
+def _datetime_to_epoch(dt):
+    # important: this must return the same as postgresql
+    # EXTRACT(EPOCH FROM TIMESTAMP dt)
+    return (dt - datetime.datetime(1970, 1, 1)).total_seconds()
+
+
+def _odoo_now():
+    dt = datetime.datetime.utcnow()
+    return _datetime_to_epoch(dt)
+
+
+def _connection_info_for(db_name):
+    db_or_uri, connection_info = odoo.sql_db.connection_info_for(db_name)
+
+    for p in ("host", "port", "user", "password"):
+        cfg = os.environ.get(
+            "ODOO_QUEUE_JOB_JOBRUNNER_DB_%s" % p.upper()
+        ) or queue_job_config.get("jobrunner_db_" + p)
+
+        if cfg:
+            connection_info[p] = cfg
+
+    return connection_info
+
+
+def _async_http_get(scheme, host, port, user, password, db_name, job_uuid):
+    # TODO: better way to HTTP GET asynchronously (grequest, ...)?
+    #       if this was python3 I would be doing this with
+    #       asyncio, aiohttp and aiopg
+    def urlopen():
+        url = "{}://{}:{}/queue_job/runjob?db={}&job_uuid={}".format(
+            scheme, host, port, db_name, job_uuid
+        )
+        # pylint: disable=except-pass
+        try:
+            auth = None
+            if user:
+                auth = (user, password)
+            # we are not interested in the result, so we set a short timeout
+            # but not too short so we trap and log hard configuration errors
+            response = requests.get(url, timeout=1, auth=auth)
+
+            # raise_for_status will result in either nothing, a Client Error
+            # for HTTP Response codes between 400 and 500 or a Server Error
+            # for codes between 500 and 600
+            response.raise_for_status()
+        except requests.Timeout:
+            # A timeout is a normal behaviour, it shouldn't be logged as an exception
+            pass
+        except Exception:
+            _logger.exception("exception in GET %s", url)
+
+    thread = threading.Thread(target=urlopen)
+    thread.daemon = True
+    thread.start()
+
+
+class Database:
+    def __init__(self, db_name):
+        self.db_name = db_name
+        connection_info = _connection_info_for(db_name)
+        self.conn = psycopg2.connect(**connection_info)
+        try:
+            self.conn.set_isolation_level(ISOLATION_LEVEL_AUTOCOMMIT)
+            self.has_queue_job = self._has_queue_job()
+            if self.has_queue_job:
+                self._acquire_master_lock()
+                self._initialize()
+        except BaseException:
+            self.close()
+            raise
+
+    def close(self):
+        # pylint: disable=except-pass
+        # if close fail for any reason, it's either because it's already closed
+        # and we don't care, or for any reason but anyway it will be closed on
+        # del
+        try:
+            self.conn.close()
+        except Exception:
+            pass
+        self.conn = None
+
+    def _acquire_master_lock(self):
+        """Acquire the master runner lock or raise MasterElectionLost"""
+        with closing(self.conn.cursor()) as cr:
+            cr.execute("SELECT pg_try_advisory_lock(%s)", (PG_ADVISORY_LOCK_ID,))
+            if not cr.fetchone()[0]:
+                msg = f"could not acquire master runner lock on {self.db_name}"
+                raise MasterElectionLost(msg)
+
+    def _has_queue_job(self):
+        with closing(self.conn.cursor()) as cr:
+            cr.execute(
+                "SELECT 1 FROM pg_tables WHERE tablename=%s", ("ir_module_module",)
+            )
+            if not cr.fetchone():
+                _logger.debug("%s doesn't seem to be an odoo db", self.db_name)
+                return False
+            cr.execute(
+                "SELECT 1 FROM ir_module_module WHERE name=%s AND state=%s",
+                ("queue_job", "installed"),
+            )
+            if not cr.fetchone():
+                _logger.debug("queue_job is not installed for db %s", self.db_name)
+                return False
+            cr.execute(
+                """SELECT COUNT(1)
+                FROM information_schema.triggers
+                WHERE event_object_table = %s
+                AND trigger_name = %s""",
+                ("queue_job", "queue_job_notify"),
+            )
+            if cr.fetchone()[0] != 3:  # INSERT, DELETE, UPDATE
+                _logger.error(
+                    "queue_job_notify trigger is missing in db %s", self.db_name
+                )
+                return False
+            return True
+
+    def _initialize(self):
+        with closing(self.conn.cursor()) as cr:
+            cr.execute("LISTEN queue_job")
+
+    @contextmanager
+    def select_jobs(self, where, args):
+        # pylint: disable=sql-injection
+        # the checker thinks we are injecting values but we are not, we are
+        # adding the where conditions, values are added later properly with
+        # parameters
+        query = (
+            "SELECT channel, uuid, id as seq, date_created, "
+            "priority, EXTRACT(EPOCH FROM eta), state "
+            "FROM queue_job WHERE %s" % (where,)
+        )
+        with closing(self.conn.cursor("select_jobs", withhold=True)) as cr:
+            cr.execute(query, args)
+            yield cr
+
+    def keep_alive(self):
+        query = "SELECT 1"
+        with closing(self.conn.cursor()) as cr:
+            cr.execute(query)
+
+    def set_job_enqueued(self, uuid):
+        with closing(self.conn.cursor()) as cr:
+            cr.execute(
+                "UPDATE queue_job SET state=%s, "
+                "date_enqueued=date_trunc('seconds', "
+                "                         now() at time zone 'utc') "
+                "WHERE uuid=%s",
+                (ENQUEUED, uuid),
+            )
+
+    def _query_requeue_dead_jobs(self):
+        return """
+            UPDATE
+                queue_job
+            SET
+                state=(
+                    CASE
+                        WHEN
+                            max_retries IS NOT NULL AND
+                            max_retries != 0 AND -- infinite retries if max_retries is 0
+                            retry IS NOT NULL AND
+                            retry>max_retries
+                        THEN 'failed'
+                        ELSE 'pending'
+                    END),
+                retry=(CASE WHEN state='started' THEN COALESCE(retry,0)+1 ELSE retry END),
+                exc_name=(
+                    CASE
+                        WHEN
+                            max_retries IS NOT NULL AND
+                            max_retries != 0 AND -- infinite retries if max_retries is 0
+                            retry IS NOT NULL AND
+                            retry>max_retries
+                        THEN 'JobFoundDead'
+                        ELSE exc_name
+                    END),
+                exc_info=(
+                    CASE
+                        WHEN
+                            max_retries IS NOT NULL AND
+                            max_retries != 0 AND -- infinite retries if max_retries is 0
+                            retry IS NOT NULL AND
+                            retry>max_retries
+                        THEN 'Job found dead after too many retries'
+                        ELSE exc_info
+                    END)
+            WHERE
+                id in (
+                    SELECT
+                        queue_job_id
+                    FROM
+                        queue_job_lock
+                    WHERE
+                        queue_job_id in (
+                            SELECT
+                                id
+                            FROM
+                                queue_job
+                            WHERE
+                                state IN ('enqueued','started')
+                                AND date_enqueued <
+                                (now() AT TIME ZONE 'utc' - INTERVAL '10 sec')
+                        )
+                    FOR UPDATE SKIP LOCKED
+                )
+            RETURNING uuid
+            """
+
+    def requeue_dead_jobs(self):
+        """
+        Set started and enqueued jobs but not locked to pending
+
+        A job is locked when it's being executed
+        When a job is killed, it releases the lock
+
+        If the number of retries exceeds the number of max retries,
+        the job is set as 'failed' with the error 'JobFoundDead'.
+
+        Adding a buffer on 'date_enqueued' to check
+        that it has been enqueued for more than 10sec.
+        This prevents from requeuing jobs before they are actually started.
+
+        When Odoo shuts down normally, it waits for running jobs to finish.
+        However, when the Odoo server crashes or is otherwise force-stopped,
+        running jobs are interrupted while the runner has no chance to know
+        they have been aborted.
+        """
+
+        with closing(self.conn.cursor()) as cr:
+            query = self._query_requeue_dead_jobs()
+
+            cr.execute(query)
+
+            for (uuid,) in cr.fetchall():
+                _logger.warning("Re-queued dead job with uuid: %s", uuid)
+
+
+class QueueJobRunner:
+    def __init__(
+        self,
+        scheme="http",
+        host="localhost",
+        port=8069,
+        user=None,
+        password=None,
+        channel_config_string=None,
+    ):
+        self.scheme = scheme
+        self.host = host
+        self.port = port
+        self.user = user
+        self.password = password
+        self.channel_manager = ChannelManager()
+        if channel_config_string is None:
+            channel_config_string = _channels()
+        self.channel_manager.simple_configure(channel_config_string)
+        self.db_by_name = {}
+        self._stop = False
+        self._stop_pipe = os.pipe()
+
+    @classmethod
+    def from_environ_or_config(cls):
+        scheme = os.environ.get("ODOO_QUEUE_JOB_SCHEME") or queue_job_config.get(
+            "scheme"
+        )
+        host = (
+            os.environ.get("ODOO_QUEUE_JOB_HOST")
+            or queue_job_config.get("host")
+            or config["http_interface"]
+        )
+        port = (
+            os.environ.get("ODOO_QUEUE_JOB_PORT")
+            or queue_job_config.get("port")
+            or config["http_port"]
+        )
+        user = os.environ.get("ODOO_QUEUE_JOB_HTTP_AUTH_USER") or queue_job_config.get(
+            "http_auth_user"
+        )
+        password = os.environ.get(
+            "ODOO_QUEUE_JOB_HTTP_AUTH_PASSWORD"
+        ) or queue_job_config.get("http_auth_password")
+        runner = cls(
+            scheme=scheme or "http",
+            host=host or "localhost",
+            port=port or 8069,
+            user=user,
+            password=password,
+        )
+        return runner
+
+    def get_db_names(self):
+        if config["db_name"]:
+            db_names = config["db_name"].split(",")
+        else:
+            db_names = odoo.service.db.list_dbs(True)
+        return db_names
+
+    def close_databases(self, remove_jobs=True):
+        for db_name, db in self.db_by_name.items():
+            try:
+                if remove_jobs:
+                    self.channel_manager.remove_db(db_name)
+                db.close()
+            except Exception:
+                _logger.warning("error closing database %s", db_name, exc_info=True)
+        self.db_by_name = {}
+
+    def initialize_databases(self):
+        for db_name in sorted(self.get_db_names()):
+            # sorting is important to avoid deadlocks in acquiring the master lock
+            db = Database(db_name)
+            if db.has_queue_job:
+                self.db_by_name[db_name] = db
+                with db.select_jobs("state in %s", (NOT_DONE,)) as cr:
+                    for job_data in cr:
+                        self.channel_manager.notify(db_name, *job_data)
+                _logger.info("queue job runner ready for db %s", db_name)
+            else:
+                db.close()
+
+    def requeue_dead_jobs(self):
+        for db in self.db_by_name.values():
+            if db.has_queue_job:
+                db.requeue_dead_jobs()
+
+    def run_jobs(self):
+        now = _odoo_now()
+        for job in self.channel_manager.get_jobs_to_run(now):
+            if self._stop:
+                break
+            _logger.info("asking Odoo to run job %s on db %s", job.uuid, job.db_name)
+            self.db_by_name[job.db_name].set_job_enqueued(job.uuid)
+            _async_http_get(
+                self.scheme,
+                self.host,
+                self.port,
+                self.user,
+                self.password,
+                job.db_name,
+                job.uuid,
+            )
+
+    def process_notifications(self):
+        for db in self.db_by_name.values():
+            if not db.conn.notifies:
+                # If there are no activity in the queue_job table it seems that
+                # tcp keepalives are not sent (in that very specific scenario),
+                # causing some intermediaries (such as haproxy) to close the
+                # connection, making the jobrunner to restart on a socket error
+                db.keep_alive()
+            while db.conn.notifies:
+                if self._stop:
+                    break
+                notification = db.conn.notifies.pop()
+                uuid = notification.payload
+                with db.select_jobs("uuid = %s", (uuid,)) as cr:
+                    job_datas = cr.fetchone()
+                    if job_datas:
+                        self.channel_manager.notify(db.db_name, *job_datas)
+                    else:
+                        self.channel_manager.remove_job(uuid)
+
+    def wait_notification(self):
+        for db in self.db_by_name.values():
+            if db.conn.notifies:
+                # something is going on in the queue, no need to wait
+                return
+        # wait for something to happen in the queue_job tables
+        # we'll select() on database connections and the stop pipe
+        conns = [db.conn for db in self.db_by_name.values()]
+        conns.append(self._stop_pipe[0])
+        # look if the channels specify a wakeup time
+        wakeup_time = self.channel_manager.get_wakeup_time()
+        if not wakeup_time:
+            # this could very well be no timeout at all, because
+            # any activity in the job queue will wake us up, but
+            # let's have a timeout anyway, just to be safe
+            timeout = SELECT_TIMEOUT
+        else:
+            timeout = wakeup_time - _odoo_now()
+        # wait for a notification or a timeout;
+        # if timeout is negative (ie wakeup time in the past),
+        # do not wait; this should rarely happen
+        # because of how get_wakeup_time is designed; actually
+        # if timeout remains a large negative number, it is most
+        # probably a bug
+        _logger.debug("select() timeout: %.2f sec", timeout)
+        if timeout > 0:
+            if conns and not self._stop:
+                with select() as sel:
+                    for conn in conns:
+                        sel.register(conn, selectors.EVENT_READ)
+                    events = sel.select(timeout=timeout)
+                    for key, _mask in events:
+                        if key.fileobj == self._stop_pipe[0]:
+                            # stop-pipe is not a conn so doesn't need poll()
+                            continue
+                        key.fileobj.poll()
+
+    def stop(self):
+        _logger.info("graceful stop requested")
+        self._stop = True
+        # wakeup the select() in wait_notification
+        os.write(self._stop_pipe[1], b".")
+
+    def run(self):
+        _logger.info("starting")
+        while not self._stop:
+            # outer loop does exception recovery
+            try:
+                _logger.debug("initializing database connections")
+                # TODO: how to detect new databases or databases
+                #       on which queue_job is installed after server start?
+                self.initialize_databases()
+                _logger.info("database connections ready")
+                # inner loop does the normal processing
+                while not self._stop:
+                    self.requeue_dead_jobs()
+                    self.process_notifications()
+                    self.run_jobs()
+                    self.wait_notification()
+            except KeyboardInterrupt:
+                self.stop()
+            except InterruptedError:
+                # Interrupted system call, i.e. KeyboardInterrupt during select
+                self.stop()
+            except MasterElectionLost as e:
+                _logger.debug(
+                    "master election lost: %s, sleeping %ds and retrying",
+                    e,
+                    ERROR_RECOVERY_DELAY,
+                )
+                self.close_databases()
+                time.sleep(ERROR_RECOVERY_DELAY)
+            except Exception:
+                _logger.exception(
+                    "exception: sleeping %ds and retrying", ERROR_RECOVERY_DELAY
+                )
+                self.close_databases()
+                time.sleep(ERROR_RECOVERY_DELAY)
+        self.close_databases(remove_jobs=False)
+        _logger.info("stopped")

odoo-bringout-oca-queue-queue_job/queue_job/migrations/15.0.1.1.0/post-migration.py

@@ -0,0 +1,47 @@
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import logging
+
+from odoo import SUPERUSER_ID, api
+
+_logger = logging.getLogger(__name__)
+
+
+def migrate(cr, version):
+    with api.Environment.manage():
+        env = api.Environment(cr, SUPERUSER_ID, {})
+        _logger.info("Computing exception name for failed jobs")
+        _compute_jobs_new_values(env)
+
+
+def _compute_jobs_new_values(env):
+    for job in env["queue.job"].search(
+        [("state", "=", "failed"), ("exc_info", "!=", False)]
+    ):
+        exception_details = _get_exception_details(job)
+        if exception_details:
+            job.update(exception_details)
+
+
+def _get_exception_details(job):
+    for line in reversed(job.exc_info.splitlines()):
+        if _find_exception(line):
+            name, msg = line.split(":", 1)
+            return {
+                "exc_name": name.strip(),
+                "exc_message": msg.strip("()', \""),
+            }
+
+
+def _find_exception(line):
+    # Just a list of common errors.
+    # If you want to target others, add your own migration step for your db.
+    exceptions = (
+        "Error:",  # catch all well named exceptions
+        # other live instance errors found
+        "requests.exceptions.MissingSchema",
+        "botocore.errorfactory.NoSuchKey",
+    )
+    for exc in exceptions:
+        if exc in line:
+            return exc

odoo-bringout-oca-queue-queue_job/queue_job/migrations/15.0.1.1.0/pre-migration.py

@@ -0,0 +1,33 @@
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo.tools.sql import column_exists, table_exists
+
+
+def migrate(cr, version):
+    if table_exists(cr, "queue_job") and not column_exists(
+        cr, "queue_job", "exec_time"
+    ):
+        # Disable trigger otherwise the update takes ages.
+        cr.execute(
+            """
+            ALTER TABLE queue_job DISABLE TRIGGER queue_job_notify;
+        """
+        )
+        cr.execute(
+            """
+            ALTER TABLE queue_job ADD COLUMN exec_time double precision DEFAULT 0;
+        """
+        )
+        cr.execute(
+            """
+            UPDATE
+                queue_job
+            SET
+                exec_time = EXTRACT(EPOCH FROM (date_done - date_started));
+        """
+        )
+        cr.execute(
+            """
+            ALTER TABLE queue_job ENABLE TRIGGER queue_job_notify;
+        """
+        )

odoo-bringout-oca-queue-queue_job/queue_job/migrations/16.0.2.11.1/pre-migration.py

@@ -0,0 +1,11 @@
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+from openupgradelib import openupgrade
+
+
+@openupgrade.migrate()
+def migrate(env, version):
+    # Remove cron garbage collector
+    openupgrade.delete_records_safely_by_xml_id(
+        env,
+        ["queue_job.ir_cron_queue_job_garbage_collector"],
+    )

odoo-bringout-oca-queue-queue_job/queue_job/migrations/16.0.2.6.1/pre-migration.py

@@ -0,0 +1,10 @@
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo.tools.sql import table_exists
+
+
+def migrate(cr, version):
+    if table_exists(cr, "queue_job"):
+        # Drop index 'queue_job_identity_key_state_partial_index',
+        # it will be recreated during the update
+        cr.execute("DROP INDEX IF EXISTS queue_job_identity_key_state_partial_index;")

odoo-bringout-oca-queue-queue_job/queue_job/models/__init__.py

@@ -0,0 +1,6 @@
+from . import base
+from . import ir_model_fields
+from . import queue_job
+from . import queue_job_channel
+from . import queue_job_function
+from . import queue_job_lock

odoo-bringout-oca-queue-queue_job/queue_job/models/base.py

@@ -0,0 +1,266 @@
+# Copyright 2016 Camptocamp
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import functools
+
+from odoo import api, models
+
+from ..delay import Delayable, DelayableRecordset
+from ..utils import must_run_without_delay
+
+
+class Base(models.AbstractModel):
+    """The base model, which is implicitly inherited by all models.
+
+    A new :meth:`~with_delay` method is added on all Odoo Models, allowing to
+    postpone the execution of a job method in an asynchronous process.
+    """
+
+    _inherit = "base"
+
+    def with_delay(
+        self,
+        priority=None,
+        eta=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        """Return a ``DelayableRecordset``
+
+        It is a shortcut for the longer form as shown below::
+
+            self.with_delay(priority=20).action_done()
+            # is equivalent to:
+            self.delayable().set(priority=20).action_done().delay()
+
+        ``with_delay()`` accepts job properties which specify how the job will
+        be executed.
+
+        Usage with job properties::
+
+            env['a.model'].with_delay(priority=30, eta=60*60*5).action_done()
+            delayable.export_one_thing(the_thing_to_export)
+            # => the job will be executed with a low priority and not before a
+            # delay of 5 hours from now
+
+        When using :meth:``with_delay``, the final ``delay()`` is implicit.
+        See the documentation of :meth:``delayable`` for more details.
+
+        :return: instance of a DelayableRecordset
+        :rtype: :class:`odoo.addons.queue_job.job.DelayableRecordset`
+        """
+        return DelayableRecordset(
+            self,
+            priority=priority,
+            eta=eta,
+            max_retries=max_retries,
+            description=description,
+            channel=channel,
+            identity_key=identity_key,
+        )
+
+    def delayable(
+        self,
+        priority=None,
+        eta=None,
+        max_retries=None,
+        description=None,
+        channel=None,
+        identity_key=None,
+    ):
+        """Return a ``Delayable``
+
+        The returned instance allows to enqueue any method of the recordset's
+        Model.
+
+        Usage::
+
+            delayable = self.env["res.users"].browse(10).delayable(priority=20)
+            delayable.do_work(name="test"}).delay()
+
+        In this example, the ``do_work`` method will not be executed directly.
+        It will be executed in an asynchronous job.
+
+        Method calls on a Delayable generally return themselves, so calls can
+        be chained together::
+
+            delayable.set(priority=15).do_work(name="test"}).delay()
+
+        The order of the calls that build the job is not relevant, beside
+        the call to ``delay()`` that must happen at the very end. This is
+        equivalent to the example above::
+
+            delayable.do_work(name="test"}).set(priority=15).delay()
+
+        Very importantly, ``delay()`` must be called on the top-most parent
+        of a chain of jobs, so if you have this::
+
+            job1 = record1.delayable().do_work()
+            job2 = record2.delayable().do_work()
+            job1.on_done(job2)
+
+        The ``delay()`` call must be made on ``job1``, otherwise ``job2`` will
+        be delayed, but ``job1`` will never be. When done on ``job1``, the
+        ``delay()`` call will traverse the graph of jobs and delay all of
+        them::
+
+            job1.delay()
+
+        For more details on the graph dependencies, read the documentation of
+        :module:`~odoo.addons.queue_job.delay`.
+
+        :param priority: Priority of the job, 0 being the higher priority.
+                         Default is 10.
+        :param eta: Estimated Time of Arrival of the job. It will not be
+                    executed before this date/time.
+        :param max_retries: maximum number of retries before giving up and set
+                            the job state to 'failed'. A value of 0 means
+                            infinite retries.  Default is 5.
+        :param description: human description of the job. If None, description
+                            is computed from the function doc or name
+        :param channel: the complete name of the channel to use to process
+                        the function. If specified it overrides the one
+                        defined on the function
+        :param identity_key: key uniquely identifying the job, if specified
+                             and a job with the same key has not yet been run,
+                             the new job will not be added. It is either a
+                             string, either a function that takes the job as
+                             argument (see :py:func:`..job.identity_exact`).
+                             the new job will not be added.
+        :return: instance of a Delayable
+        :rtype: :class:`odoo.addons.queue_job.job.Delayable`
+        """
+        return Delayable(
+            self,
+            priority=priority,
+            eta=eta,
+            max_retries=max_retries,
+            description=description,
+            channel=channel,
+            identity_key=identity_key,
+        )
+
+    def _patch_job_auto_delay(self, method_name, context_key=None):
+        """Patch a method to be automatically delayed as job method when called
+
+        This patch method has to be called in ``_register_hook`` (example
+        below).
+
+        When a method is patched, any call to the method will not directly
+        execute the method's body, but will instead enqueue a job.
+
+        When a ``context_key`` is set when calling ``_patch_job_auto_delay``,
+        the patched method is automatically delayed only when this key is
+        ``True`` in the caller's context. It is advised to patch the method
+        with a ``context_key``, because making the automatic delay *in any
+        case* can produce nasty and unexpected side effects (e.g. another
+        module calls the method and expects it to be computed before doing
+        something else, expecting a result, ...).
+
+        A typical use case is when a method in a module we don't control is
+        called synchronously in the middle of another method, and we'd like all
+        the calls to this method become asynchronous.
+
+        The options of the job usually passed to ``with_delay()`` (priority,
+        description, identity_key, ...) can be returned in a dictionary by a
+        method named after the name of the method suffixed by ``_job_options``
+        which takes the same parameters as the initial method.
+
+        It is still possible to force synchronous execution of the method by
+        setting a key ``_job_force_sync`` to True in the environment context.
+
+        Example patching the "foo" method to be automatically delayed as job
+        (the job options method is optional):
+
+        .. code-block:: python
+
+            # original method:
+            def foo(self, arg1):
+                print("hello", arg1)
+
+            def large_method(self):
+                # doing a lot of things
+                self.foo("world)
+                # doing a lot of other things
+
+            def button_x(self):
+                self.with_context(auto_delay_foo=True).large_method()
+
+            # auto delay patch:
+            def foo_job_options(self, arg1):
+                return {
+                  "priority": 100,
+                  "description": "Saying hello to {}".format(arg1)
+                }
+
+            def _register_hook(self):
+                self._patch_method(
+                    "foo",
+                    self._patch_job_auto_delay("foo", context_key="auto_delay_foo")
+                )
+                return super()._register_hook()
+
+        The result when ``button_x`` is called, is that a new job for ``foo``
+        is delayed.
+        """
+
+        def auto_delay_wrapper(self, *args, **kwargs):
+            # when no context_key is set, we delay in any case (warning, can be
+            # dangerous)
+            context_delay = self.env.context.get(context_key) if context_key else True
+            if (
+                self.env.context.get("job_uuid")
+                or not context_delay
+                or must_run_without_delay(self.env)
+            ):
+                # we are in the job execution
+                return auto_delay_wrapper.origin(self, *args, **kwargs)
+            else:
+                # replace the synchronous call by a job on itself
+                method_name = auto_delay_wrapper.origin.__name__
+                job_options_method = getattr(
+                    self, "{}_job_options".format(method_name), None
+                )
+                job_options = {}
+                if job_options_method:
+                    job_options.update(job_options_method(*args, **kwargs))
+                delayed = self.with_delay(**job_options)
+                return getattr(delayed, method_name)(*args, **kwargs)
+
+        origin = getattr(self, method_name)
+        return functools.update_wrapper(auto_delay_wrapper, origin)
+
+    @api.model
+    def _job_store_values(self, job):
+        """Hook for manipulating job stored values.
+
+        You can define a more specific hook for a job function
+        by defining a method name with this pattern:
+
+            `_queue_job_store_values_${func_name}`
+
+        NOTE: values will be stored only if they match stored fields on `queue.job`.
+
+        :param job: current queue_job.job.Job instance.
+        :return: dictionary for setting job values.
+        """
+        return {}
+
+    @api.model
+    def _job_prepare_context_before_enqueue_keys(self):
+        """Keys to keep in context of stored jobs
+        Empty by default for backward compatibility.
+        """
+        return ("tz", "lang", "allowed_company_ids", "force_company", "active_test")
+
+    def _job_prepare_context_before_enqueue(self):
+        """Return the context to store in the jobs
+        Can be used to keep only safe keys.
+        """
+        return {
+            key: value
+            for key, value in self.env.context.items()
+            if key in self._job_prepare_context_before_enqueue_keys()
+        }

odoo-bringout-oca-queue-queue_job/queue_job/models/ir_model_fields.py

@@ -0,0 +1,13 @@
+# Copyright 2020 Camptocamp
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import fields, models
+
+
+class IrModelFields(models.Model):
+    _inherit = "ir.model.fields"
+
+    ttype = fields.Selection(
+        selection_add=[("job_serialized", "Job Serialized")],
+        ondelete={"job_serialized": "cascade"},
+    )

odoo-bringout-oca-queue-queue_job/queue_job/models/queue_job.py

@@ -0,0 +1,457 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import logging
+import random
+from datetime import datetime, timedelta
+
+from odoo import _, api, exceptions, fields, models
+from odoo.tools import config, html_escape
+
+from odoo.addons.base_sparse_field.models.fields import Serialized
+
+from ..delay import Graph
+from ..exception import JobError
+from ..fields import JobSerialized
+from ..job import (
+    CANCELLED,
+    DONE,
+    FAILED,
+    PENDING,
+    STARTED,
+    STATES,
+    WAIT_DEPENDENCIES,
+    Job,
+)
+
+_logger = logging.getLogger(__name__)
+
+
+class QueueJob(models.Model):
+    """Model storing the jobs to be executed."""
+
+    _name = "queue.job"
+    _description = "Queue Job"
+    _inherit = ["mail.thread", "mail.activity.mixin"]
+    _log_access = False
+
+    _order = "date_created DESC, date_done DESC"
+
+    _removal_interval = 30  # days
+    _default_related_action = "related_action_open_record"
+
+    # This must be passed in a context key "_job_edit_sentinel" to write on
+    # protected fields. It protects against crafting "queue.job" records from
+    # RPC (e.g. on internal methods). When ``with_delay`` is used, the sentinel
+    # is set.
+    EDIT_SENTINEL = object()
+    _protected_fields = (
+        "uuid",
+        "name",
+        "date_created",
+        "model_name",
+        "method_name",
+        "func_string",
+        "channel_method_name",
+        "job_function_id",
+        "records",
+        "args",
+        "kwargs",
+    )
+
+    uuid = fields.Char(string="UUID", readonly=True, index=True, required=True)
+    graph_uuid = fields.Char(
+        string="Graph UUID",
+        readonly=True,
+        index=True,
+        help="Single shared identifier of a Graph. Empty for a single job.",
+    )
+    user_id = fields.Many2one(comodel_name="res.users", string="User ID")
+    company_id = fields.Many2one(
+        comodel_name="res.company", string="Company", index=True
+    )
+    name = fields.Char(string="Description", readonly=True)
+
+    model_name = fields.Char(string="Model", readonly=True)
+    method_name = fields.Char(readonly=True)
+    # record_ids field is only for backward compatibility (e.g. used in related
+    # actions), can be removed (replaced by "records") in 14.0
+    record_ids = JobSerialized(compute="_compute_record_ids", base_type=list)
+    records = JobSerialized(
+        string="Record(s)",
+        readonly=True,
+        base_type=models.BaseModel,
+    )
+    dependencies = Serialized(readonly=True)
+    # dependency graph as expected by the field widget
+    dependency_graph = Serialized(compute="_compute_dependency_graph")
+    graph_jobs_count = fields.Integer(compute="_compute_graph_jobs_count")
+    args = JobSerialized(readonly=True, base_type=tuple)
+    kwargs = JobSerialized(readonly=True, base_type=dict)
+    func_string = fields.Char(string="Task", readonly=True)
+
+    state = fields.Selection(STATES, readonly=True, required=True, index=True)
+    priority = fields.Integer()
+    exc_name = fields.Char(string="Exception", readonly=True)
+    exc_message = fields.Char(string="Exception Message", readonly=True, tracking=True)
+    exc_info = fields.Text(string="Exception Info", readonly=True)
+    result = fields.Text(readonly=True)
+
+    date_created = fields.Datetime(string="Created Date", readonly=True)
+    date_started = fields.Datetime(string="Start Date", readonly=True)
+    date_enqueued = fields.Datetime(string="Enqueue Time", readonly=True)
+    date_done = fields.Datetime(readonly=True)
+    exec_time = fields.Float(
+        string="Execution Time (avg)",
+        group_operator="avg",
+        help="Time required to execute this job in seconds. Average when grouped.",
+    )
+    date_cancelled = fields.Datetime(readonly=True)
+
+    eta = fields.Datetime(string="Execute only after")
+    retry = fields.Integer(string="Current try")
+    max_retries = fields.Integer(
+        string="Max. retries",
+        help="The job will fail if the number of tries reach the "
+        "max. retries.\n"
+        "Retries are infinite when empty.",
+    )
+    # FIXME the name of this field is very confusing
+    channel_method_name = fields.Char(string="Complete Method Name", readonly=True)
+    job_function_id = fields.Many2one(
+        comodel_name="queue.job.function",
+        string="Job Function",
+        readonly=True,
+    )
+
+    channel = fields.Char(index=True)
+
+    identity_key = fields.Char(readonly=True)
+    worker_pid = fields.Integer(readonly=True)
+
+    def init(self):
+        self._cr.execute(
+            "SELECT indexname FROM pg_indexes WHERE indexname = %s ",
+            ("queue_job_identity_key_state_partial_index",),
+        )
+        if not self._cr.fetchone():
+            self._cr.execute(
+                "CREATE INDEX queue_job_identity_key_state_partial_index "
+                "ON queue_job (identity_key) WHERE state in ('pending', "
+                "'enqueued', 'wait_dependencies') AND identity_key IS NOT NULL;"
+            )
+
+    @api.depends("records")
+    def _compute_record_ids(self):
+        for record in self:
+            record.record_ids = record.records.ids
+
+    @api.depends("dependencies")
+    def _compute_dependency_graph(self):
+        jobs_groups = self.env["queue.job"].read_group(
+            [
+                (
+                    "graph_uuid",
+                    "in",
+                    [uuid for uuid in self.mapped("graph_uuid") if uuid],
+                )
+            ],
+            ["graph_uuid", "ids:array_agg(id)"],
+            ["graph_uuid"],
+        )
+        ids_per_graph_uuid = {
+            group["graph_uuid"]: group["ids"] for group in jobs_groups
+        }
+        for record in self:
+            if not record.graph_uuid:
+                record.dependency_graph = {}
+                continue
+
+            graph_jobs = self.browse(ids_per_graph_uuid.get(record.graph_uuid) or [])
+            if not graph_jobs:
+                record.dependency_graph = {}
+                continue
+
+            graph_ids = {graph_job.uuid: graph_job.id for graph_job in graph_jobs}
+            graph_jobs_by_ids = {graph_job.id: graph_job for graph_job in graph_jobs}
+
+            graph = Graph()
+            for graph_job in graph_jobs:
+                graph.add_vertex(graph_job.id)
+                for parent_uuid in graph_job.dependencies["depends_on"]:
+                    parent_id = graph_ids.get(parent_uuid)
+                    if not parent_id:
+                        continue
+                    graph.add_edge(parent_id, graph_job.id)
+                for child_uuid in graph_job.dependencies["reverse_depends_on"]:
+                    child_id = graph_ids.get(child_uuid)
+                    if not child_id:
+                        continue
+                    graph.add_edge(graph_job.id, child_id)
+
+            record.dependency_graph = {
+                # list of ids
+                "nodes": [
+                    graph_jobs_by_ids[graph_id]._dependency_graph_vis_node()
+                    for graph_id in graph.vertices()
+                ],
+                # list of tuples (from, to)
+                "edges": graph.edges(),
+            }
+
+    def _dependency_graph_vis_node(self):
+        """Return the node as expected by the JobDirectedGraph widget"""
+        default = ("#D2E5FF", "#2B7CE9")
+        colors = {
+            DONE: ("#C2FABC", "#4AD63A"),
+            FAILED: ("#FB7E81", "#FA0A10"),
+            STARTED: ("#FFFF00", "#FFA500"),
+        }
+        return {
+            "id": self.id,
+            "title": "<strong>%s</strong><br/>%s"
+            % (
+                html_escape(self.display_name),
+                html_escape(self.func_string),
+            ),
+            "color": colors.get(self.state, default)[0],
+            "border": colors.get(self.state, default)[1],
+            "shadow": True,
+        }
+
+    def _compute_graph_jobs_count(self):
+        jobs_groups = self.env["queue.job"].read_group(
+            [
+                (
+                    "graph_uuid",
+                    "in",
+                    [uuid for uuid in self.mapped("graph_uuid") if uuid],
+                )
+            ],
+            ["graph_uuid"],
+            ["graph_uuid"],
+        )
+        count_per_graph_uuid = {
+            group["graph_uuid"]: group["graph_uuid_count"] for group in jobs_groups
+        }
+        for record in self:
+            record.graph_jobs_count = count_per_graph_uuid.get(record.graph_uuid) or 0
+
+    @api.model_create_multi
+    def create(self, vals_list):
+        if self.env.context.get("_job_edit_sentinel") is not self.EDIT_SENTINEL:
+            # Prevent to create a queue.job record "raw" from RPC.
+            # ``with_delay()`` must be used.
+            raise exceptions.AccessError(
+                _("Queue jobs must be created by calling 'with_delay()'.")
+            )
+        return super(
+            QueueJob,
+            self.with_context(mail_create_nolog=True, mail_create_nosubscribe=True),
+        ).create(vals_list)
+
+    def write(self, vals):
+        if self.env.context.get("_job_edit_sentinel") is not self.EDIT_SENTINEL:
+            write_on_protected_fields = [
+                fieldname for fieldname in vals if fieldname in self._protected_fields
+            ]
+            if write_on_protected_fields:
+                raise exceptions.AccessError(
+                    _("Not allowed to change field(s): {}").format(
+                        write_on_protected_fields
+                    )
+                )
+
+        different_user_jobs = self.browse()
+        if vals.get("user_id"):
+            different_user_jobs = self.filtered(
+                lambda records: records.env.user.id != vals["user_id"]
+            )
+
+        if vals.get("state") == "failed":
+            self._message_post_on_failure()
+
+        result = super().write(vals)
+
+        for record in different_user_jobs:
+            # the user is stored in the env of the record, but we still want to
+            # have a stored user_id field to be able to search/groupby, so
+            # synchronize the env of records with user_id
+            super(QueueJob, record).write(
+                {"records": record.records.with_user(vals["user_id"])}
+            )
+        return result
+
+    def open_related_action(self):
+        """Open the related action associated to the job"""
+        self.ensure_one()
+        job = Job.load(self.env, self.uuid)
+        action = job.related_action()
+        if action is None:
+            raise exceptions.UserError(_("No action available for this job"))
+        return action
+
+    def open_graph_jobs(self):
+        """Return action that opens all jobs of the same graph"""
+        self.ensure_one()
+        jobs = self.env["queue.job"].search([("graph_uuid", "=", self.graph_uuid)])
+
+        action = self.env["ir.actions.act_window"]._for_xml_id(
+            "queue_job.action_queue_job"
+        )
+        action.update(
+            {
+                "name": _("Jobs for graph %s") % (self.graph_uuid),
+                "context": {},
+                "domain": [("id", "in", jobs.ids)],
+            }
+        )
+        return action
+
+    def _change_job_state(self, state, result=None):
+        """Change the state of the `Job` object
+
+        Changing the state of the Job will automatically change some fields
+        (date, result, ...).
+        """
+        for record in self:
+            job_ = Job.load(record.env, record.uuid)
+            if state == DONE:
+                job_.set_done(result=result)
+                job_.store()
+                record.env["queue.job"].flush_model()
+                job_.enqueue_waiting()
+            elif state == PENDING:
+                job_.set_pending(result=result)
+                job_.store()
+            elif state == CANCELLED:
+                job_.set_cancelled(result=result)
+                job_.store()
+                record.env["queue.job"].flush_model()
+                job_.cancel_dependent_jobs()
+            else:
+                raise ValueError("State not supported: %s" % state)
+
+    def button_done(self):
+        result = _("Manually set to done by %s") % self.env.user.name
+        self._change_job_state(DONE, result=result)
+        return True
+
+    def button_cancelled(self):
+        result = _("Cancelled by %s") % self.env.user.name
+        self._change_job_state(CANCELLED, result=result)
+        return True
+
+    def requeue(self):
+        jobs_to_requeue = self.filtered(lambda job_: job_.state != WAIT_DEPENDENCIES)
+        jobs_to_requeue._change_job_state(PENDING)
+        return jobs_to_requeue
+
+    def _message_post_on_failure(self):
+        # subscribe the users now to avoid to subscribe them
+        # at every job creation
+        domain = self._subscribe_users_domain()
+        base_users = self.env["res.users"].search(domain)
+        for record in self:
+            users = base_users | record.user_id
+            record.message_subscribe(partner_ids=users.mapped("partner_id").ids)
+            msg = record._message_failed_job()
+            if msg:
+                record.message_post(body=msg, subtype_xmlid="queue_job.mt_job_failed")
+
+    def _subscribe_users_domain(self):
+        """Subscribe all users having the 'Queue Job Manager' group"""
+        group = self.env.ref("queue_job.group_queue_job_manager")
+        if not group:
+            return None
+        companies = self.mapped("company_id")
+        domain = [("groups_id", "=", group.id)]
+        if companies:
+            domain.append(("company_id", "in", companies.ids))
+        return domain
+
+    def _message_failed_job(self):
+        """Return a message which will be posted on the job when it is failed.
+
+        It can be inherited to allow more precise messages based on the
+        exception informations.
+
+        If nothing is returned, no message will be posted.
+        """
+        self.ensure_one()
+        return _(
+            "Something bad happened during the execution of job %s. "
+            "More details in the 'Exception Information' section.",
+            self.uuid,
+        )
+
+    def _needaction_domain_get(self):
+        """Returns the domain to filter records that require an action
+
+        :return: domain or False is no action
+        """
+        return [("state", "=", "failed")]
+
+    def autovacuum(self):
+        """Delete all jobs done based on the removal interval defined on the
+           channel
+
+        Called from a cron.
+        """
+        for channel in self.env["queue.job.channel"].search([]):
+            deadline = datetime.now() - timedelta(days=int(channel.removal_interval))
+            while True:
+                jobs = self.search(
+                    [
+                        "|",
+                        ("date_done", "<=", deadline),
+                        ("date_cancelled", "<=", deadline),
+                        ("channel", "=", channel.complete_name),
+                    ],
+                    limit=1000,
+                )
+                if jobs:
+                    jobs.unlink()
+                    if not config["test_enable"]:
+                        self.env.cr.commit()  # pylint: disable=E8102
+                else:
+                    break
+        return True
+
+    def related_action_open_record(self):
+        """Open a form view with the record(s) of the job.
+
+        For instance, for a job on a ``product.product``, it will open a
+        ``product.product`` form view with the product record(s) concerned by
+        the job. If the job concerns more than one record, it opens them in a
+        list.
+
+        This is the default related action.
+
+        """
+        self.ensure_one()
+        records = self.records.exists()
+        if not records:
+            return None
+        action = {
+            "name": _("Related Record"),
+            "type": "ir.actions.act_window",
+            "view_mode": "form",
+            "res_model": records._name,
+        }
+        if len(records) == 1:
+            action["res_id"] = records.id
+        else:
+            action.update(
+                {
+                    "name": _("Related Records"),
+                    "view_mode": "tree,form",
+                    "domain": [("id", "in", records.ids)],
+                }
+            )
+        return action
+
+    def _test_job(self, failure_rate=0):
+        _logger.info("Running test job.")
+        if random.random() <= failure_rate:
+            raise JobError("Job failed")

odoo-bringout-oca-queue-queue_job/queue_job/models/queue_job_channel.py

@@ -0,0 +1,94 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+
+from odoo import _, api, exceptions, fields, models
+
+
+class QueueJobChannel(models.Model):
+    _name = "queue.job.channel"
+    _description = "Job Channels"
+
+    name = fields.Char()
+    complete_name = fields.Char(
+        compute="_compute_complete_name", store=True, readonly=True, recursive=True
+    )
+    parent_id = fields.Many2one(
+        comodel_name="queue.job.channel", string="Parent Channel", ondelete="restrict"
+    )
+    job_function_ids = fields.One2many(
+        comodel_name="queue.job.function",
+        inverse_name="channel_id",
+        string="Job Functions",
+    )
+    removal_interval = fields.Integer(
+        default=lambda self: self.env["queue.job"]._removal_interval, required=True
+    )
+
+    _sql_constraints = [
+        ("name_uniq", "unique(complete_name)", "Channel complete name must be unique")
+    ]
+
+    @api.depends("name", "parent_id.complete_name")
+    def _compute_complete_name(self):
+        for record in self:
+            if not record.name:
+                complete_name = ""  # new record
+            elif record.parent_id:
+                complete_name = ".".join([record.parent_id.complete_name, record.name])
+            else:
+                complete_name = record.name
+            record.complete_name = complete_name
+
+    @api.constrains("parent_id", "name")
+    def parent_required(self):
+        for record in self:
+            if record.name != "root" and not record.parent_id:
+                raise exceptions.ValidationError(_("Parent channel required."))
+
+    @api.model_create_multi
+    def create(self, vals_list):
+        records = self.browse()
+        if self.env.context.get("install_mode"):
+            # installing a module that creates a channel: rebinds the channel
+            # to an existing one (likely we already had the channel created by
+            # the @job decorator previously)
+            new_vals_list = []
+            for vals in vals_list:
+                name = vals.get("name")
+                parent_id = vals.get("parent_id")
+                if name and parent_id:
+                    existing = self.search(
+                        [("name", "=", name), ("parent_id", "=", parent_id)]
+                    )
+                    if existing:
+                        if not existing.get_metadata()[0].get("noupdate"):
+                            existing.write(vals)
+                        records |= existing
+                        continue
+                new_vals_list.append(vals)
+            vals_list = new_vals_list
+        records |= super().create(vals_list)
+        return records
+
+    def write(self, values):
+        for channel in self:
+            if (
+                not self.env.context.get("install_mode")
+                and channel.name == "root"
+                and ("name" in values or "parent_id" in values)
+            ):
+                raise exceptions.UserError(_("Cannot change the root channel"))
+        return super().write(values)
+
+    def unlink(self):
+        for channel in self:
+            if channel.name == "root":
+                raise exceptions.UserError(_("Cannot remove the root channel"))
+        return super().unlink()
+
+    def name_get(self):
+        result = []
+        for record in self:
+            result.append((record.id, record.complete_name))
+        return result

odoo-bringout-oca-queue-queue_job/queue_job/models/queue_job_function.py

@@ -0,0 +1,273 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import ast
+import logging
+import re
+from collections import namedtuple
+
+from odoo import _, api, exceptions, fields, models, tools
+
+from ..fields import JobSerialized
+
+_logger = logging.getLogger(__name__)
+
+
+regex_job_function_name = re.compile(r"^<([0-9a-z_\.]+)>\.([0-9a-zA-Z_]+)$")
+
+
+class QueueJobFunction(models.Model):
+    _name = "queue.job.function"
+    _description = "Job Functions"
+    _log_access = False
+
+    JobConfig = namedtuple(
+        "JobConfig",
+        "channel "
+        "retry_pattern "
+        "related_action_enable "
+        "related_action_func_name "
+        "related_action_kwargs "
+        "job_function_id ",
+    )
+
+    def _default_channel(self):
+        return self.env.ref("queue_job.channel_root")
+
+    name = fields.Char(
+        compute="_compute_name",
+        inverse="_inverse_name",
+        index=True,
+        store=True,
+    )
+
+    # model and method should be required, but the required flag doesn't
+    # let a chance to _inverse_name to be executed
+    model_id = fields.Many2one(
+        comodel_name="ir.model", string="Model", ondelete="cascade"
+    )
+    method = fields.Char()
+
+    channel_id = fields.Many2one(
+        comodel_name="queue.job.channel",
+        string="Channel",
+        required=True,
+        default=lambda r: r._default_channel(),
+    )
+    channel = fields.Char(related="channel_id.complete_name", store=True, readonly=True)
+    retry_pattern = JobSerialized(string="Retry Pattern (serialized)", base_type=dict)
+    edit_retry_pattern = fields.Text(
+        string="Retry Pattern",
+        compute="_compute_edit_retry_pattern",
+        inverse="_inverse_edit_retry_pattern",
+        help="Pattern expressing from the count of retries on retryable errors,"
+        " the number of of seconds to postpone the next execution. Setting the "
+        "number of seconds to a 2-element tuple or list will randomize the "
+        "retry interval between the 2 values.\n"
+        "Example: {1: 10, 5: 20, 10: 30, 15: 300}.\n"
+        "Example: {1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}.\n"
+        "See the module description for details.",
+    )
+    related_action = JobSerialized(string="Related Action (serialized)", base_type=dict)
+    edit_related_action = fields.Text(
+        string="Related Action",
+        compute="_compute_edit_related_action",
+        inverse="_inverse_edit_related_action",
+        help="The action when the button *Related Action* is used on a job. "
+        "The default action is to open the view of the record related "
+        "to the job. Configured as a dictionary with optional keys: "
+        "enable, func_name, kwargs.\n"
+        "See the module description for details.",
+    )
+
+    @api.depends("model_id.model", "method")
+    def _compute_name(self):
+        for record in self:
+            if not (record.model_id and record.method):
+                record.name = ""
+                continue
+            record.name = self.job_function_name(record.model_id.model, record.method)
+
+    def _inverse_name(self):
+        groups = regex_job_function_name.match(self.name)
+        if not groups:
+            raise exceptions.UserError(_("Invalid job function: {}").format(self.name))
+        model_name = groups[1]
+        method = groups[2]
+        model = (
+            self.env["ir.model"].sudo().search([("model", "=", model_name)], limit=1)
+        )
+        if not model:
+            raise exceptions.UserError(_("Model {} not found").format(model_name))
+        self.model_id = model.id
+        self.method = method
+
+    @api.depends("retry_pattern")
+    def _compute_edit_retry_pattern(self):
+        for record in self:
+            retry_pattern = record._parse_retry_pattern()
+            record.edit_retry_pattern = str(retry_pattern)
+
+    def _inverse_edit_retry_pattern(self):
+        try:
+            edited = (self.edit_retry_pattern or "").strip()
+            if edited:
+                self.retry_pattern = ast.literal_eval(edited)
+            else:
+                self.retry_pattern = {}
+        except (ValueError, TypeError, SyntaxError) as ex:
+            raise exceptions.UserError(
+                self._retry_pattern_format_error_message()
+            ) from ex
+
+    @api.depends("related_action")
+    def _compute_edit_related_action(self):
+        for record in self:
+            record.edit_related_action = str(record.related_action)
+
+    def _inverse_edit_related_action(self):
+        try:
+            edited = (self.edit_related_action or "").strip()
+            if edited:
+                self.related_action = ast.literal_eval(edited)
+            else:
+                self.related_action = {}
+        except (ValueError, TypeError, SyntaxError) as ex:
+            raise exceptions.UserError(
+                self._related_action_format_error_message()
+            ) from ex
+
+    @staticmethod
+    def job_function_name(model_name, method_name):
+        return "<{}>.{}".format(model_name, method_name)
+
+    def job_default_config(self):
+        return self.JobConfig(
+            channel="root",
+            retry_pattern={},
+            related_action_enable=True,
+            related_action_func_name=None,
+            related_action_kwargs={},
+            job_function_id=None,
+        )
+
+    def _parse_retry_pattern(self):
+        try:
+            # as json can't have integers as keys and the field is stored
+            # as json, convert back to int
+            retry_pattern = {}
+            for try_count, postpone_value in self.retry_pattern.items():
+                if isinstance(postpone_value, int):
+                    retry_pattern[int(try_count)] = postpone_value
+                else:
+                    retry_pattern[int(try_count)] = tuple(postpone_value)
+        except ValueError:
+            _logger.error(
+                "Invalid retry pattern for job function %s,"
+                " keys could not be parsed as integers, fallback"
+                " to the default retry pattern.",
+                self.name,
+            )
+            retry_pattern = {}
+        return retry_pattern
+
+    @tools.ormcache("name")
+    def job_config(self, name):
+        config = self.search([("name", "=", name)], limit=1)
+        if not config:
+            return self.job_default_config()
+        retry_pattern = config._parse_retry_pattern()
+        return self.JobConfig(
+            channel=config.channel,
+            retry_pattern=retry_pattern,
+            related_action_enable=config.related_action.get("enable", True),
+            related_action_func_name=config.related_action.get("func_name"),
+            related_action_kwargs=config.related_action.get("kwargs", {}),
+            job_function_id=config.id,
+        )
+
+    def _retry_pattern_format_error_message(self):
+        return _(
+            "Unexpected format of Retry Pattern for {}.\n"
+            "Example of valid formats:\n"
+            "{{1: 300, 5: 600, 10: 1200, 15: 3000}}\n"
+            "{{1: (1, 10), 5: (11, 20), 10: (21, 30), 15: (100, 300)}}"
+        ).format(self.name)
+
+    @api.constrains("retry_pattern")
+    def _check_retry_pattern(self):
+        for record in self:
+            retry_pattern = record.retry_pattern
+            if not retry_pattern:
+                continue
+
+            all_values = list(retry_pattern) + list(retry_pattern.values())
+            for value in all_values:
+                try:
+                    self._retry_value_type_check(value)
+                except ValueError as ex:
+                    raise exceptions.UserError(
+                        record._retry_pattern_format_error_message()
+                    ) from ex
+
+    def _retry_value_type_check(self, value):
+        if isinstance(value, (tuple, list)):
+            if len(value) != 2:
+                raise ValueError
+            [self._retry_value_type_check(element) for element in value]
+            return
+        int(value)
+
+    def _related_action_format_error_message(self):
+        return _(
+            "Unexpected format of Related Action for {}.\n"
+            "Example of valid format:\n"
+            '{{"enable": True, "func_name": "related_action_foo",'
+            ' "kwargs" {{"limit": 10}}}}'
+        ).format(self.name)
+
+    @api.constrains("related_action")
+    def _check_related_action(self):
+        valid_keys = ("enable", "func_name", "kwargs")
+        for record in self:
+            related_action = record.related_action
+            if not related_action:
+                continue
+
+            if any(key not in valid_keys for key in related_action):
+                raise exceptions.UserError(
+                    record._related_action_format_error_message()
+                )
+
+    @api.model_create_multi
+    def create(self, vals_list):
+        records = self.browse()
+        if self.env.context.get("install_mode"):
+            # installing a module that creates a job function: rebinds the record
+            # to an existing one (likely we already had the job function created by
+            # the @job decorator previously)
+            new_vals_list = []
+            for vals in vals_list:
+                name = vals.get("name")
+                if name:
+                    existing = self.search([("name", "=", name)], limit=1)
+                    if existing:
+                        if not existing.get_metadata()[0].get("noupdate"):
+                            existing.write(vals)
+                        records |= existing
+                        continue
+                new_vals_list.append(vals)
+            vals_list = new_vals_list
+        records |= super().create(vals_list)
+        self.clear_caches()
+        return records
+
+    def write(self, values):
+        res = super().write(values)
+        self.clear_caches()
+        return res
+
+    def unlink(self):
+        res = super().unlink()
+        self.clear_caches()
+        return res

odoo-bringout-oca-queue-queue_job/queue_job/models/queue_job_lock.py

@@ -0,0 +1,16 @@
+# Copyright 2025 ACSONE SA/NV
+# License AGPL-3.0 or later (https://www.gnu.org/licenses/agpl).
+
+from odoo import fields, models
+
+
+class QueueJobLock(models.Model):
+    _name = "queue.job.lock"
+    _description = "Queue Job Lock"
+
+    queue_job_id = fields.Many2one(
+        comodel_name="queue.job",
+        required=True,
+        ondelete="cascade",
+        index=True,
+    )

odoo-bringout-oca-queue-queue_job/queue_job/post_init_hook.py

@@ -0,0 +1,33 @@
+# Copyright 2020 ACSONE SA/NV
+# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl).
+
+import logging
+
+logger = logging.getLogger(__name__)
+
+
+def post_init_hook(cr, registry):
+    # this is the trigger that sends notifications when jobs change
+    logger.info("Create queue_job_notify trigger")
+    cr.execute(
+        """
+            DROP TRIGGER IF EXISTS queue_job_notify ON queue_job;
+            CREATE OR REPLACE
+                FUNCTION queue_job_notify() RETURNS trigger AS $$
+            BEGIN
+                IF TG_OP = 'DELETE' THEN
+                    IF OLD.state != 'done' THEN
+                        PERFORM pg_notify('queue_job', OLD.uuid);
+                    END IF;
+                ELSE
+                    PERFORM pg_notify('queue_job', NEW.uuid);
+                END IF;
+                RETURN NULL;
+            END;
+            $$ LANGUAGE plpgsql;
+            CREATE TRIGGER queue_job_notify
+                AFTER INSERT OR UPDATE OR DELETE
+                ON queue_job
+                FOR EACH ROW EXECUTE PROCEDURE queue_job_notify();
+        """
+    )

odoo-bringout-oca-queue-queue_job/queue_job/post_load.py

@@ -0,0 +1,25 @@
+import logging
+
+from odoo import http
+
+_logger = logging.getLogger(__name__)
+
+
+def post_load():
+    _logger.info(
+        "Apply Request._get_session_and_dbname monkey patch to capture db"
+        " from request with multiple databases"
+    )
+    _get_session_and_dbname_orig = http.Request._get_session_and_dbname
+
+    def _get_session_and_dbname(self):
+        session, dbname = _get_session_and_dbname_orig(self)
+        if (
+            not dbname
+            and self.httprequest.path == "/queue_job/runjob"
+            and self.httprequest.args.get("db")
+        ):
+            dbname = self.httprequest.args["db"]
+        return session, dbname
+
+    http.Request._get_session_and_dbname = _get_session_and_dbname

odoo-bringout-oca-queue-queue_job/queue_job/readme/CONFIGURE.rst

@@ -0,0 +1,50 @@
+* Using environment variables and command line:
+
+  * Adjust environment variables (optional):
+
+    - ``ODOO_QUEUE_JOB_CHANNELS=root:4`` or any other channels configuration.
+      The default is ``root:1``
+
+    - if ``xmlrpc_port`` is not set: ``ODOO_QUEUE_JOB_PORT=8069``
+
+  * Start Odoo with ``--load=web,queue_job``
+    and ``--workers`` greater than 1. [1]_
+
+* Keep in mind that the number of workers should be greater than the number of
+  channels. ``queue_job`` will reuse normal Odoo workers to process jobs. It
+  will not spawn its own workers.
+
+* Using the Odoo configuration file:
+
+.. code-block:: ini
+
+  [options]
+  (...)
+  workers = 6
+  server_wide_modules = web,queue_job
+
+  (...)
+  [queue_job]
+  channels = root:2
+
+* Environment variables have priority over the configuration file.
+
+* Confirm the runner is starting correctly by checking the odoo log file:
+
+.. code-block::
+
+  ...INFO...queue_job.jobrunner.runner: starting
+  ...INFO...queue_job.jobrunner.runner: initializing database connections
+  ...INFO...queue_job.jobrunner.runner: queue job runner ready for db <dbname>
+  ...INFO...queue_job.jobrunner.runner: database connections ready
+
+* Create jobs (eg using ``base_import_async``) and observe they
+  start immediately and in parallel.
+
+* Tip: to enable debug logging for the queue job, use
+  ``--log-handler=odoo.addons.queue_job:DEBUG``
+
+.. [1] It works with the threaded Odoo server too, although this way
+       of running Odoo is obviously not for production purposes.
+
+* Jobs that remain in `enqueued` or `started` state (because, for instance, their worker has been killed) will be automatically re-queued.

odoo-bringout-oca-queue-queue_job/queue_job/readme/CONTRIBUTORS.rst

@@ -0,0 +1,12 @@
+* Guewen Baconnier <guewen.baconnier@camptocamp.com>
+* Stéphane Bidoul <stephane.bidoul@acsone.eu>
+* Matthieu Dietrich <matthieu.dietrich@camptocamp.com>
+* Jos De Graeve <Jos.DeGraeve@apertoso.be>
+* David Lefever <dl@taktik.be>
+* Laurent Mignon <laurent.mignon@acsone.eu>
+* Laetitia Gangloff <laetitia.gangloff@acsone.eu>
+* Cédric Pigeon <cedric.pigeon@acsone.eu>
+* Tatiana Deribina <tatiana.deribina@avoin.systems>
+* Souheil Bejaoui <souheil.bejaoui@acsone.eu>
+* Eric Antones <eantones@nuobit.com>
+* Simone Orsi <simone.orsi@camptocamp.com>

odoo-bringout-oca-queue-queue_job/queue_job/readme/DESCRIPTION.rst

@@ -0,0 +1,46 @@
+This addon adds an integrated Job Queue to Odoo.
+
+It allows to postpone method calls executed asynchronously.
+
+Jobs are executed in the background by a ``Jobrunner``, in their own transaction.
+
+Example:
+
+.. code-block:: python
+
+  from odoo import models, fields, api
+
+  class MyModel(models.Model):
+     _name = 'my.model'
+
+     def my_method(self, a, k=None):
+         _logger.info('executed with a: %s and k: %s', a, k)
+
+
+  class MyOtherModel(models.Model):
+      _name = 'my.other.model'
+
+      def button_do_stuff(self):
+          self.env['my.model'].with_delay().my_method('a', k=2)
+
+
+In the snippet of code above, when we call ``button_do_stuff``, a job **capturing
+the method and arguments** will be postponed.  It will be executed as soon as the
+Jobrunner has a free bucket, which can be instantaneous if no other job is
+running.
+
+
+Features:
+
+* Views for jobs, jobs are stored in PostgreSQL
+* Jobrunner: execute the jobs, highly efficient thanks to PostgreSQL's NOTIFY
+* Channels: give a capacity for the root channel and its sub-channels and
+  segregate jobs in them. Allow for instance to restrict heavy jobs to be
+  executed one at a time while little ones are executed 4 at a times.
+* Retries: Ability to retry jobs by raising a type of exception
+* Retry Pattern: the 3 first tries, retry after 10 seconds, the 5 next tries,
+  retry after 1 minutes, ...
+* Job properties: priorities, estimated time of arrival (ETA), custom
+  description, number of retries
+* Related Actions: link an action on the job view, such as open the record
+  concerned by the job

odoo-bringout-oca-queue-queue_job/queue_job/readme/HISTORY.rst

@@ -0,0 +1,18 @@
+.. [ The change log. The goal of this file is to help readers
+    understand changes between version. The primary audience is
+    end users and integrators. Purely technical changes such as
+    code refactoring must not be mentioned here.
+
+    This file may contain ONE level of section titles, underlined
+    with the ~ (tilde) character. Other section markers are
+    forbidden and will likely break the structure of the README.rst
+    or other documents where this fragment is included. ]
+
+Next
+~~~~
+
+* [ADD] Run jobrunner as a worker process instead of a thread in the main
+  process (when running with --workers > 0)
+* [REF] ``@job`` and ``@related_action`` deprecated, any method can be delayed,
+  and configured using ``queue.job.function`` records
+* [MIGRATION] from 13.0 branched at rev. e24ff4b

odoo-bringout-oca-queue-queue_job/queue_job/readme/INSTALL.rst

@@ -0,0 +1 @@
+Be sure to have the ``requests`` library.

odoo-bringout-oca-queue-queue_job/queue_job/readme/ROADMAP.rst

@@ -0,0 +1,18 @@
+* After creating a new database or installing ``queue_job`` on an
+  existing database, Odoo must be restarted for the runner to detect it.
+
+* When Odoo shuts down normally, it waits for running jobs to finish.
+  However, when the Odoo server crashes or is otherwise force-stopped,
+  running jobs are interrupted while the runner has no chance to know
+  they have been aborted. In such situations, jobs may remain in
+  ``started`` or ``enqueued`` state after the Odoo server is halted.
+  Since the runner has no way to know if they are actually running or
+  not, and does not know for sure if it is safe to restart the jobs,
+  it does not attempt to restart them automatically. Such stale jobs
+  therefore fill the running queue and prevent other jobs to start.
+  You must therefore requeue them manually, either from the Jobs view,
+  or by running the following SQL statement *before starting Odoo*:
+
+.. code-block:: sql
+
+  update queue_job set state='pending' where state in ('started', 'enqueued')

odoo-bringout-oca-queue-queue_job/queue_job/readme/USAGE.rst

@@ -0,0 +1,455 @@
+To use this module, you need to:
+
+#. Go to ``Job Queue`` menu
+
+Developers
+~~~~~~~~~~
+
+Delaying jobs
+-------------
+
+The fast way to enqueue a job for a method is to use ``with_delay()`` on a record
+or model:
+
+
+.. code-block:: python
+
+   def button_done(self):
+       self.with_delay().print_confirmation_document(self.state)
+       self.write({"state": "done"})
+       return True
+
+Here, the method ``print_confirmation_document()`` will be executed asynchronously
+as a job. ``with_delay()`` can take several parameters to define more precisely how
+the job is executed (priority, ...).
+
+All the arguments passed to the method being delayed are stored in the job and
+passed to the method when it is executed asynchronously, including ``self``, so
+the current record is maintained during the job execution (warning: the context
+is not kept).
+
+Dependencies can be expressed between jobs. To start a graph of jobs, use ``delayable()``
+on a record or model. The following is the equivalent of ``with_delay()`` but using the
+long form:
+
+.. code-block:: python
+
+   def button_done(self):
+       delayable = self.delayable()
+       delayable.print_confirmation_document(self.state)
+       delayable.delay()
+       self.write({"state": "done"})
+       return True
+
+Methods of Delayable objects return itself, so it can be used as a builder pattern,
+which in some cases allow to build the jobs dynamically:
+
+.. code-block:: python
+
+    def button_generate_simple_with_delayable(self):
+        self.ensure_one()
+        # Introduction of a delayable object, using a builder pattern
+        # allowing to chain jobs or set properties. The delay() method
+        # on the delayable object actually stores the delayable objects
+        # in the queue_job table
+        (
+            self.delayable()
+            .generate_thumbnail((50, 50))
+            .set(priority=30)
+            .set(description=_("generate xxx"))
+            .delay()
+        )
+
+The simplest way to define a dependency is to use ``.on_done(job)`` on a Delayable:
+
+.. code-block:: python
+
+    def button_chain_done(self):
+        self.ensure_one()
+        job1 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        job2 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        job3 = self.browse(1).delayable().generate_thumbnail((50, 50))
+        # job 3 is executed when job 2 is done which is executed when job 1 is done
+        job1.on_done(job2.on_done(job3)).delay()
+
+Delayables can be chained to form more complex graphs using the ``chain()`` and
+``group()`` primitives.
+A chain represents a sequence of jobs to execute in order, a group represents
+jobs which can be executed in parallel. Using ``chain()`` has the same effect as
+using several nested ``on_done()`` but is more readable. Both can be combined to
+form a graph, for instance we can group [A] of jobs, which blocks another group
+[B] of jobs. When and only when all the jobs of the group [A] are executed, the
+jobs of the group [B] are executed. The code would look like:
+
+.. code-block:: python
+
+   from odoo.addons.queue_job.delay import group, chain
+
+   def button_done(self):
+       group_a = group(self.delayable().method_foo(), self.delayable().method_bar())
+       group_b = group(self.delayable().method_baz(1), self.delayable().method_baz(2))
+       chain(group_a, group_b).delay()
+       self.write({"state": "done"})
+       return True
+
+When a failure happens in a graph of jobs, the execution of the jobs that depend on the
+failed job stops. They remain in a state ``wait_dependencies`` until their "parent" job is
+successful. This can happen in two ways: either the parent job retries and is successful
+on a second try, either the parent job is manually "set to done" by a user. In these two
+cases, the dependency is resolved and the graph will continue to be processed. Alternatively,
+the failed job and all its dependent jobs can be canceled by a user. The other jobs of the
+graph that do not depend on the failed job continue their execution in any case.
+
+Note: ``delay()`` must be called on the delayable, chain, or group which is at the top
+of the graph. In the example above, if it was called on ``group_a``, then ``group_b``
+would never be delayed (but a warning would be shown).
+
+It is also possible to split a job into several jobs, each one processing a part of the
+work. This can be useful to avoid very long jobs, parallelize some task and get more specific 
+errors. Usage is as follows:
+
+.. code-block:: python
+
+    def button_split_delayable(self):
+        (
+            self  # Can be a big recordset, let's say 1000 records
+            .delayable()
+            .generate_thumbnail((50, 50))
+            .set(priority=30)
+            .set(description=_("generate xxx"))
+            .split(50)  # Split the job in 20 jobs of 50 records each
+            .delay()
+        )
+
+The ``split()`` method takes a ``chain`` boolean keyword argument. If set to
+True, the jobs will be chained, meaning that the next job will only start when the previous
+one is done:
+
+.. code-block:: python
+
+    def button_increment_var(self):
+        (
+            self
+            .delayable()
+            .increment_counter()
+            .split(1, chain=True) # Will exceute the jobs one after the other
+            .delay()
+        )
+
+
+Enqueing Job Options
+--------------------
+
+* priority: default is 10, the closest it is to 0, the faster it will be
+  executed
+* eta: Estimated Time of Arrival of the job. It will not be executed before this
+  date/time
+* max_retries: default is 5, maximum number of retries before giving up and set
+  the job state to 'failed'. A value of 0 means infinite retries.
+* description: human description of the job. If not set, description is computed
+  from the function doc or method name
+* channel: the complete name of the channel to use to process the function. If
+  specified it overrides the one defined on the function
+* identity_key: key uniquely identifying the job, if specified and a job with
+  the same key has not yet been run, the new job will not be created
+
+Configure default options for jobs
+----------------------------------
+
+In earlier versions, jobs could be configured using the ``@job`` decorator.
+This is now obsolete, they can be configured using optional ``queue.job.function``
+and ``queue.job.channel`` XML records.
+
+Example of channel:
+
+.. code-block:: XML
+
+    <record id="channel_sale" model="queue.job.channel">
+        <field name="name">sale</field>
+        <field name="parent_id" ref="queue_job.channel_root" />
+    </record>
+
+Example of job function:
+
+.. code-block:: XML
+
+    <record id="job_function_sale_order_action_done" model="queue.job.function">
+        <field name="model_id" ref="sale.model_sale_order" />
+        <field name="method">action_done</field>
+        <field name="channel_id" ref="channel_sale" />
+        <field name="related_action" eval='{"func_name": "custom_related_action"}' />
+        <field name="retry_pattern" eval="{1: 60, 2: 180, 3: 10, 5: 300}" />
+    </record>
+
+The general form for the ``name`` is: ``<model.name>.method``.
+
+The channel, related action and retry pattern options are optional, they are
+documented below.
+
+When writing modules, if 2+ modules add a job function or channel with the same
+name (and parent for channels), they'll be merged in the same record, even if
+they have different xmlids. On uninstall, the merged record is deleted when all
+the modules using it are uninstalled.
+
+
+**Job function: model**
+
+If the function is defined in an abstract model, you can not write
+``<field name="model_id" ref="xml_id_of_the_abstract_model"</field>``
+but you have to define a function for each model that inherits from the abstract model.
+
+
+**Job function: channel**
+
+The channel where the job will be delayed. The default channel is ``root``.
+
+**Job function: related action**
+
+The *Related Action* appears as a button on the Job's view.
+The button will execute the defined action.
+
+The default one is to open the view of the record related to the job (form view
+when there is a single record, list view for several records).
+In many cases, the default related action is enough and doesn't need
+customization, but it can be customized by providing a dictionary on the job
+function:
+
+.. code-block:: python
+
+   {
+       "enable": False,
+       "func_name": "related_action_partner",
+       "kwargs": {"name": "Partner"},
+   }
+
+* ``enable``: when ``False``, the button has no effect (default: ``True``)
+* ``func_name``: name of the method on ``queue.job`` that returns an action
+* ``kwargs``: extra arguments to pass to the related action method
+
+Example of related action code:
+
+.. code-block:: python
+
+    class QueueJob(models.Model):
+        _inherit = 'queue.job'
+
+        def related_action_partner(self, name):
+            self.ensure_one()
+            model = self.model_name
+            partner = self.records
+            action = {
+                'name': name,
+                'type': 'ir.actions.act_window',
+                'res_model': model,
+                'view_type': 'form',
+                'view_mode': 'form',
+                'res_id': partner.id,
+            }
+            return action
+
+
+**Job function: retry pattern**
+
+When a job fails with a retryable error type, it is automatically
+retried later. By default, the retry is always 10 minutes later.
+
+A retry pattern can be configured on the job function. What a pattern represents
+is "from X tries, postpone to Y seconds". It is expressed as a dictionary where
+keys are tries and values are seconds to postpone as integers:
+
+
+.. code-block:: python
+
+   {
+       1: 10,
+       5: 20,
+       10: 30,
+       15: 300,
+   }
+
+Based on this configuration, we can tell that:
+
+* 5 first retries are postponed 10 seconds later
+* retries 5 to 10 postponed 20 seconds later
+* retries 10 to 15 postponed 30 seconds later
+* all subsequent retries postponed 5 minutes later
+
+**Job Context**
+
+The context of the recordset of the job, or any recordset passed in arguments of
+a job, is transferred to the job according to an allow-list.
+
+The default allow-list is `("tz", "lang", "allowed_company_ids", "force_company", "active_test")`. It can
+be customized in ``Base._job_prepare_context_before_enqueue_keys``.
+**Bypass jobs on running Odoo**
+
+When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.
+
+To do so you can set `QUEUE_JOB__NO_DELAY=1` in your environment.
+
+**Bypass jobs in tests**
+
+When writing tests on job-related methods is always tricky to deal with
+delayed recordsets. To make your testing life easier
+you can set `queue_job__no_delay=True` in the context.
+
+Tip: you can do this at test case level like this
+
+.. code-block:: python
+
+    @classmethod
+    def setUpClass(cls):
+        super().setUpClass()
+        cls.env = cls.env(context=dict(
+            cls.env.context,
+            queue_job__no_delay=True,  # no jobs thanks
+        ))
+
+Then all your tests execute the job methods synchronously
+without delaying any jobs.
+
+Testing
+-------
+
+**Asserting enqueued jobs**
+
+The recommended way to test jobs, rather than running them directly and synchronously is to
+split the tests in two parts:
+
+ * one test where the job is mocked (trap jobs with ``trap_jobs()`` and the test
+   only verifies that the job has been delayed with the expected arguments
+ * one test that only calls the method of the job synchronously, to validate the
+   proper behavior of this method only
+
+Proceeding this way means that you can prove that jobs will be enqueued properly
+at runtime, and it ensures your code does not have a different behavior in tests
+and in production (because running your jobs synchronously may have a different
+behavior as they are in the same transaction / in the middle of the method).
+Additionally, it gives more control on the arguments you want to pass when
+calling the job's method (synchronously, this time, in the second type of
+tests), and it makes tests smaller.
+
+The best way to run such assertions on the enqueued jobs is to use
+``odoo.addons.queue_job.tests.common.trap_jobs()``.
+
+Inside this context manager, instead of being added in the database's queue,
+jobs are pushed in an in-memory list. The context manager then provides useful
+helpers to verify that jobs have been enqueued with the expected arguments. It
+even can run the jobs of its list synchronously! Details in
+``odoo.addons.queue_job.tests.common.JobsTester``.
+
+A very small example (more details in ``tests/common.py``):
+
+.. code-block:: python
+
+    # code
+    def my_job_method(self, name, count):
+        self.write({"name": " ".join([name] * count)
+
+    def method_to_test(self):
+        count = self.env["other.model"].search_count([])
+        self.with_delay(priority=15).my_job_method("Hi!", count=count)
+        return count
+
+    # tests
+    from odoo.addons.queue_job.tests.common import trap_jobs
+
+    # first test only check the expected behavior of the method and the proper
+    # enqueuing of jobs
+    def test_method_to_test(self):
+        with trap_jobs() as trap:
+            result = self.env["model"].method_to_test()
+            expected_count = 12
+
+            trap.assert_jobs_count(1, only=self.env["model"].my_job_method)
+            trap.assert_enqueued_job(
+                self.env["model"].my_job_method,
+                args=("Hi!",),
+                kwargs=dict(count=expected_count),
+                properties=dict(priority=15)
+            )
+            self.assertEqual(result, expected_count)
+
+
+     # second test to validate the behavior of the job unitarily
+     def test_my_job_method(self):
+         record = self.env["model"].browse(1)
+         record.my_job_method("Hi!", count=12)
+         self.assertEqual(record.name, "Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!")
+
+If you prefer, you can still test the whole thing in a single test, by calling
+``jobs_tester.perform_enqueued_jobs()`` in your test.
+
+.. code-block:: python
+
+    def test_method_to_test(self):
+        with trap_jobs() as trap:
+            result = self.env["model"].method_to_test()
+            expected_count = 12
+
+            trap.assert_jobs_count(1, only=self.env["model"].my_job_method)
+            trap.assert_enqueued_job(
+                self.env["model"].my_job_method,
+                args=("Hi!",),
+                kwargs=dict(count=expected_count),
+                properties=dict(priority=15)
+            )
+            self.assertEqual(result, expected_count)
+
+            trap.perform_enqueued_jobs()
+
+            record = self.env["model"].browse(1)
+            record.my_job_method("Hi!", count=12)
+            self.assertEqual(record.name, "Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!")
+
+**Execute jobs synchronously when running Odoo**
+
+When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.
+
+To do so you can set ``QUEUE_JOB__NO_DELAY=1`` in your environment.
+
+.. WARNING:: Do not do this in production
+
+**Execute jobs synchronously in tests**
+
+You should use ``trap_jobs``, really, but if for any reason you could not use it,
+and still need to have job methods executed synchronously in your tests, you can
+do so by setting ``queue_job__no_delay=True`` in the context.
+
+Tip: you can do this at test case level like this
+
+.. code-block:: python
+
+    @classmethod
+    def setUpClass(cls):
+        super().setUpClass()
+        cls.env = cls.env(context=dict(
+            cls.env.context,
+            queue_job__no_delay=True,  # no jobs thanks
+        ))
+
+Then all your tests execute the job methods synchronously without delaying any
+jobs.
+
+In tests you'll have to mute the logger like:
+
+    @mute_logger('odoo.addons.queue_job.models.base')
+
+.. NOTE:: in graphs of jobs, the ``queue_job__no_delay`` context key must be in at
+          least one job's env of the graph for the whole graph to be executed synchronously
+
+
+Tips and tricks
+---------------
+
+* **Idempotency** (https://www.restapitutorial.com/lessons/idempotency.html): The queue_job should be idempotent so they can be retried several times without impact on the data.
+* **The job should test at the very beginning its relevance**: the moment the job will be executed is unknown by design. So the first task of a job should be to check if the related work is still relevant at the moment of the execution.
+
+Patterns
+--------
+Through the time, two main patterns emerged:
+
+1. For data exposed to users, a model should store the data and the model should be the creator of the job. The job is kept hidden from the users
+2. For technical data, that are not exposed to the users, it is generally alright to create directly jobs with data passed as arguments to the job, without intermediary models.

odoo-bringout-oca-queue-queue_job/queue_job/security/ir.model.access.csv

@@ -0,0 +1,8 @@
+id,name,model_id:id,group_id:id,perm_read,perm_write,perm_create,perm_unlink
+access_queue_job_manager,queue job manager,queue_job.model_queue_job,queue_job.group_queue_job_manager,1,1,1,1
+access_queue_job_lock_manager,queue job lock manager,queue_job.model_queue_job_lock,queue_job.group_queue_job_manager,1,0,0,0
+access_queue_job_function_manager,queue job functions manager,queue_job.model_queue_job_function,queue_job.group_queue_job_manager,1,1,1,1
+access_queue_job_channel_manager,queue job channel manager,queue_job.model_queue_job_channel,queue_job.group_queue_job_manager,1,1,1,1
+access_queue_requeue_job,queue requeue job manager,queue_job.model_queue_requeue_job,queue_job.group_queue_job_manager,1,1,1,1
+access_queue_jobs_to_done,queue jobs to done manager,queue_job.model_queue_jobs_to_done,queue_job.group_queue_job_manager,1,1,1,1
+access_queue_jobs_to_cancelled,queue jobs to cancelled manager,queue_job.model_queue_jobs_to_cancelled,queue_job.group_queue_job_manager,1,1,1,1

odoo-bringout-oca-queue-queue_job/queue_job/security/security.xml

@@ -0,0 +1,27 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+    <data>
+        <record model="ir.module.category" id="module_category_queue_job">
+            <field name="name">Job Queue</field>
+            <field name="sequence">20</field>
+        </record>
+        <record id="group_queue_job_manager" model="res.groups">
+            <field name="name">Job Queue Manager</field>
+            <field name="category_id" ref="module_category_queue_job" />
+            <field
+                name="users"
+                eval="[(4, ref('base.user_root')), (4, ref('base.user_admin'))]"
+            />
+        </record>
+    </data>
+    <data noupdate="1">
+        <record id="queue_job_comp_rule" model="ir.rule">
+            <field name="name">Job Queue multi-company</field>
+            <field name="model_id" ref="model_queue_job" />
+            <field name="global" eval="True" />
+            <field
+                name="domain_force"
+            >['|', ('company_id', '=', False), ('company_id', 'in', company_ids)]</field>
+        </record>
+    </data>
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/static/description/icon.svg

@@ -0,0 +1 @@
+<svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" width="70" height="70" viewBox="0,0,70,70"><!-- Generated with https://ivantodorovich.github.io/odoo-icon --><defs><linearGradient x1="70" y1="0" x2="0" y2="70" gradientUnits="userSpaceOnUse" id="color-1"><stop offset="0" stop-color="#ff6c68"/><stop offset="1" stop-color="#e53935"/></linearGradient></defs><g fill="none" fill-rule="nonzero" stroke="none" stroke-width="1" stroke-linecap="butt" stroke-linejoin="miter" stroke-miterlimit="10" stroke-dasharray="" stroke-dashoffset="0" font-family="none" font-weight="none" font-size="none" text-anchor="none" style="mix-blend-mode: normal"><path d="M3.5,70c-1.933,0 -3.5,-1.567 -3.5,-3.5v-63c0,-1.933 1.567,-3.5 3.5,-3.5h63c1.933,0 3.5,1.567 3.5,3.5v63c0,1.933 -1.567,3.5 -3.5,3.5z" id="box" fill="url(#color-1)"/><path d="M65,1h-61c-1.95033,0 -3.2667,0.63396 -3.9491,1.90189c0.28378,-1.64806 1.72001,-2.90189 3.4491,-2.90189h63c1.72965,0 3.16627,1.25466 3.44938,2.90352c-0.69803,-1.26902 -2.34782,-1.90352 -4.94938,-1.90352z" id="topBoxShadow" fill="#ffffff" opacity="0.383"/><path d="M4,69h61c2.66667,0 4.33333,-1 5,-3v0.5c0,1.933 -1.567,3.5 -3.5,3.5h-63c-1.933,0 -3.5,-1.567 -3.5,-3.5c0,-0.1611 0,-0.32777 0,-0.5c0.66667,2 2,3 4,3z" id="bottomBoxShadow" fill="#000000" opacity="0.383"/><path d="M12,16.55545h10.22243v10.22243h-10.22243v-10.22243M27.33333,19.1106v5.11091h30.66667v-5.11091h-30.66667M12,31.88879h10.22243v10.22243h-10.22243v-10.22243M27.33333,34.44393v5.11091h30.66667v-5.11091h-30.66667M12,47.22212h10.22243v10.22243h-10.22243v-10.22243M27.33333,49.77727v5.11091h30.66667v-5.11091z" id="shadow" fill="#000000" opacity="0.3"/><path d="M22.22243,14.55545l0,7.66605l5.11091,-5.11091h30.66667v5.11091l-10.22243,10.22243h10.22243v5.11091l-10.22243,10.22243h10.22243v5.11091l-17.11183,17.11183h-37.38817c-1.933,0 -3.5,-1.567 -3.5,-3.5l0,-39.94455l12,-12z" id="flatShadow" fill="#000000" opacity="0.324"/><path d="M12,14.55545h10.22243v10.22243h-10.22243v-10.22243M27.33333,17.1106v5.11091h30.66667v-5.11091h-30.66667M12,29.88879h10.22243v10.22243h-10.22243v-10.22243M27.33333,32.44393v5.11091h30.66667v-5.11091h-30.66667M12,45.22212h10.22243v10.22243h-10.22243v-10.22243M27.33333,47.77727v5.11091h30.66667v-5.11091z" id="icon" fill="#ffffff"/></g></svg>

odoo-bringout-oca-queue-queue_job/queue_job/static/description/index.html

@@ -0,0 +1,998 @@
+<!DOCTYPE html PUBLIC "-//W3C//DTD XHTML 1.0 Transitional//EN" "http://www.w3.org/TR/xhtml1/DTD/xhtml1-transitional.dtd">
+<html xmlns="http://www.w3.org/1999/xhtml" xml:lang="en" lang="en">
+<head>
+<meta http-equiv="Content-Type" content="text/html; charset=utf-8" />
+<meta name="generator" content="Docutils: https://docutils.sourceforge.io/" />
+<title>README.rst</title>
+<style type="text/css">
+
+/*
+:Author: David Goodger (goodger@python.org)
+:Id: $Id: html4css1.css 9511 2024-01-13 09:50:07Z milde $
+:Copyright: This stylesheet has been placed in the public domain.
+
+Default cascading style sheet for the HTML output of Docutils.
+Despite the name, some widely supported CSS2 features are used.
+
+See https://docutils.sourceforge.io/docs/howto/html-stylesheets.html for how to
+customize this style sheet.
+*/
+
+/* used to remove borders from tables and images */
+.borderless, table.borderless td, table.borderless th {
+  border: 0 }
+
+table.borderless td, table.borderless th {
+  /* Override padding for "table.docutils td" with "! important".
+     The right padding separates the table cells. */
+  padding: 0 0.5em 0 0 ! important }
+
+.first {
+  /* Override more specific margin styles with "! important". */
+  margin-top: 0 ! important }
+
+.last, .with-subtitle {
+  margin-bottom: 0 ! important }
+
+.hidden {
+  display: none }
+
+.subscript {
+  vertical-align: sub;
+  font-size: smaller }
+
+.superscript {
+  vertical-align: super;
+  font-size: smaller }
+
+a.toc-backref {
+  text-decoration: none ;
+  color: black }
+
+blockquote.epigraph {
+  margin: 2em 5em ; }
+
+dl.docutils dd {
+  margin-bottom: 0.5em }
+
+object[type="image/svg+xml"], object[type="application/x-shockwave-flash"] {
+  overflow: hidden;
+}
+
+/* Uncomment (and remove this text!) to get bold-faced definition list terms
+dl.docutils dt {
+  font-weight: bold }
+*/
+
+div.abstract {
+  margin: 2em 5em }
+
+div.abstract p.topic-title {
+  font-weight: bold ;
+  text-align: center }
+
+div.admonition, div.attention, div.caution, div.danger, div.error,
+div.hint, div.important, div.note, div.tip, div.warning {
+  margin: 2em ;
+  border: medium outset ;
+  padding: 1em }
+
+div.admonition p.admonition-title, div.hint p.admonition-title,
+div.important p.admonition-title, div.note p.admonition-title,
+div.tip p.admonition-title {
+  font-weight: bold ;
+  font-family: sans-serif }
+
+div.attention p.admonition-title, div.caution p.admonition-title,
+div.danger p.admonition-title, div.error p.admonition-title,
+div.warning p.admonition-title, .code .error {
+  color: red ;
+  font-weight: bold ;
+  font-family: sans-serif }
+
+/* Uncomment (and remove this text!) to get reduced vertical space in
+   compound paragraphs.
+div.compound .compound-first, div.compound .compound-middle {
+  margin-bottom: 0.5em }
+
+div.compound .compound-last, div.compound .compound-middle {
+  margin-top: 0.5em }
+*/
+
+div.dedication {
+  margin: 2em 5em ;
+  text-align: center ;
+  font-style: italic }
+
+div.dedication p.topic-title {
+  font-weight: bold ;
+  font-style: normal }
+
+div.figure {
+  margin-left: 2em ;
+  margin-right: 2em }
+
+div.footer, div.header {
+  clear: both;
+  font-size: smaller }
+
+div.line-block {
+  display: block ;
+  margin-top: 1em ;
+  margin-bottom: 1em }
+
+div.line-block div.line-block {
+  margin-top: 0 ;
+  margin-bottom: 0 ;
+  margin-left: 1.5em }
+
+div.sidebar {
+  margin: 0 0 0.5em 1em ;
+  border: medium outset ;
+  padding: 1em ;
+  background-color: #ffffee ;
+  width: 40% ;
+  float: right ;
+  clear: right }
+
+div.sidebar p.rubric {
+  font-family: sans-serif ;
+  font-size: medium }
+
+div.system-messages {
+  margin: 5em }
+
+div.system-messages h1 {
+  color: red }
+
+div.system-message {
+  border: medium outset ;
+  padding: 1em }
+
+div.system-message p.system-message-title {
+  color: red ;
+  font-weight: bold }
+
+div.topic {
+  margin: 2em }
+
+h1.section-subtitle, h2.section-subtitle, h3.section-subtitle,
+h4.section-subtitle, h5.section-subtitle, h6.section-subtitle {
+  margin-top: 0.4em }
+
+h1.title {
+  text-align: center }
+
+h2.subtitle {
+  text-align: center }
+
+hr.docutils {
+  width: 75% }
+
+img.align-left, .figure.align-left, object.align-left, table.align-left {
+  clear: left ;
+  float: left ;
+  margin-right: 1em }
+
+img.align-right, .figure.align-right, object.align-right, table.align-right {
+  clear: right ;
+  float: right ;
+  margin-left: 1em }
+
+img.align-center, .figure.align-center, object.align-center {
+  display: block;
+  margin-left: auto;
+  margin-right: auto;
+}
+
+table.align-center {
+  margin-left: auto;
+  margin-right: auto;
+}
+
+.align-left {
+  text-align: left }
+
+.align-center {
+  clear: both ;
+  text-align: center }
+
+.align-right {
+  text-align: right }
+
+/* reset inner alignment in figures */
+div.align-right {
+  text-align: inherit }
+
+/* div.align-center * { */
+/*   text-align: left } */
+
+.align-top    {
+  vertical-align: top }
+
+.align-middle {
+  vertical-align: middle }
+
+.align-bottom {
+  vertical-align: bottom }
+
+ol.simple, ul.simple {
+  margin-bottom: 1em }
+
+ol.arabic {
+  list-style: decimal }
+
+ol.loweralpha {
+  list-style: lower-alpha }
+
+ol.upperalpha {
+  list-style: upper-alpha }
+
+ol.lowerroman {
+  list-style: lower-roman }
+
+ol.upperroman {
+  list-style: upper-roman }
+
+p.attribution {
+  text-align: right ;
+  margin-left: 50% }
+
+p.caption {
+  font-style: italic }
+
+p.credits {
+  font-style: italic ;
+  font-size: smaller }
+
+p.label {
+  white-space: nowrap }
+
+p.rubric {
+  font-weight: bold ;
+  font-size: larger ;
+  color: maroon ;
+  text-align: center }
+
+p.sidebar-title {
+  font-family: sans-serif ;
+  font-weight: bold ;
+  font-size: larger }
+
+p.sidebar-subtitle {
+  font-family: sans-serif ;
+  font-weight: bold }
+
+p.topic-title {
+  font-weight: bold }
+
+pre.address {
+  margin-bottom: 0 ;
+  margin-top: 0 ;
+  font: inherit }
+
+pre.literal-block, pre.doctest-block, pre.math, pre.code {
+  margin-left: 2em ;
+  margin-right: 2em }
+
+pre.code .ln { color: gray; } /* line numbers */
+pre.code, code { background-color: #eeeeee }
+pre.code .comment, code .comment { color: #5C6576 }
+pre.code .keyword, code .keyword { color: #3B0D06; font-weight: bold }
+pre.code .literal.string, code .literal.string { color: #0C5404 }
+pre.code .name.builtin, code .name.builtin { color: #352B84 }
+pre.code .deleted, code .deleted { background-color: #DEB0A1}
+pre.code .inserted, code .inserted { background-color: #A3D289}
+
+span.classifier {
+  font-family: sans-serif ;
+  font-style: oblique }
+
+span.classifier-delimiter {
+  font-family: sans-serif ;
+  font-weight: bold }
+
+span.interpreted {
+  font-family: sans-serif }
+
+span.option {
+  white-space: nowrap }
+
+span.pre {
+  white-space: pre }
+
+span.problematic, pre.problematic {
+  color: red }
+
+span.section-subtitle {
+  /* font-size relative to parent (h1..h6 element) */
+  font-size: 80% }
+
+table.citation {
+  border-left: solid 1px gray;
+  margin-left: 1px }
+
+table.docinfo {
+  margin: 2em 4em }
+
+table.docutils {
+  margin-top: 0.5em ;
+  margin-bottom: 0.5em }
+
+table.footnote {
+  border-left: solid 1px black;
+  margin-left: 1px }
+
+table.docutils td, table.docutils th,
+table.docinfo td, table.docinfo th {
+  padding-left: 0.5em ;
+  padding-right: 0.5em ;
+  vertical-align: top }
+
+table.docutils th.field-name, table.docinfo th.docinfo-name {
+  font-weight: bold ;
+  text-align: left ;
+  white-space: nowrap ;
+  padding-left: 0 }
+
+/* "booktabs" style (no vertical lines) */
+table.docutils.booktabs {
+  border: 0px;
+  border-top: 2px solid;
+  border-bottom: 2px solid;
+  border-collapse: collapse;
+}
+table.docutils.booktabs * {
+  border: 0px;
+}
+table.docutils.booktabs th {
+  border-bottom: thin solid;
+  text-align: left;
+}
+
+h1 tt.docutils, h2 tt.docutils, h3 tt.docutils,
+h4 tt.docutils, h5 tt.docutils, h6 tt.docutils {
+  font-size: 100% }
+
+ul.auto-toc {
+  list-style-type: none }
+
+</style>
+</head>
+<body>
+<div class="document">
+
+
+<a class="reference external image-reference" href="https://odoo-community.org/get-involved?utm_source=readme">
+<img alt="Odoo Community Association" src="https://odoo-community.org/readme-banner-image" />
+</a>
+<div class="section" id="job-queue">
+<h1>Job Queue</h1>
+<!-- !!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+!! This file is generated by oca-gen-addon-readme !!
+!! changes will be overwritten.                   !!
+!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!
+!! source digest: sha256:7cc71c9aa5e6aec02e31b34ff1df8b45615787be688cbb13ac7714243400d7f8
+!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!!! -->
+<p><a class="reference external image-reference" href="https://odoo-community.org/page/development-status"><img alt="Mature" src="https://img.shields.io/badge/maturity-Mature-brightgreen.png" /></a> <a class="reference external image-reference" href="http://www.gnu.org/licenses/lgpl-3.0-standalone.html"><img alt="License: LGPL-3" src="https://img.shields.io/badge/license-LGPL--3-blue.png" /></a> <a class="reference external image-reference" href="https://github.com/OCA/queue/tree/16.0/queue_job"><img alt="OCA/queue" src="https://img.shields.io/badge/github-OCA%2Fqueue-lightgray.png?logo=github" /></a> <a class="reference external image-reference" href="https://translation.odoo-community.org/projects/queue-16-0/queue-16-0-queue_job"><img alt="Translate me on Weblate" src="https://img.shields.io/badge/weblate-Translate%20me-F47D42.png" /></a> <a class="reference external image-reference" href="https://runboat.odoo-community.org/builds?repo=OCA/queue&amp;target_branch=16.0"><img alt="Try me on Runboat" src="https://img.shields.io/badge/runboat-Try%20me-875A7B.png" /></a></p>
+<p>This addon adds an integrated Job Queue to Odoo.</p>
+<p>It allows to postpone method calls executed asynchronously.</p>
+<p>Jobs are executed in the background by a <tt class="docutils literal">Jobrunner</tt>, in their own transaction.</p>
+<p>Example:</p>
+<pre class="code python literal-block">
+<span class="kn">from</span><span class="w"> </span><span class="nn">odoo</span><span class="w"> </span><span class="kn">import</span> <span class="n">models</span><span class="p">,</span> <span class="n">fields</span><span class="p">,</span> <span class="n">api</span><span class="w">
+
+</span><span class="k">class</span><span class="w"> </span><span class="nc">MyModel</span><span class="p">(</span><span class="n">models</span><span class="o">.</span><span class="n">Model</span><span class="p">):</span><span class="w">
+</span>   <span class="n">_name</span> <span class="o">=</span> <span class="s1">'my.model'</span><span class="w">
+
+</span>   <span class="k">def</span><span class="w"> </span><span class="nf">my_method</span><span class="p">(</span><span class="bp">self</span><span class="p">,</span> <span class="n">a</span><span class="p">,</span> <span class="n">k</span><span class="o">=</span><span class="kc">None</span><span class="p">):</span><span class="w">
+</span>       <span class="n">_logger</span><span class="o">.</span><span class="n">info</span><span class="p">(</span><span class="s1">'executed with a: </span><span class="si">%s</span><span class="s1"> and k: </span><span class="si">%s</span><span class="s1">'</span><span class="p">,</span> <span class="n">a</span><span class="p">,</span> <span class="n">k</span><span class="p">)</span><span class="w">
+
+
+</span><span class="k">class</span><span class="w"> </span><span class="nc">MyOtherModel</span><span class="p">(</span><span class="n">models</span><span class="o">.</span><span class="n">Model</span><span class="p">):</span><span class="w">
+</span>    <span class="n">_name</span> <span class="o">=</span> <span class="s1">'my.other.model'</span><span class="w">
+
+</span>    <span class="k">def</span><span class="w"> </span><span class="nf">button_do_stuff</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s1">'my.model'</span><span class="p">]</span><span class="o">.</span><span class="n">with_delay</span><span class="p">()</span><span class="o">.</span><span class="n">my_method</span><span class="p">(</span><span class="s1">'a'</span><span class="p">,</span> <span class="n">k</span><span class="o">=</span><span class="mi">2</span><span class="p">)</span>
+</pre>
+<p>In the snippet of code above, when we call <tt class="docutils literal">button_do_stuff</tt>, a job <strong>capturing
+the method and arguments</strong> will be postponed.  It will be executed as soon as the
+Jobrunner has a free bucket, which can be instantaneous if no other job is
+running.</p>
+<p>Features:</p>
+<ul class="simple">
+<li>Views for jobs, jobs are stored in PostgreSQL</li>
+<li>Jobrunner: execute the jobs, highly efficient thanks to PostgreSQL’s NOTIFY</li>
+<li>Channels: give a capacity for the root channel and its sub-channels and
+segregate jobs in them. Allow for instance to restrict heavy jobs to be
+executed one at a time while little ones are executed 4 at a times.</li>
+<li>Retries: Ability to retry jobs by raising a type of exception</li>
+<li>Retry Pattern: the 3 first tries, retry after 10 seconds, the 5 next tries,
+retry after 1 minutes, …</li>
+<li>Job properties: priorities, estimated time of arrival (ETA), custom
+description, number of retries</li>
+<li>Related Actions: link an action on the job view, such as open the record
+concerned by the job</li>
+</ul>
+<p><strong>Table of contents</strong></p>
+<div class="contents local topic" id="contents">
+<ul class="simple">
+<li><a class="reference internal" href="#installation" id="toc-entry-1">Installation</a></li>
+<li><a class="reference internal" href="#configuration" id="toc-entry-2">Configuration</a></li>
+<li><a class="reference internal" href="#usage" id="toc-entry-3">Usage</a><ul>
+<li><a class="reference internal" href="#developers" id="toc-entry-4">Developers</a><ul>
+<li><a class="reference internal" href="#delaying-jobs" id="toc-entry-5">Delaying jobs</a></li>
+<li><a class="reference internal" href="#enqueing-job-options" id="toc-entry-6">Enqueing Job Options</a></li>
+<li><a class="reference internal" href="#configure-default-options-for-jobs" id="toc-entry-7">Configure default options for jobs</a></li>
+<li><a class="reference internal" href="#testing" id="toc-entry-8">Testing</a></li>
+<li><a class="reference internal" href="#tips-and-tricks" id="toc-entry-9">Tips and tricks</a></li>
+<li><a class="reference internal" href="#patterns" id="toc-entry-10">Patterns</a></li>
+</ul>
+</li>
+</ul>
+</li>
+<li><a class="reference internal" href="#known-issues-roadmap" id="toc-entry-11">Known issues / Roadmap</a></li>
+<li><a class="reference internal" href="#changelog" id="toc-entry-12">Changelog</a><ul>
+<li><a class="reference internal" href="#next" id="toc-entry-13">Next</a></li>
+</ul>
+</li>
+<li><a class="reference internal" href="#bug-tracker" id="toc-entry-14">Bug Tracker</a></li>
+<li><a class="reference internal" href="#credits" id="toc-entry-15">Credits</a><ul>
+<li><a class="reference internal" href="#authors" id="toc-entry-16">Authors</a></li>
+<li><a class="reference internal" href="#contributors" id="toc-entry-17">Contributors</a></li>
+<li><a class="reference internal" href="#maintainers" id="toc-entry-18">Maintainers</a></li>
+</ul>
+</li>
+</ul>
+</div>
+<div class="section" id="installation">
+<h2><a class="toc-backref" href="#toc-entry-1">Installation</a></h2>
+<p>Be sure to have the <tt class="docutils literal">requests</tt> library.</p>
+</div>
+<div class="section" id="configuration">
+<h2><a class="toc-backref" href="#toc-entry-2">Configuration</a></h2>
+<ul class="simple">
+<li>Using environment variables and command line:<ul>
+<li>Adjust environment variables (optional):<ul>
+<li><tt class="docutils literal">ODOO_QUEUE_JOB_CHANNELS=root:4</tt> or any other channels configuration.
+The default is <tt class="docutils literal">root:1</tt></li>
+<li>if <tt class="docutils literal">xmlrpc_port</tt> is not set: <tt class="docutils literal">ODOO_QUEUE_JOB_PORT=8069</tt></li>
+</ul>
+</li>
+<li>Start Odoo with <tt class="docutils literal"><span class="pre">--load=web,queue_job</span></tt>
+and <tt class="docutils literal"><span class="pre">--workers</span></tt> greater than 1. <a class="footnote-reference" href="#footnote-1" id="footnote-reference-1">[1]</a></li>
+</ul>
+</li>
+<li>Keep in mind that the number of workers should be greater than the number of
+channels. <tt class="docutils literal">queue_job</tt> will reuse normal Odoo workers to process jobs. It
+will not spawn its own workers.</li>
+<li>Using the Odoo configuration file:</li>
+</ul>
+<pre class="code ini literal-block">
+<span class="k">[options]</span><span class="w">
+</span><span class="na">(...)</span><span class="w">
+</span><span class="na">workers</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="s">6</span><span class="w">
+</span><span class="na">server_wide_modules</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="s">web,queue_job</span><span class="w">
+
+</span><span class="na">(...)</span><span class="w">
+</span><span class="k">[queue_job]</span><span class="w">
+</span><span class="na">channels</span><span class="w"> </span><span class="o">=</span><span class="w"> </span><span class="s">root:2</span>
+</pre>
+<ul class="simple">
+<li>Environment variables have priority over the configuration file.</li>
+<li>Confirm the runner is starting correctly by checking the odoo log file:</li>
+</ul>
+<pre class="code literal-block">
+...INFO...queue_job.jobrunner.runner: starting
+...INFO...queue_job.jobrunner.runner: initializing database connections
+...INFO...queue_job.jobrunner.runner: queue job runner ready for db &lt;dbname&gt;
+...INFO...queue_job.jobrunner.runner: database connections ready
+</pre>
+<ul class="simple">
+<li>Create jobs (eg using <tt class="docutils literal">base_import_async</tt>) and observe they
+start immediately and in parallel.</li>
+<li>Tip: to enable debug logging for the queue job, use
+<tt class="docutils literal"><span class="pre">--log-handler=odoo.addons.queue_job:DEBUG</span></tt></li>
+</ul>
+<table class="docutils footnote" frame="void" id="footnote-1" rules="none">
+<colgroup><col class="label" /><col /></colgroup>
+<tbody valign="top">
+<tr><td class="label"><a class="fn-backref" href="#footnote-reference-1">[1]</a></td><td>It works with the threaded Odoo server too, although this way
+of running Odoo is obviously not for production purposes.</td></tr>
+</tbody>
+</table>
+<ul class="simple">
+<li>Jobs that remain in <cite>enqueued</cite> or <cite>started</cite> state (because, for instance, their worker has been killed) will be automatically re-queued.</li>
+</ul>
+</div>
+<div class="section" id="usage">
+<h2><a class="toc-backref" href="#toc-entry-3">Usage</a></h2>
+<p>To use this module, you need to:</p>
+<ol class="arabic simple">
+<li>Go to <tt class="docutils literal">Job Queue</tt> menu</li>
+</ol>
+<div class="section" id="developers">
+<h3><a class="toc-backref" href="#toc-entry-4">Developers</a></h3>
+<div class="section" id="delaying-jobs">
+<h4><a class="toc-backref" href="#toc-entry-5">Delaying jobs</a></h4>
+<p>The fast way to enqueue a job for a method is to use <tt class="docutils literal">with_delay()</tt> on a record
+or model:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_done</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">with_delay</span><span class="p">()</span><span class="o">.</span><span class="n">print_confirmation_document</span><span class="p">(</span><span class="bp">self</span><span class="o">.</span><span class="n">state</span><span class="p">)</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">write</span><span class="p">({</span><span class="s2">&quot;state&quot;</span><span class="p">:</span> <span class="s2">&quot;done&quot;</span><span class="p">})</span><span class="w">
+</span>    <span class="k">return</span> <span class="kc">True</span>
+</pre>
+<p>Here, the method <tt class="docutils literal">print_confirmation_document()</tt> will be executed asynchronously
+as a job. <tt class="docutils literal">with_delay()</tt> can take several parameters to define more precisely how
+the job is executed (priority, …).</p>
+<p>All the arguments passed to the method being delayed are stored in the job and
+passed to the method when it is executed asynchronously, including <tt class="docutils literal">self</tt>, so
+the current record is maintained during the job execution (warning: the context
+is not kept).</p>
+<p>Dependencies can be expressed between jobs. To start a graph of jobs, use <tt class="docutils literal">delayable()</tt>
+on a record or model. The following is the equivalent of <tt class="docutils literal">with_delay()</tt> but using the
+long form:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_done</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="n">delayable</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="w">
+</span>    <span class="n">delayable</span><span class="o">.</span><span class="n">print_confirmation_document</span><span class="p">(</span><span class="bp">self</span><span class="o">.</span><span class="n">state</span><span class="p">)</span><span class="w">
+</span>    <span class="n">delayable</span><span class="o">.</span><span class="n">delay</span><span class="p">()</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">write</span><span class="p">({</span><span class="s2">&quot;state&quot;</span><span class="p">:</span> <span class="s2">&quot;done&quot;</span><span class="p">})</span><span class="w">
+</span>    <span class="k">return</span> <span class="kc">True</span>
+</pre>
+<p>Methods of Delayable objects return itself, so it can be used as a builder pattern,
+which in some cases allow to build the jobs dynamically:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_generate_simple_with_delayable</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">ensure_one</span><span class="p">()</span><span class="w">
+</span>    <span class="c1"># Introduction of a delayable object, using a builder pattern</span><span class="w">
+</span>    <span class="c1"># allowing to chain jobs or set properties. The delay() method</span><span class="w">
+</span>    <span class="c1"># on the delayable object actually stores the delayable objects</span><span class="w">
+</span>    <span class="c1"># in the queue_job table</span><span class="w">
+</span>    <span class="p">(</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="w">
+</span>        <span class="o">.</span><span class="n">generate_thumbnail</span><span class="p">((</span><span class="mi">50</span><span class="p">,</span> <span class="mi">50</span><span class="p">))</span><span class="w">
+</span>        <span class="o">.</span><span class="n">set</span><span class="p">(</span><span class="n">priority</span><span class="o">=</span><span class="mi">30</span><span class="p">)</span><span class="w">
+</span>        <span class="o">.</span><span class="n">set</span><span class="p">(</span><span class="n">description</span><span class="o">=</span><span class="n">_</span><span class="p">(</span><span class="s2">&quot;generate xxx&quot;</span><span class="p">))</span><span class="w">
+</span>        <span class="o">.</span><span class="n">delay</span><span class="p">()</span><span class="w">
+</span>    <span class="p">)</span>
+</pre>
+<p>The simplest way to define a dependency is to use <tt class="docutils literal">.on_done(job)</tt> on a Delayable:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_chain_done</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">ensure_one</span><span class="p">()</span><span class="w">
+</span>    <span class="n">job1</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">browse</span><span class="p">(</span><span class="mi">1</span><span class="p">)</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">generate_thumbnail</span><span class="p">((</span><span class="mi">50</span><span class="p">,</span> <span class="mi">50</span><span class="p">))</span><span class="w">
+</span>    <span class="n">job2</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">browse</span><span class="p">(</span><span class="mi">1</span><span class="p">)</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">generate_thumbnail</span><span class="p">((</span><span class="mi">50</span><span class="p">,</span> <span class="mi">50</span><span class="p">))</span><span class="w">
+</span>    <span class="n">job3</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">browse</span><span class="p">(</span><span class="mi">1</span><span class="p">)</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">generate_thumbnail</span><span class="p">((</span><span class="mi">50</span><span class="p">,</span> <span class="mi">50</span><span class="p">))</span><span class="w">
+</span>    <span class="c1"># job 3 is executed when job 2 is done which is executed when job 1 is done</span><span class="w">
+</span>    <span class="n">job1</span><span class="o">.</span><span class="n">on_done</span><span class="p">(</span><span class="n">job2</span><span class="o">.</span><span class="n">on_done</span><span class="p">(</span><span class="n">job3</span><span class="p">))</span><span class="o">.</span><span class="n">delay</span><span class="p">()</span>
+</pre>
+<p>Delayables can be chained to form more complex graphs using the <tt class="docutils literal">chain()</tt> and
+<tt class="docutils literal">group()</tt> primitives.
+A chain represents a sequence of jobs to execute in order, a group represents
+jobs which can be executed in parallel. Using <tt class="docutils literal">chain()</tt> has the same effect as
+using several nested <tt class="docutils literal">on_done()</tt> but is more readable. Both can be combined to
+form a graph, for instance we can group [A] of jobs, which blocks another group
+[B] of jobs. When and only when all the jobs of the group [A] are executed, the
+jobs of the group [B] are executed. The code would look like:</p>
+<pre class="code python literal-block">
+<span class="kn">from</span><span class="w"> </span><span class="nn">odoo.addons.queue_job.delay</span><span class="w"> </span><span class="kn">import</span> <span class="n">group</span><span class="p">,</span> <span class="n">chain</span><span class="w">
+
+</span><span class="k">def</span><span class="w"> </span><span class="nf">button_done</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="n">group_a</span> <span class="o">=</span> <span class="n">group</span><span class="p">(</span><span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">method_foo</span><span class="p">(),</span> <span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">method_bar</span><span class="p">())</span><span class="w">
+</span>    <span class="n">group_b</span> <span class="o">=</span> <span class="n">group</span><span class="p">(</span><span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">method_baz</span><span class="p">(</span><span class="mi">1</span><span class="p">),</span> <span class="bp">self</span><span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="o">.</span><span class="n">method_baz</span><span class="p">(</span><span class="mi">2</span><span class="p">))</span><span class="w">
+</span>    <span class="n">chain</span><span class="p">(</span><span class="n">group_a</span><span class="p">,</span> <span class="n">group_b</span><span class="p">)</span><span class="o">.</span><span class="n">delay</span><span class="p">()</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">write</span><span class="p">({</span><span class="s2">&quot;state&quot;</span><span class="p">:</span> <span class="s2">&quot;done&quot;</span><span class="p">})</span><span class="w">
+</span>    <span class="k">return</span> <span class="kc">True</span>
+</pre>
+<p>When a failure happens in a graph of jobs, the execution of the jobs that depend on the
+failed job stops. They remain in a state <tt class="docutils literal">wait_dependencies</tt> until their “parent” job is
+successful. This can happen in two ways: either the parent job retries and is successful
+on a second try, either the parent job is manually “set to done” by a user. In these two
+cases, the dependency is resolved and the graph will continue to be processed. Alternatively,
+the failed job and all its dependent jobs can be canceled by a user. The other jobs of the
+graph that do not depend on the failed job continue their execution in any case.</p>
+<p>Note: <tt class="docutils literal">delay()</tt> must be called on the delayable, chain, or group which is at the top
+of the graph. In the example above, if it was called on <tt class="docutils literal">group_a</tt>, then <tt class="docutils literal">group_b</tt>
+would never be delayed (but a warning would be shown).</p>
+<p>It is also possible to split a job into several jobs, each one processing a part of the
+work. This can be useful to avoid very long jobs, parallelize some task and get more specific
+errors. Usage is as follows:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_split_delayable</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="p">(</span><span class="w">
+</span>        <span class="bp">self</span>  <span class="c1"># Can be a big recordset, let's say 1000 records</span><span class="w">
+</span>        <span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="w">
+</span>        <span class="o">.</span><span class="n">generate_thumbnail</span><span class="p">((</span><span class="mi">50</span><span class="p">,</span> <span class="mi">50</span><span class="p">))</span><span class="w">
+</span>        <span class="o">.</span><span class="n">set</span><span class="p">(</span><span class="n">priority</span><span class="o">=</span><span class="mi">30</span><span class="p">)</span><span class="w">
+</span>        <span class="o">.</span><span class="n">set</span><span class="p">(</span><span class="n">description</span><span class="o">=</span><span class="n">_</span><span class="p">(</span><span class="s2">&quot;generate xxx&quot;</span><span class="p">))</span><span class="w">
+</span>        <span class="o">.</span><span class="n">split</span><span class="p">(</span><span class="mi">50</span><span class="p">)</span>  <span class="c1"># Split the job in 20 jobs of 50 records each</span><span class="w">
+</span>        <span class="o">.</span><span class="n">delay</span><span class="p">()</span><span class="w">
+</span>    <span class="p">)</span>
+</pre>
+<p>The <tt class="docutils literal">split()</tt> method takes a <tt class="docutils literal">chain</tt> boolean keyword argument. If set to
+True, the jobs will be chained, meaning that the next job will only start when the previous
+one is done:</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">button_increment_var</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="p">(</span><span class="w">
+</span>        <span class="bp">self</span><span class="w">
+</span>        <span class="o">.</span><span class="n">delayable</span><span class="p">()</span><span class="w">
+</span>        <span class="o">.</span><span class="n">increment_counter</span><span class="p">()</span><span class="w">
+</span>        <span class="o">.</span><span class="n">split</span><span class="p">(</span><span class="mi">1</span><span class="p">,</span> <span class="n">chain</span><span class="o">=</span><span class="kc">True</span><span class="p">)</span> <span class="c1"># Will exceute the jobs one after the other</span><span class="w">
+</span>        <span class="o">.</span><span class="n">delay</span><span class="p">()</span><span class="w">
+</span>    <span class="p">)</span>
+</pre>
+</div>
+<div class="section" id="enqueing-job-options">
+<h4><a class="toc-backref" href="#toc-entry-6">Enqueing Job Options</a></h4>
+<ul class="simple">
+<li>priority: default is 10, the closest it is to 0, the faster it will be
+executed</li>
+<li>eta: Estimated Time of Arrival of the job. It will not be executed before this
+date/time</li>
+<li>max_retries: default is 5, maximum number of retries before giving up and set
+the job state to ‘failed’. A value of 0 means infinite retries.</li>
+<li>description: human description of the job. If not set, description is computed
+from the function doc or method name</li>
+<li>channel: the complete name of the channel to use to process the function. If
+specified it overrides the one defined on the function</li>
+<li>identity_key: key uniquely identifying the job, if specified and a job with
+the same key has not yet been run, the new job will not be created</li>
+</ul>
+</div>
+<div class="section" id="configure-default-options-for-jobs">
+<h4><a class="toc-backref" href="#toc-entry-7">Configure default options for jobs</a></h4>
+<p>In earlier versions, jobs could be configured using the <tt class="docutils literal">&#64;job</tt> decorator.
+This is now obsolete, they can be configured using optional <tt class="docutils literal">queue.job.function</tt>
+and <tt class="docutils literal">queue.job.channel</tt> XML records.</p>
+<p>Example of channel:</p>
+<pre class="code XML literal-block">
+<span class="nt">&lt;record</span><span class="w"> </span><span class="na">id=</span><span class="s">&quot;channel_sale&quot;</span><span class="w"> </span><span class="na">model=</span><span class="s">&quot;queue.job.channel&quot;</span><span class="nt">&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;name&quot;</span><span class="nt">&gt;</span>sale<span class="nt">&lt;/field&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;parent_id&quot;</span><span class="w"> </span><span class="na">ref=</span><span class="s">&quot;queue_job.channel_root&quot;</span><span class="w"> </span><span class="nt">/&gt;</span><span class="w">
+</span><span class="nt">&lt;/record&gt;</span>
+</pre>
+<p>Example of job function:</p>
+<pre class="code XML literal-block">
+<span class="nt">&lt;record</span><span class="w"> </span><span class="na">id=</span><span class="s">&quot;job_function_sale_order_action_done&quot;</span><span class="w"> </span><span class="na">model=</span><span class="s">&quot;queue.job.function&quot;</span><span class="nt">&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;model_id&quot;</span><span class="w"> </span><span class="na">ref=</span><span class="s">&quot;sale.model_sale_order&quot;</span><span class="w"> </span><span class="nt">/&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;method&quot;</span><span class="nt">&gt;</span>action_done<span class="nt">&lt;/field&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;channel_id&quot;</span><span class="w"> </span><span class="na">ref=</span><span class="s">&quot;channel_sale&quot;</span><span class="w"> </span><span class="nt">/&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;related_action&quot;</span><span class="w"> </span><span class="na">eval=</span><span class="s">'{&quot;func_name&quot;: &quot;custom_related_action&quot;}'</span><span class="w"> </span><span class="nt">/&gt;</span><span class="w">
+    </span><span class="nt">&lt;field</span><span class="w"> </span><span class="na">name=</span><span class="s">&quot;retry_pattern&quot;</span><span class="w"> </span><span class="na">eval=</span><span class="s">&quot;{1: 60, 2: 180, 3: 10, 5: 300}&quot;</span><span class="w"> </span><span class="nt">/&gt;</span><span class="w">
+</span><span class="nt">&lt;/record&gt;</span>
+</pre>
+<p>The general form for the <tt class="docutils literal">name</tt> is: <tt class="docutils literal"><span class="pre">&lt;model.name&gt;.method</span></tt>.</p>
+<p>The channel, related action and retry pattern options are optional, they are
+documented below.</p>
+<p>When writing modules, if 2+ modules add a job function or channel with the same
+name (and parent for channels), they’ll be merged in the same record, even if
+they have different xmlids. On uninstall, the merged record is deleted when all
+the modules using it are uninstalled.</p>
+<p><strong>Job function: model</strong></p>
+<p>If the function is defined in an abstract model, you can not write
+<tt class="docutils literal">&lt;field <span class="pre">name=&quot;model_id&quot;</span> <span class="pre">ref=&quot;xml_id_of_the_abstract_model&quot;&lt;/field&gt;</span></tt>
+but you have to define a function for each model that inherits from the abstract model.</p>
+<p><strong>Job function: channel</strong></p>
+<p>The channel where the job will be delayed. The default channel is <tt class="docutils literal">root</tt>.</p>
+<p><strong>Job function: related action</strong></p>
+<p>The <em>Related Action</em> appears as a button on the Job’s view.
+The button will execute the defined action.</p>
+<p>The default one is to open the view of the record related to the job (form view
+when there is a single record, list view for several records).
+In many cases, the default related action is enough and doesn’t need
+customization, but it can be customized by providing a dictionary on the job
+function:</p>
+<pre class="code python literal-block">
+<span class="p">{</span><span class="w">
+</span>    <span class="s2">&quot;enable&quot;</span><span class="p">:</span> <span class="kc">False</span><span class="p">,</span><span class="w">
+</span>    <span class="s2">&quot;func_name&quot;</span><span class="p">:</span> <span class="s2">&quot;related_action_partner&quot;</span><span class="p">,</span><span class="w">
+</span>    <span class="s2">&quot;kwargs&quot;</span><span class="p">:</span> <span class="p">{</span><span class="s2">&quot;name&quot;</span><span class="p">:</span> <span class="s2">&quot;Partner&quot;</span><span class="p">},</span><span class="w">
+</span><span class="p">}</span>
+</pre>
+<ul class="simple">
+<li><tt class="docutils literal">enable</tt>: when <tt class="docutils literal">False</tt>, the button has no effect (default: <tt class="docutils literal">True</tt>)</li>
+<li><tt class="docutils literal">func_name</tt>: name of the method on <tt class="docutils literal">queue.job</tt> that returns an action</li>
+<li><tt class="docutils literal">kwargs</tt>: extra arguments to pass to the related action method</li>
+</ul>
+<p>Example of related action code:</p>
+<pre class="code python literal-block">
+<span class="k">class</span><span class="w"> </span><span class="nc">QueueJob</span><span class="p">(</span><span class="n">models</span><span class="o">.</span><span class="n">Model</span><span class="p">):</span><span class="w">
+</span>    <span class="n">_inherit</span> <span class="o">=</span> <span class="s1">'queue.job'</span><span class="w">
+
+</span>    <span class="k">def</span><span class="w"> </span><span class="nf">related_action_partner</span><span class="p">(</span><span class="bp">self</span><span class="p">,</span> <span class="n">name</span><span class="p">):</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">ensure_one</span><span class="p">()</span><span class="w">
+</span>        <span class="n">model</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">model_name</span><span class="w">
+</span>        <span class="n">partner</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">records</span><span class="w">
+</span>        <span class="n">action</span> <span class="o">=</span> <span class="p">{</span><span class="w">
+</span>            <span class="s1">'name'</span><span class="p">:</span> <span class="n">name</span><span class="p">,</span><span class="w">
+</span>            <span class="s1">'type'</span><span class="p">:</span> <span class="s1">'ir.actions.act_window'</span><span class="p">,</span><span class="w">
+</span>            <span class="s1">'res_model'</span><span class="p">:</span> <span class="n">model</span><span class="p">,</span><span class="w">
+</span>            <span class="s1">'view_type'</span><span class="p">:</span> <span class="s1">'form'</span><span class="p">,</span><span class="w">
+</span>            <span class="s1">'view_mode'</span><span class="p">:</span> <span class="s1">'form'</span><span class="p">,</span><span class="w">
+</span>            <span class="s1">'res_id'</span><span class="p">:</span> <span class="n">partner</span><span class="o">.</span><span class="n">id</span><span class="p">,</span><span class="w">
+</span>        <span class="p">}</span><span class="w">
+</span>        <span class="k">return</span> <span class="n">action</span>
+</pre>
+<p><strong>Job function: retry pattern</strong></p>
+<p>When a job fails with a retryable error type, it is automatically
+retried later. By default, the retry is always 10 minutes later.</p>
+<p>A retry pattern can be configured on the job function. What a pattern represents
+is “from X tries, postpone to Y seconds”. It is expressed as a dictionary where
+keys are tries and values are seconds to postpone as integers:</p>
+<pre class="code python literal-block">
+<span class="p">{</span><span class="w">
+</span>    <span class="mi">1</span><span class="p">:</span> <span class="mi">10</span><span class="p">,</span><span class="w">
+</span>    <span class="mi">5</span><span class="p">:</span> <span class="mi">20</span><span class="p">,</span><span class="w">
+</span>    <span class="mi">10</span><span class="p">:</span> <span class="mi">30</span><span class="p">,</span><span class="w">
+</span>    <span class="mi">15</span><span class="p">:</span> <span class="mi">300</span><span class="p">,</span><span class="w">
+</span><span class="p">}</span>
+</pre>
+<p>Based on this configuration, we can tell that:</p>
+<ul class="simple">
+<li>5 first retries are postponed 10 seconds later</li>
+<li>retries 5 to 10 postponed 20 seconds later</li>
+<li>retries 10 to 15 postponed 30 seconds later</li>
+<li>all subsequent retries postponed 5 minutes later</li>
+</ul>
+<p><strong>Job Context</strong></p>
+<p>The context of the recordset of the job, or any recordset passed in arguments of
+a job, is transferred to the job according to an allow-list.</p>
+<p>The default allow-list is <cite>(“tz”, “lang”, “allowed_company_ids”, “force_company”, “active_test”)</cite>. It can
+be customized in <tt class="docutils literal">Base._job_prepare_context_before_enqueue_keys</tt>.
+<strong>Bypass jobs on running Odoo</strong></p>
+<p>When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.</p>
+<p>To do so you can set <cite>QUEUE_JOB__NO_DELAY=1</cite> in your environment.</p>
+<p><strong>Bypass jobs in tests</strong></p>
+<p>When writing tests on job-related methods is always tricky to deal with
+delayed recordsets. To make your testing life easier
+you can set <cite>queue_job__no_delay=True</cite> in the context.</p>
+<p>Tip: you can do this at test case level like this</p>
+<pre class="code python literal-block">
+<span class="nd">&#64;classmethod</span><span class="w">
+</span><span class="k">def</span><span class="w"> </span><span class="nf">setUpClass</span><span class="p">(</span><span class="bp">cls</span><span class="p">):</span><span class="w">
+</span>    <span class="nb">super</span><span class="p">()</span><span class="o">.</span><span class="n">setUpClass</span><span class="p">()</span><span class="w">
+</span>    <span class="bp">cls</span><span class="o">.</span><span class="n">env</span> <span class="o">=</span> <span class="bp">cls</span><span class="o">.</span><span class="n">env</span><span class="p">(</span><span class="n">context</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="w">
+</span>        <span class="bp">cls</span><span class="o">.</span><span class="n">env</span><span class="o">.</span><span class="n">context</span><span class="p">,</span><span class="w">
+</span>        <span class="n">queue_job__no_delay</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span>  <span class="c1"># no jobs thanks</span><span class="w">
+</span>    <span class="p">))</span>
+</pre>
+<p>Then all your tests execute the job methods synchronously
+without delaying any jobs.</p>
+</div>
+<div class="section" id="testing">
+<h4><a class="toc-backref" href="#toc-entry-8">Testing</a></h4>
+<p><strong>Asserting enqueued jobs</strong></p>
+<p>The recommended way to test jobs, rather than running them directly and synchronously is to
+split the tests in two parts:</p>
+<blockquote>
+<ul class="simple">
+<li>one test where the job is mocked (trap jobs with <tt class="docutils literal">trap_jobs()</tt> and the test
+only verifies that the job has been delayed with the expected arguments</li>
+<li>one test that only calls the method of the job synchronously, to validate the
+proper behavior of this method only</li>
+</ul>
+</blockquote>
+<p>Proceeding this way means that you can prove that jobs will be enqueued properly
+at runtime, and it ensures your code does not have a different behavior in tests
+and in production (because running your jobs synchronously may have a different
+behavior as they are in the same transaction / in the middle of the method).
+Additionally, it gives more control on the arguments you want to pass when
+calling the job’s method (synchronously, this time, in the second type of
+tests), and it makes tests smaller.</p>
+<p>The best way to run such assertions on the enqueued jobs is to use
+<tt class="docutils literal">odoo.addons.queue_job.tests.common.trap_jobs()</tt>.</p>
+<p>Inside this context manager, instead of being added in the database’s queue,
+jobs are pushed in an in-memory list. The context manager then provides useful
+helpers to verify that jobs have been enqueued with the expected arguments. It
+even can run the jobs of its list synchronously! Details in
+<tt class="docutils literal">odoo.addons.queue_job.tests.common.JobsTester</tt>.</p>
+<p>A very small example (more details in <tt class="docutils literal">tests/common.py</tt>):</p>
+<pre class="code python literal-block">
+<span class="c1"># code</span><span class="w">
+</span><span class="k">def</span><span class="w"> </span><span class="nf">my_job_method</span><span class="p">(</span><span class="bp">self</span><span class="p">,</span> <span class="n">name</span><span class="p">,</span> <span class="n">count</span><span class="p">):</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">write</span><span class="p">({</span><span class="s2">&quot;name&quot;</span><span class="p">:</span> <span class="s2">&quot; &quot;</span><span class="o">.</span><span class="n">join</span><span class="p">([</span><span class="n">name</span><span class="p">]</span> <span class="o">*</span> <span class="n">count</span><span class="p">)</span><span class="w">
+
+</span><span class="k">def</span><span class="w"> </span><span class="nf">method_to_test</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="n">count</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;other.model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">search_count</span><span class="p">([])</span><span class="w">
+</span>    <span class="bp">self</span><span class="o">.</span><span class="n">with_delay</span><span class="p">(</span><span class="n">priority</span><span class="o">=</span><span class="mi">15</span><span class="p">)</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">(</span><span class="s2">&quot;Hi!&quot;</span><span class="p">,</span> <span class="n">count</span><span class="o">=</span><span class="n">count</span><span class="p">)</span><span class="w">
+</span>    <span class="k">return</span> <span class="n">count</span><span class="w">
+
+</span><span class="c1"># tests</span><span class="w">
+</span><span class="kn">from</span><span class="w"> </span><span class="nn">odoo.addons.queue_job.tests.common</span><span class="w"> </span><span class="kn">import</span> <span class="n">trap_jobs</span><span class="w">
+
+</span><span class="c1"># first test only check the expected behavior of the method and the proper</span><span class="w">
+</span><span class="c1"># enqueuing of jobs</span><span class="w">
+</span><span class="k">def</span><span class="w"> </span><span class="nf">test_method_to_test</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="k">with</span> <span class="n">trap_jobs</span><span class="p">()</span> <span class="k">as</span> <span class="n">trap</span><span class="p">:</span><span class="w">
+</span>        <span class="n">result</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">method_to_test</span><span class="p">()</span><span class="w">
+</span>        <span class="n">expected_count</span> <span class="o">=</span> <span class="mi">12</span><span class="w">
+
+</span>        <span class="n">trap</span><span class="o">.</span><span class="n">assert_jobs_count</span><span class="p">(</span><span class="mi">1</span><span class="p">,</span> <span class="n">only</span><span class="o">=</span><span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">)</span><span class="w">
+</span>        <span class="n">trap</span><span class="o">.</span><span class="n">assert_enqueued_job</span><span class="p">(</span><span class="w">
+</span>            <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">,</span><span class="w">
+</span>            <span class="n">args</span><span class="o">=</span><span class="p">(</span><span class="s2">&quot;Hi!&quot;</span><span class="p">,),</span><span class="w">
+</span>            <span class="n">kwargs</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="n">count</span><span class="o">=</span><span class="n">expected_count</span><span class="p">),</span><span class="w">
+</span>            <span class="n">properties</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="n">priority</span><span class="o">=</span><span class="mi">15</span><span class="p">)</span><span class="w">
+</span>        <span class="p">)</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">assertEqual</span><span class="p">(</span><span class="n">result</span><span class="p">,</span> <span class="n">expected_count</span><span class="p">)</span><span class="w">
+
+
+</span> <span class="c1"># second test to validate the behavior of the job unitarily</span><span class="w">
+</span> <span class="k">def</span><span class="w"> </span><span class="nf">test_my_job_method</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>     <span class="n">record</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">browse</span><span class="p">(</span><span class="mi">1</span><span class="p">)</span><span class="w">
+</span>     <span class="n">record</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">(</span><span class="s2">&quot;Hi!&quot;</span><span class="p">,</span> <span class="n">count</span><span class="o">=</span><span class="mi">12</span><span class="p">)</span><span class="w">
+</span>     <span class="bp">self</span><span class="o">.</span><span class="n">assertEqual</span><span class="p">(</span><span class="n">record</span><span class="o">.</span><span class="n">name</span><span class="p">,</span> <span class="s2">&quot;Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!&quot;</span><span class="p">)</span>
+</pre>
+<p>If you prefer, you can still test the whole thing in a single test, by calling
+<tt class="docutils literal">jobs_tester.perform_enqueued_jobs()</tt> in your test.</p>
+<pre class="code python literal-block">
+<span class="k">def</span><span class="w"> </span><span class="nf">test_method_to_test</span><span class="p">(</span><span class="bp">self</span><span class="p">):</span><span class="w">
+</span>    <span class="k">with</span> <span class="n">trap_jobs</span><span class="p">()</span> <span class="k">as</span> <span class="n">trap</span><span class="p">:</span><span class="w">
+</span>        <span class="n">result</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">method_to_test</span><span class="p">()</span><span class="w">
+</span>        <span class="n">expected_count</span> <span class="o">=</span> <span class="mi">12</span><span class="w">
+
+</span>        <span class="n">trap</span><span class="o">.</span><span class="n">assert_jobs_count</span><span class="p">(</span><span class="mi">1</span><span class="p">,</span> <span class="n">only</span><span class="o">=</span><span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">)</span><span class="w">
+</span>        <span class="n">trap</span><span class="o">.</span><span class="n">assert_enqueued_job</span><span class="p">(</span><span class="w">
+</span>            <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">,</span><span class="w">
+</span>            <span class="n">args</span><span class="o">=</span><span class="p">(</span><span class="s2">&quot;Hi!&quot;</span><span class="p">,),</span><span class="w">
+</span>            <span class="n">kwargs</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="n">count</span><span class="o">=</span><span class="n">expected_count</span><span class="p">),</span><span class="w">
+</span>            <span class="n">properties</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="n">priority</span><span class="o">=</span><span class="mi">15</span><span class="p">)</span><span class="w">
+</span>        <span class="p">)</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">assertEqual</span><span class="p">(</span><span class="n">result</span><span class="p">,</span> <span class="n">expected_count</span><span class="p">)</span><span class="w">
+
+</span>        <span class="n">trap</span><span class="o">.</span><span class="n">perform_enqueued_jobs</span><span class="p">()</span><span class="w">
+
+</span>        <span class="n">record</span> <span class="o">=</span> <span class="bp">self</span><span class="o">.</span><span class="n">env</span><span class="p">[</span><span class="s2">&quot;model&quot;</span><span class="p">]</span><span class="o">.</span><span class="n">browse</span><span class="p">(</span><span class="mi">1</span><span class="p">)</span><span class="w">
+</span>        <span class="n">record</span><span class="o">.</span><span class="n">my_job_method</span><span class="p">(</span><span class="s2">&quot;Hi!&quot;</span><span class="p">,</span> <span class="n">count</span><span class="o">=</span><span class="mi">12</span><span class="p">)</span><span class="w">
+</span>        <span class="bp">self</span><span class="o">.</span><span class="n">assertEqual</span><span class="p">(</span><span class="n">record</span><span class="o">.</span><span class="n">name</span><span class="p">,</span> <span class="s2">&quot;Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi! Hi!&quot;</span><span class="p">)</span>
+</pre>
+<p><strong>Execute jobs synchronously when running Odoo</strong></p>
+<p>When you are developing (ie: connector modules) you might want
+to bypass the queue job and run your code immediately.</p>
+<p>To do so you can set <tt class="docutils literal">QUEUE_JOB__NO_DELAY=1</tt> in your environment.</p>
+<div class="admonition warning">
+<p class="first admonition-title">Warning</p>
+<p class="last">Do not do this in production</p>
+</div>
+<p><strong>Execute jobs synchronously in tests</strong></p>
+<p>You should use <tt class="docutils literal">trap_jobs</tt>, really, but if for any reason you could not use it,
+and still need to have job methods executed synchronously in your tests, you can
+do so by setting <tt class="docutils literal">queue_job__no_delay=True</tt> in the context.</p>
+<p>Tip: you can do this at test case level like this</p>
+<pre class="code python literal-block">
+<span class="nd">&#64;classmethod</span><span class="w">
+</span><span class="k">def</span><span class="w"> </span><span class="nf">setUpClass</span><span class="p">(</span><span class="bp">cls</span><span class="p">):</span><span class="w">
+</span>    <span class="nb">super</span><span class="p">()</span><span class="o">.</span><span class="n">setUpClass</span><span class="p">()</span><span class="w">
+</span>    <span class="bp">cls</span><span class="o">.</span><span class="n">env</span> <span class="o">=</span> <span class="bp">cls</span><span class="o">.</span><span class="n">env</span><span class="p">(</span><span class="n">context</span><span class="o">=</span><span class="nb">dict</span><span class="p">(</span><span class="w">
+</span>        <span class="bp">cls</span><span class="o">.</span><span class="n">env</span><span class="o">.</span><span class="n">context</span><span class="p">,</span><span class="w">
+</span>        <span class="n">queue_job__no_delay</span><span class="o">=</span><span class="kc">True</span><span class="p">,</span>  <span class="c1"># no jobs thanks</span><span class="w">
+</span>    <span class="p">))</span>
+</pre>
+<p>Then all your tests execute the job methods synchronously without delaying any
+jobs.</p>
+<p>In tests you’ll have to mute the logger like:</p>
+<blockquote>
+&#64;mute_logger(‘odoo.addons.queue_job.models.base’)</blockquote>
+<div class="admonition note">
+<p class="first admonition-title">Note</p>
+<p class="last">in graphs of jobs, the <tt class="docutils literal">queue_job__no_delay</tt> context key must be in at
+least one job’s env of the graph for the whole graph to be executed synchronously</p>
+</div>
+</div>
+<div class="section" id="tips-and-tricks">
+<h4><a class="toc-backref" href="#toc-entry-9">Tips and tricks</a></h4>
+<ul class="simple">
+<li><strong>Idempotency</strong> (<a class="reference external" href="https://www.restapitutorial.com/lessons/idempotency.html">https://www.restapitutorial.com/lessons/idempotency.html</a>): The queue_job should be idempotent so they can be retried several times without impact on the data.</li>
+<li><strong>The job should test at the very beginning its relevance</strong>: the moment the job will be executed is unknown by design. So the first task of a job should be to check if the related work is still relevant at the moment of the execution.</li>
+</ul>
+</div>
+<div class="section" id="patterns">
+<h4><a class="toc-backref" href="#toc-entry-10">Patterns</a></h4>
+<p>Through the time, two main patterns emerged:</p>
+<ol class="arabic simple">
+<li>For data exposed to users, a model should store the data and the model should be the creator of the job. The job is kept hidden from the users</li>
+<li>For technical data, that are not exposed to the users, it is generally alright to create directly jobs with data passed as arguments to the job, without intermediary models.</li>
+</ol>
+</div>
+</div>
+</div>
+<div class="section" id="known-issues-roadmap">
+<h2><a class="toc-backref" href="#toc-entry-11">Known issues / Roadmap</a></h2>
+<ul class="simple">
+<li>After creating a new database or installing <tt class="docutils literal">queue_job</tt> on an
+existing database, Odoo must be restarted for the runner to detect it.</li>
+<li>When Odoo shuts down normally, it waits for running jobs to finish.
+However, when the Odoo server crashes or is otherwise force-stopped,
+running jobs are interrupted while the runner has no chance to know
+they have been aborted. In such situations, jobs may remain in
+<tt class="docutils literal">started</tt> or <tt class="docutils literal">enqueued</tt> state after the Odoo server is halted.
+Since the runner has no way to know if they are actually running or
+not, and does not know for sure if it is safe to restart the jobs,
+it does not attempt to restart them automatically. Such stale jobs
+therefore fill the running queue and prevent other jobs to start.
+You must therefore requeue them manually, either from the Jobs view,
+or by running the following SQL statement <em>before starting Odoo</em>:</li>
+</ul>
+<pre class="code sql literal-block">
+<span class="k">update</span><span class="w"> </span><span class="n">queue_job</span><span class="w"> </span><span class="k">set</span><span class="w"> </span><span class="k">state</span><span class="o">=</span><span class="s1">'pending'</span><span class="w"> </span><span class="k">where</span><span class="w"> </span><span class="k">state</span><span class="w"> </span><span class="k">in</span><span class="w"> </span><span class="p">(</span><span class="s1">'started'</span><span class="p">,</span><span class="w"> </span><span class="s1">'enqueued'</span><span class="p">)</span>
+</pre>
+</div>
+<div class="section" id="changelog">
+<h2><a class="toc-backref" href="#toc-entry-12">Changelog</a></h2>
+<!-- [ The change log. The goal of this file is to help readers
+understand changes between version. The primary audience is
+end users and integrators. Purely technical changes such as
+code refactoring must not be mentioned here.
+
+This file may contain ONE level of section titles, underlined
+with the ~ (tilde) character. Other section markers are
+forbidden and will likely break the structure of the README.rst
+or other documents where this fragment is included. ] -->
+<div class="section" id="next">
+<h3><a class="toc-backref" href="#toc-entry-13">Next</a></h3>
+<ul class="simple">
+<li>[ADD] Run jobrunner as a worker process instead of a thread in the main
+process (when running with –workers &gt; 0)</li>
+<li>[REF] <tt class="docutils literal">&#64;job</tt> and <tt class="docutils literal">&#64;related_action</tt> deprecated, any method can be delayed,
+and configured using <tt class="docutils literal">queue.job.function</tt> records</li>
+<li>[MIGRATION] from 13.0 branched at rev. e24ff4b</li>
+</ul>
+</div>
+</div>
+<div class="section" id="bug-tracker">
+<h2><a class="toc-backref" href="#toc-entry-14">Bug Tracker</a></h2>
+<p>Bugs are tracked on <a class="reference external" href="https://github.com/OCA/queue/issues">GitHub Issues</a>.
+In case of trouble, please check there if your issue has already been reported.
+If you spotted it first, help us to smash it by providing a detailed and welcomed
+<a class="reference external" href="https://github.com/OCA/queue/issues/new?body=module:%20queue_job%0Aversion:%2016.0%0A%0A**Steps%20to%20reproduce**%0A-%20...%0A%0A**Current%20behavior**%0A%0A**Expected%20behavior**">feedback</a>.</p>
+<p>Do not contact contributors directly about support or help with technical issues.</p>
+</div>
+<div class="section" id="credits">
+<h2><a class="toc-backref" href="#toc-entry-15">Credits</a></h2>
+<div class="section" id="authors">
+<h3><a class="toc-backref" href="#toc-entry-16">Authors</a></h3>
+<ul class="simple">
+<li>Camptocamp</li>
+<li>ACSONE SA/NV</li>
+</ul>
+</div>
+<div class="section" id="contributors">
+<h3><a class="toc-backref" href="#toc-entry-17">Contributors</a></h3>
+<ul class="simple">
+<li>Guewen Baconnier &lt;<a class="reference external" href="mailto:guewen.baconnier&#64;camptocamp.com">guewen.baconnier&#64;camptocamp.com</a>&gt;</li>
+<li>Stéphane Bidoul &lt;<a class="reference external" href="mailto:stephane.bidoul&#64;acsone.eu">stephane.bidoul&#64;acsone.eu</a>&gt;</li>
+<li>Matthieu Dietrich &lt;<a class="reference external" href="mailto:matthieu.dietrich&#64;camptocamp.com">matthieu.dietrich&#64;camptocamp.com</a>&gt;</li>
+<li>Jos De Graeve &lt;<a class="reference external" href="mailto:Jos.DeGraeve&#64;apertoso.be">Jos.DeGraeve&#64;apertoso.be</a>&gt;</li>
+<li>David Lefever &lt;<a class="reference external" href="mailto:dl&#64;taktik.be">dl&#64;taktik.be</a>&gt;</li>
+<li>Laurent Mignon &lt;<a class="reference external" href="mailto:laurent.mignon&#64;acsone.eu">laurent.mignon&#64;acsone.eu</a>&gt;</li>
+<li>Laetitia Gangloff &lt;<a class="reference external" href="mailto:laetitia.gangloff&#64;acsone.eu">laetitia.gangloff&#64;acsone.eu</a>&gt;</li>
+<li>Cédric Pigeon &lt;<a class="reference external" href="mailto:cedric.pigeon&#64;acsone.eu">cedric.pigeon&#64;acsone.eu</a>&gt;</li>
+<li>Tatiana Deribina &lt;<a class="reference external" href="mailto:tatiana.deribina&#64;avoin.systems">tatiana.deribina&#64;avoin.systems</a>&gt;</li>
+<li>Souheil Bejaoui &lt;<a class="reference external" href="mailto:souheil.bejaoui&#64;acsone.eu">souheil.bejaoui&#64;acsone.eu</a>&gt;</li>
+<li>Eric Antones &lt;<a class="reference external" href="mailto:eantones&#64;nuobit.com">eantones&#64;nuobit.com</a>&gt;</li>
+<li>Simone Orsi &lt;<a class="reference external" href="mailto:simone.orsi&#64;camptocamp.com">simone.orsi&#64;camptocamp.com</a>&gt;</li>
+</ul>
+</div>
+<div class="section" id="maintainers">
+<h3><a class="toc-backref" href="#toc-entry-18">Maintainers</a></h3>
+<p>This module is maintained by the OCA.</p>
+<a class="reference external image-reference" href="https://odoo-community.org">
+<img alt="Odoo Community Association" src="https://odoo-community.org/logo.png" />
+</a>
+<p>OCA, or the Odoo Community Association, is a nonprofit organization whose
+mission is to support the collaborative development of Odoo features and
+promote its widespread use.</p>
+<p>Current <a class="reference external" href="https://odoo-community.org/page/maintainer-role">maintainer</a>:</p>
+<p><a class="reference external image-reference" href="https://github.com/guewen"><img alt="guewen" src="https://github.com/guewen.png?size=40px" /></a></p>
+<p>This module is part of the <a class="reference external" href="https://github.com/OCA/queue/tree/16.0/queue_job">OCA/queue</a> project on GitHub.</p>
+<p>You are welcome to contribute. To learn how please visit <a class="reference external" href="https://odoo-community.org/page/Contribute">https://odoo-community.org/page/Contribute</a>.</p>
+</div>
+</div>
+</div>
+</div>
+</body>
+</html>

odoo-bringout-oca-queue-queue_job/queue_job/static/src/views/fields/job_direct_graph/job_direct_graph.esm.js

@@ -0,0 +1,143 @@
+/* @odoo-module */
+/* global vis */
+
+import {loadCSS, loadJS} from "@web/core/assets";
+import {registry} from "@web/core/registry";
+import {standardFieldProps} from "@web/views/fields/standard_field_props";
+import {useService} from "@web/core/utils/hooks";
+
+const {Component, onWillStart, useEffect, useRef} = owl;
+
+export class JobDirectGraph extends Component {
+    setup() {
+        this.orm = useService("orm");
+        this.action = useService("action");
+        this.rootRef = useRef("root_vis");
+        this.network = null;
+        onWillStart(async () => {
+            await loadJS("/queue_job/static/lib/vis/vis-network.min.js");
+            loadCSS("/queue_job/static/lib/vis/vis-network.min.css");
+        });
+        useEffect(() => {
+            this.renderNetwork();
+            this._fitNetwork();
+            return () => {
+                if (this.network) {
+                    this.$el.empty();
+                }
+                return this.rootRef.el;
+            };
+        });
+    }
+
+    get $el() {
+        return $(this.rootRef.el);
+    }
+
+    get resId() {
+        return this.props.record.data.id;
+    }
+
+    get context() {
+        return this.props.record.getFieldContext(this.props.name);
+    }
+
+    get model() {
+        return this.props.record.resModel;
+    }
+
+    htmlTitle(html) {
+        const container = document.createElement("div");
+        container.innerHTML = html;
+        return container;
+    }
+
+    renderNetwork() {
+        if (this.network) {
+            this.$el.empty();
+        }
+        let nodes = this.props.value.nodes || [];
+        if (!nodes.length) {
+            return;
+        }
+        nodes = nodes.map((node) => {
+            node.title = this.htmlTitle(node.title || "");
+            return node;
+        });
+
+        const edges = [];
+        _.each(this.props.value.edges || [], function (edge) {
+            const edgeFrom = edge[0];
+            const edgeTo = edge[1];
+            edges.push({
+                from: edgeFrom,
+                to: edgeTo,
+                arrows: "to",
+            });
+        });
+
+        const data = {
+            nodes: new vis.DataSet(nodes),
+            edges: new vis.DataSet(edges),
+        };
+        const options = {
+            // Fix the seed to have always the same result for the same graph
+            layout: {randomSeed: 1},
+        };
+        // Arbitrary threshold, generation becomes very slow at some
+        // point, and disabling the stabilization helps to have a fast result.
+        // Actually, it stabilizes, but is displayed while stabilizing, rather
+        // than showing a blank canvas.
+        if (nodes.length > 100) {
+            options.physics = {stabilization: false};
+        }
+        const network = new vis.Network(this.$el[0], data, options);
+        network.selectNodes([this.resId]);
+        var self = this;
+        network.on("dragging", function () {
+            // By default, dragging changes the selected node
+            // to the dragged one, we want to keep the current
+            // job selected
+            network.selectNodes([self.resId]);
+        });
+        network.on("click", function (params) {
+            if (params.nodes.length > 0) {
+                var resId = params.nodes[0];
+                if (resId !== self.resId) {
+                    self.openDependencyJob(resId);
+                }
+            } else {
+                // Clicked outside of the nodes, we want to
+                // keep the current job selected
+                network.selectNodes([self.resId]);
+            }
+        });
+        this.network = network;
+    }
+
+    async openDependencyJob(resId) {
+        const action = await this.orm.call(
+            this.model,
+            "get_formview_action",
+            [[resId]],
+            {
+                context: this.context,
+            }
+        );
+        await this.action.doAction(action);
+    }
+
+    _fitNetwork() {
+        if (this.network) {
+            this.network.fit(this.network.body.nodeIndices);
+        }
+    }
+}
+
+JobDirectGraph.props = {
+    ...standardFieldProps,
+};
+
+JobDirectGraph.template = "queue.JobDirectGraph";
+
+registry.category("fields").add("job_directed_graph", JobDirectGraph);

odoo-bringout-oca-queue-queue_job/queue_job/static/src/views/fields/job_direct_graph/job_direct_graph.scss

@@ -0,0 +1,10 @@
+.o_field_job_directed_graph {
+    width: 600px;
+    height: 400px;
+    border: 1px solid lightgray;
+
+    div.root_vis {
+        height: 100%;
+        width: 100%;
+    }
+}

odoo-bringout-oca-queue-queue_job/queue_job/static/src/views/fields/job_direct_graph/job_direct_graph.xml

@@ -0,0 +1,8 @@
+<?xml version="1.0" encoding="UTF-8" ?>
+<templates xml:space="preserve">
+
+    <t t-name="queue.JobDirectGraph" owl="1">
+        <div id="props.id" t-ref="root_vis" class="root_vis" />
+    </t>
+
+</templates>

odoo-bringout-oca-queue-queue_job/queue_job/tests/__init__.py

@@ -0,0 +1,10 @@
+from . import test_runner_channels
+from . import test_runner_runner
+from . import test_delayable
+from . import test_delayable_split
+from . import test_json_field
+from . import test_model_job_channel
+from . import test_model_job_function
+from . import test_queue_job_protected_write
+from . import test_wizards
+from . import test_requeue_dead_job

odoo-bringout-oca-queue-queue_job/queue_job/tests/common.py

@@ -0,0 +1,458 @@
+# Copyright 2019 Camptocamp
+# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl).
+import doctest
+import logging
+import sys
+import typing
+from contextlib import contextmanager
+from itertools import groupby
+from operator import attrgetter
+from unittest import TestCase, mock
+
+from odoo.addons.queue_job.delay import Graph
+
+# pylint: disable=odoo-addons-relative-import
+from odoo.addons.queue_job.job import Job
+
+
+@contextmanager
+def trap_jobs():
+    """Context Manager used to test enqueuing of jobs
+
+    Trapping jobs allows to split the tests in:
+
+    * the part that delays the job with the expected arguments in one test
+    * the execution of the job itself in a second test
+
+    When the jobs are trapped, they are not executed at all, however, we
+    can verify they have been enqueued with the correct arguments and
+    properties.
+
+    Then in a second test, we can call the job method directly with the
+    arguments to test.
+
+    The context manager yields a instance of ``JobsTrap``, which provides
+    utilities and assert methods.
+
+    Example of method to test::
+
+        def button_that_uses_delayable_chain(self):
+            delayables = chain(
+                self.delayable(
+                    channel="root.test",
+                    description="Test",
+                    eta=15,
+                    identity_key=identity_exact,
+                    max_retries=1,
+                    priority=15,
+                ).testing_method(1, foo=2),
+                self.delayable().testing_method('x', foo='y'),
+                self.delayable().no_description(),
+            )
+            delayables.delay()
+
+    Example of usage in a test::
+
+        with trap_jobs() as trap:
+            self.env['test.queue.job'].button_that_uses_delayable_chain()
+
+            trap.assert_jobs_count(3)
+            trap.assert_jobs_count(
+                2, only=self.env['test.queue.job'].testing_method
+
+            )
+            trap.assert_jobs_count(
+                1, only=self.env['test.queue.job'].no_description
+            )
+
+            trap.assert_enqueued_job(
+                self.env['test.queue.job'].testing_method,
+                args=(1,),
+                kwargs={"foo": 2},
+                properties=dict(
+                    channel="root.test",
+                    description="Test",
+                    eta=15,
+                    identity_key=identity_exact,
+                    max_retries=1,
+                    priority=15,
+                )
+            )
+            trap.assert_enqueued_job(
+                self.env['test.queue.job'].testing_method,
+                args=("x",),
+                kwargs={"foo": "y"},
+            )
+            trap.assert_enqueued_job(
+                self.env['test.queue.job'].no_description,
+            )
+
+            # optionally, you can perform the jobs synchronously (without going
+            # to the database)
+            jobs_tester.perform_enqueued_jobs()
+    """
+    with mock.patch(
+        "odoo.addons.queue_job.delay.Job",
+        name="Job Class",
+        auto_spec=True,
+        unsafe=True,
+    ) as job_cls_mock:
+        with JobsTrap(job_cls_mock) as trap:
+            yield trap
+
+
+class JobCall(typing.NamedTuple):
+    method: typing.Callable
+    args: tuple
+    kwargs: dict
+    properties: dict
+
+    def __eq__(self, other):
+        if not isinstance(other, JobCall):
+            return NotImplemented
+        return (
+            self.method.__self__ == other.method.__self__
+            and self.method.__func__ == other.method.__func__
+            and self.args == other.args
+            and self.kwargs == other.kwargs
+            and self.properties == other.properties
+        )
+
+
+class JobsTrap:
+    """Used by ``trap_jobs()``, provide assert methods on the trapped jobs
+
+    Look the documentation of ``trap_jobs()`` for a usage example.
+
+    The ``store`` method of the Job instances is mocked so they are never
+    saved in database.
+
+    Helpers for tests:
+
+    * ``jobs_count``
+    * ``assert_jobs_count``
+    * ``assert_enqueued_job``
+    * ``perform_enqueued_jobs``
+
+    You can also access the list of calls that were made to enqueue the jobs in
+    the ``calls`` attribute, and the generated jobs in the ``enqueued_jobs``.
+    """
+
+    def __init__(self, job_mock):
+        self.job_mock = job_mock
+        self.job_mock.side_effect = self._add_job
+        # 1 call == 1 job, they share the same position in the lists
+        self.calls = []
+        self.enqueued_jobs = []
+        self._store_patchers = []
+        self._test_case = TestCase()
+
+    def jobs_count(self, only=None):
+        """Return the count of enqueued jobs
+
+        ``only`` is an option method on which the count is filtered
+        """
+        if only:
+            return len(self._filtered_enqueued_jobs(only))
+        return len(self.enqueued_jobs)
+
+    def assert_jobs_count(self, expected, only=None):
+        """Raise an assertion error if the count of enqueued jobs does not match
+
+        ``only`` is an option method on which the count is filtered
+        """
+        self._test_case.assertEqual(self.jobs_count(only=only), expected)
+
+    def assert_enqueued_job(self, method, args=None, kwargs=None, properties=None):
+        """Raise an assertion error if the expected method has not been enqueued
+
+        * ``method`` is the method (as method object) delayed as job
+        * ``args`` is a tuple of arguments passed to the job method
+        * ``kwargs`` is a dict of keyword arguments passed to the job method
+        * ``properties`` is a dict of job properties (priority, eta, ...)
+
+        The args and the kwargs *must* be match exactly what has been enqueued
+        in the job method. The properties are optional: if the job has been
+        enqueued with a custom description but the assert method is not called
+        with ``description`` in the properties, it still matches the call.
+        However, if a ``description`` is passed in the assert's properties, it
+        must match.
+        """
+        if properties is None:
+            properties = {}
+        if args is None:
+            args = ()
+        if kwargs is None:
+            kwargs = {}
+        expected_call = JobCall(
+            method=method,
+            args=args,
+            kwargs=kwargs,
+            properties=properties,
+        )
+        actual_calls = []
+        for call in self.calls:
+            checked_properties = {
+                key: value
+                for key, value in call.properties.items()
+                if key in properties
+            }
+            # build copy of calls with only the properties that we want to
+            # check
+            actual_calls.append(
+                JobCall(
+                    method=call.method,
+                    args=call.args,
+                    kwargs=call.kwargs,
+                    properties=checked_properties,
+                )
+            )
+
+        if expected_call not in actual_calls:
+            raise AssertionError(
+                "Job %s was not enqueued.\n"
+                "Actual enqueued jobs:\n%s"
+                % (
+                    self._format_job_call(expected_call),
+                    "\n".join(
+                        " * %s" % (self._format_job_call(call),)
+                        for call in actual_calls
+                    ),
+                )
+            )
+
+    def perform_enqueued_jobs(self):
+        """Perform the enqueued jobs synchronously"""
+
+        def by_graph(job):
+            return job.graph_uuid or ""
+
+        sorted_jobs = sorted(self.enqueued_jobs, key=by_graph)
+        self.enqueued_jobs = []
+        for graph_uuid, jobs in groupby(sorted_jobs, key=by_graph):
+            if graph_uuid:
+                self._perform_graph_jobs(jobs)
+            else:
+                self._perform_single_jobs(jobs)
+
+    def _perform_single_jobs(self, jobs):
+        # we probably don't want to replicate a perfect order here, but at
+        # least respect the priority
+        for job in sorted(jobs, key=attrgetter("priority")):
+            job.perform()
+
+    def _perform_graph_jobs(self, jobs):
+        graph = Graph()
+        for job in jobs:
+            graph.add_vertex(job)
+            for parent in job.depends_on:
+                graph.add_edge(parent, job)
+
+        for job in graph.topological_sort():
+            job.perform()
+
+    def _add_job(self, *args, **kwargs):
+        job = Job(*args, **kwargs)
+        if not job.identity_key or all(
+            j.identity_key != job.identity_key for j in self.enqueued_jobs
+        ):
+            self.enqueued_jobs.append(job)
+
+            patcher = mock.patch.object(job, "store")
+            self._store_patchers.append(patcher)
+            patcher.start()
+
+        job_args = kwargs.pop("args", None) or ()
+        job_kwargs = kwargs.pop("kwargs", None) or {}
+        self.calls.append(
+            JobCall(
+                method=args[0],
+                args=job_args,
+                kwargs=job_kwargs,
+                properties=kwargs,
+            )
+        )
+        return job
+
+    def __enter__(self):
+        return self
+
+    def __exit__(self, exc_type, exc_value, traceback):
+        for patcher in self._store_patchers:
+            patcher.stop()
+
+    def _filtered_enqueued_jobs(self, job_method):
+        enqueued_jobs = [
+            job
+            for job in self.enqueued_jobs
+            if job.func.__self__ == job_method.__self__
+            and job.func.__func__ == job_method.__func__
+        ]
+        return enqueued_jobs
+
+    def _format_job_call(self, call):
+        method_all_args = []
+        if call.args:
+            method_all_args.append(", ".join("%s" % (arg,) for arg in call.args))
+        if call.kwargs:
+            method_all_args.append(
+                ", ".join("%s=%s" % (key, value) for key, value in call.kwargs.items())
+            )
+        return "<%s>.%s(%s) with properties (%s)" % (
+            call.method.__self__,
+            call.method.__name__,
+            ", ".join(method_all_args),
+            ", ".join("%s=%s" % (key, value) for key, value in call.properties.items()),
+        )
+
+    def __repr__(self):
+        return repr(self.calls)
+
+
+class JobCounter:
+    def __init__(self, env):
+        super().__init__()
+        self.env = env
+        self.existing = self.search_all()
+
+    def count_all(self):
+        return len(self.search_all())
+
+    def count_created(self):
+        return len(self.search_created())
+
+    def count_existing(self):
+        return len(self.existing)
+
+    def search_created(self):
+        return self.search_all() - self.existing
+
+    def search_all(self):
+        return self.env["queue.job"].search([])
+
+
+class JobMixin:
+    def job_counter(self):
+        return JobCounter(self.env)
+
+    def perform_jobs(self, jobs):
+        for job in jobs.search_created():
+            Job.load(self.env, job.uuid).perform()
+
+    @contextmanager
+    def trap_jobs(self):
+        with trap_jobs() as trap:
+            yield trap
+
+
+@contextmanager
+def mock_with_delay():
+    """Context Manager mocking ``with_delay()``
+
+    DEPRECATED: use ``trap_jobs()'``.
+
+    Mocking this method means we can decorrelate the tests in:
+
+    * the part that delay the job with the expected arguments
+    * the execution of the job itself
+
+    The first kind of test does not need to actually create the jobs in the
+    database, as we can inspect how the Mocks were called.
+
+    The second kind of test calls directly the method decorated by ``@job``
+    with the arguments that we want to test.
+
+    The context manager returns 2 mocks:
+    * the first allow to check that with_delay() was called and with which
+      arguments
+    * the second to check which job method was called and with which arguments.
+
+    Example of test::
+
+        def test_export(self):
+            with mock_with_delay() as (delayable_cls, delayable):
+                # inside this method, there is a call
+                # partner.with_delay(priority=15).export_record('test')
+                self.record.run_export()
+
+                # check 'with_delay()' part:
+                self.assertEqual(delayable_cls.call_count, 1)
+                # arguments passed in 'with_delay()'
+                delay_args, delay_kwargs = delayable_cls.call_args
+                self.assertEqual(
+                    delay_args, (self.env['res.partner'],)
+                )
+                self.assertDictEqual(delay_kwargs, {priority: 15})
+
+                # check what's passed to the job method 'export_record'
+                self.assertEqual(delayable.export_record.call_count, 1)
+                delay_args, delay_kwargs = delayable.export_record.call_args
+                self.assertEqual(delay_args, ('test',))
+                self.assertDictEqual(delay_kwargs, {})
+
+    An example of the first kind of test:
+    https://github.com/camptocamp/connector-jira/blob/0ca4261b3920d5e8c2ae4bb0fc352ea3f6e9d2cd/connector_jira/tests/test_batch_timestamp_import.py#L43-L76  # noqa
+    And the second kind:
+    https://github.com/camptocamp/connector-jira/blob/0ca4261b3920d5e8c2ae4bb0fc352ea3f6e9d2cd/connector_jira/tests/test_import_task.py#L34-L46  # noqa
+
+    """
+    with mock.patch(
+        "odoo.addons.queue_job.models.base.DelayableRecordset",
+        name="DelayableRecordset",
+        spec=True,
+    ) as delayable_cls:
+        # prepare the mocks
+        delayable = mock.MagicMock(name="DelayableBinding")
+        delayable_cls.return_value = delayable
+        yield delayable_cls, delayable
+
+
+class OdooDocTestCase(doctest.DocTestCase):
+    """
+    We need a custom DocTestCase class in order to:
+    - define test_tags to run as part of standard tests
+    - output a more meaningful test name than default "DocTestCase.runTest"
+    """
+
+    def __init__(
+        self, doctest, optionflags=0, setUp=None, tearDown=None, checker=None, seq=0
+    ):
+        super().__init__(
+            doctest._dt_test,
+            optionflags=optionflags,
+            setUp=setUp,
+            tearDown=tearDown,
+            checker=checker,
+        )
+        self.test_sequence = seq
+
+    def setUp(self):
+        """Log an extra statement which test is started."""
+        super().setUp()
+        logging.getLogger(__name__).info("Running tests for %s", self._dt_test.name)
+
+
+def load_doctests(module):
+    """
+    Generates a tests loading method for the doctests of the given module
+    https://docs.python.org/3/library/unittest.html#load-tests-protocol
+    """
+
+    def load_tests(loader, tests, ignore):
+        """
+        Apply the 'test_tags' attribute to each DocTestCase found by the DocTestSuite.
+        Also extend the DocTestCase class trivially to fit the class teardown
+        that Odoo backported for its own test classes from Python 3.8.
+        """
+        if sys.version_info < (3, 8):
+            doctest.DocTestCase.doClassCleanups = lambda: None
+            doctest.DocTestCase.tearDown_exceptions = []
+
+        for idx, test in enumerate(doctest.DocTestSuite(module)):
+            odoo_test = OdooDocTestCase(test, seq=idx)
+            odoo_test.test_tags = {"standard", "at_install", "queue_job", "doctest"}
+            tests.addTest(odoo_test)
+
+        return tests
+
+    return load_tests

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_delayable.py

@@ -0,0 +1,287 @@
+# copyright 2019 Camptocamp
+# license agpl-3.0 or later (http://www.gnu.org/licenses/agpl.html)
+
+import gc
+import logging
+from unittest import mock
+
+from odoo.tests import common
+
+from odoo.addons.queue_job.delay import Delayable, DelayableGraph
+
+
+class TestDelayable(common.BaseCase):
+    def setUp(self):
+        super().setUp()
+        self.recordset = mock.MagicMock(name="recordset")
+
+    def test_delayable_set(self):
+        # Use gc for garbage collection and use assertLogs to suppress WARNING
+        with self.assertLogs("odoo.addons.queue_job.delay", level=logging.WARNING):
+            dl = Delayable(self.recordset)
+            dl.set(priority=15)
+            self.assertEqual(dl.priority, 15)
+            dl.set({"priority": 20, "description": "test"})
+            self.assertEqual(dl.priority, 20)
+            self.assertEqual(dl.description, "test")
+            del dl
+            gc.collect()
+
+    def test_delayable_set_unknown(self):
+        # Use gc for garbage collection and use assertLogs to suppress WARNING
+        with self.assertLogs("odoo.addons.queue_job.delay", level=logging.WARNING):
+            dl = Delayable(self.recordset)
+            with self.assertRaises(ValueError):
+                dl.set(foo=15)
+            del dl
+            gc.collect()
+
+    def test_graph_add_vertex_edge(self):
+        graph = DelayableGraph()
+        graph.add_vertex("a")
+        self.assertEqual(graph._graph, {"a": set()})
+        graph.add_edge("a", "b")
+        self.assertEqual(graph._graph, {"a": {"b"}, "b": set()})
+        graph.add_edge("b", "c")
+        self.assertEqual(graph._graph, {"a": {"b"}, "b": {"c"}, "c": set()})
+
+    def test_graph_vertices(self):
+        graph = DelayableGraph({"a": {"b"}, "b": {"c"}, "c": set()})
+        self.assertEqual(graph.vertices(), {"a", "b", "c"})
+
+    def test_graph_edges(self):
+        graph = DelayableGraph(
+            {"a": {"b"}, "b": {"c", "d"}, "c": {"e"}, "d": set(), "e": set()}
+        )
+        self.assertEqual(
+            sorted(graph.edges()),
+            sorted(
+                [
+                    ("a", "b"),
+                    ("b", "c"),
+                    ("b", "d"),
+                    ("c", "e"),
+                ]
+            ),
+        )
+
+    def test_graph_connect(self):
+        # Use gc for garbage collection and use assertLogs to suppress WARNING
+        with self.assertLogs("odoo.addons.queue_job.delay", level=logging.WARNING):
+            node_tail = Delayable(self.recordset)
+            node_tail2 = Delayable(self.recordset)
+            node_middle = Delayable(self.recordset)
+            node_top = Delayable(self.recordset)
+            node_middle.on_done(node_tail)
+            node_middle.on_done(node_tail2)
+            node_top.on_done(node_middle)
+            collected = node_top._graph._connect_graphs()
+            self.assertEqual(
+                collected._graph,
+                {
+                    node_tail: set(),
+                    node_tail2: set(),
+                    node_middle: {node_tail, node_tail2},
+                    node_top: {node_middle},
+                },
+            )
+
+            del node_tail, node_tail2, node_middle, node_top, collected
+            gc.collect()
+
+    def test_graph_paths(self):
+        graph = DelayableGraph(
+            {"a": {"b"}, "b": {"c", "d"}, "c": {"e"}, "d": set(), "e": set()}
+        )
+        paths = list(graph.paths("a"))
+        self.assertEqual(sorted(paths), sorted([["a", "b", "d"], ["a", "b", "c", "e"]]))
+        paths = list(graph.paths("b"))
+        self.assertEqual(sorted(paths), sorted([["b", "d"], ["b", "c", "e"]]))
+        paths = list(graph.paths("c"))
+        self.assertEqual(paths, [["c", "e"]])
+        paths = list(graph.paths("d"))
+        self.assertEqual(paths, [["d"]])
+        paths = list(graph.paths("e"))
+        self.assertEqual(paths, [["e"]])
+
+    def test_graph_repr(self):
+        graph = DelayableGraph(
+            {"a": {"b"}, "b": {"c", "d"}, "c": {"e"}, "d": set(), "e": set()}
+        )
+        actual = repr(graph)
+        expected = ["'a' → 'b' → 'c' → 'e'", "'a' → 'b' → 'd'"]
+        self.assertEqual(sorted(actual.split("\n")), expected)
+
+    def test_graph_topological_sort(self):
+        # the graph is an example from
+        # https://en.wikipedia.org/wiki/Topological_sorting
+        # if you want a visual representation
+        graph = DelayableGraph(
+            {
+                5: {11},
+                7: {11, 8},
+                3: {8, 10},
+                11: {2, 9, 10},
+                2: set(),
+                8: {9},
+                9: set(),
+                10: set(),
+            }
+        )
+
+        # these are all the pre-computed combinations that
+        # respect the dependencies order
+        valid_solutions = [
+            [3, 5, 7, 8, 11, 2, 9, 10],
+            [3, 5, 7, 8, 11, 2, 10, 9],
+            [3, 5, 7, 8, 11, 9, 2, 10],
+            [3, 5, 7, 8, 11, 9, 10, 2],
+            [3, 5, 7, 8, 11, 10, 2, 9],
+            [3, 5, 7, 8, 11, 10, 9, 2],
+            [3, 5, 7, 11, 2, 8, 9, 10],
+            [3, 5, 7, 11, 2, 8, 10, 9],
+            [3, 5, 7, 11, 2, 10, 8, 9],
+            [3, 5, 7, 11, 8, 2, 9, 10],
+            [3, 5, 7, 11, 8, 2, 10, 9],
+            [3, 5, 7, 11, 8, 9, 2, 10],
+            [3, 5, 7, 11, 8, 9, 10, 2],
+            [3, 5, 7, 11, 8, 10, 2, 9],
+            [3, 5, 7, 11, 8, 10, 9, 2],
+            [3, 5, 7, 11, 10, 2, 8, 9],
+            [3, 5, 7, 11, 10, 8, 2, 9],
+            [3, 5, 7, 11, 10, 8, 9, 2],
+            [3, 7, 5, 8, 11, 2, 9, 10],
+            [3, 7, 5, 8, 11, 2, 10, 9],
+            [3, 7, 5, 8, 11, 9, 2, 10],
+            [3, 7, 5, 8, 11, 9, 10, 2],
+            [3, 7, 5, 8, 11, 10, 2, 9],
+            [3, 7, 5, 8, 11, 10, 9, 2],
+            [3, 7, 5, 11, 2, 8, 9, 10],
+            [3, 7, 5, 11, 2, 8, 10, 9],
+            [3, 7, 5, 11, 2, 10, 8, 9],
+            [3, 7, 5, 11, 8, 2, 9, 10],
+            [3, 7, 5, 11, 8, 2, 10, 9],
+            [3, 7, 5, 11, 8, 9, 2, 10],
+            [3, 7, 5, 11, 8, 9, 10, 2],
+            [3, 7, 5, 11, 8, 10, 2, 9],
+            [3, 7, 5, 11, 8, 10, 9, 2],
+            [3, 7, 5, 11, 10, 2, 8, 9],
+            [3, 7, 5, 11, 10, 8, 2, 9],
+            [3, 7, 5, 11, 10, 8, 9, 2],
+            [3, 7, 8, 5, 11, 2, 9, 10],
+            [3, 7, 8, 5, 11, 2, 10, 9],
+            [3, 7, 8, 5, 11, 9, 2, 10],
+            [3, 7, 8, 5, 11, 9, 10, 2],
+            [3, 7, 8, 5, 11, 10, 2, 9],
+            [3, 7, 8, 5, 11, 10, 9, 2],
+            [5, 3, 7, 8, 11, 2, 9, 10],
+            [5, 3, 7, 8, 11, 2, 10, 9],
+            [5, 3, 7, 8, 11, 9, 2, 10],
+            [5, 3, 7, 8, 11, 9, 10, 2],
+            [5, 3, 7, 8, 11, 10, 2, 9],
+            [5, 3, 7, 8, 11, 10, 9, 2],
+            [5, 3, 7, 11, 2, 8, 9, 10],
+            [5, 3, 7, 11, 2, 8, 10, 9],
+            [5, 3, 7, 11, 2, 10, 8, 9],
+            [5, 3, 7, 11, 8, 2, 9, 10],
+            [5, 3, 7, 11, 8, 2, 10, 9],
+            [5, 3, 7, 11, 8, 9, 2, 10],
+            [5, 3, 7, 11, 8, 9, 10, 2],
+            [5, 3, 7, 11, 8, 10, 2, 9],
+            [5, 3, 7, 11, 8, 10, 9, 2],
+            [5, 3, 7, 11, 10, 2, 8, 9],
+            [5, 3, 7, 11, 10, 8, 2, 9],
+            [5, 3, 7, 11, 10, 8, 9, 2],
+            [5, 7, 3, 8, 11, 2, 9, 10],
+            [5, 7, 3, 8, 11, 2, 10, 9],
+            [5, 7, 3, 8, 11, 9, 2, 10],
+            [5, 7, 3, 8, 11, 9, 10, 2],
+            [5, 7, 3, 8, 11, 10, 2, 9],
+            [5, 7, 3, 8, 11, 10, 9, 2],
+            [5, 7, 3, 11, 2, 8, 9, 10],
+            [5, 7, 3, 11, 2, 8, 10, 9],
+            [5, 7, 3, 11, 2, 10, 8, 9],
+            [5, 7, 3, 11, 8, 2, 9, 10],
+            [5, 7, 3, 11, 8, 2, 10, 9],
+            [5, 7, 3, 11, 8, 9, 2, 10],
+            [5, 7, 3, 11, 8, 9, 10, 2],
+            [5, 7, 3, 11, 8, 10, 2, 9],
+            [5, 7, 3, 11, 8, 10, 9, 2],
+            [5, 7, 3, 11, 10, 2, 8, 9],
+            [5, 7, 3, 11, 10, 8, 2, 9],
+            [5, 7, 3, 11, 10, 8, 9, 2],
+            [5, 7, 11, 2, 3, 8, 9, 10],
+            [5, 7, 11, 2, 3, 8, 10, 9],
+            [5, 7, 11, 2, 3, 10, 8, 9],
+            [5, 7, 11, 3, 2, 8, 9, 10],
+            [5, 7, 11, 3, 2, 8, 10, 9],
+            [5, 7, 11, 3, 2, 10, 8, 9],
+            [5, 7, 11, 3, 8, 2, 9, 10],
+            [5, 7, 11, 3, 8, 2, 10, 9],
+            [5, 7, 11, 3, 8, 9, 2, 10],
+            [5, 7, 11, 3, 8, 9, 10, 2],
+            [5, 7, 11, 3, 8, 10, 2, 9],
+            [5, 7, 11, 3, 8, 10, 9, 2],
+            [5, 7, 11, 3, 10, 2, 8, 9],
+            [5, 7, 11, 3, 10, 8, 2, 9],
+            [5, 7, 11, 3, 10, 8, 9, 2],
+            [7, 3, 5, 8, 11, 2, 9, 10],
+            [7, 3, 5, 8, 11, 2, 10, 9],
+            [7, 3, 5, 8, 11, 9, 2, 10],
+            [7, 3, 5, 8, 11, 9, 10, 2],
+            [7, 3, 5, 8, 11, 10, 2, 9],
+            [7, 3, 5, 8, 11, 10, 9, 2],
+            [7, 3, 5, 11, 2, 8, 9, 10],
+            [7, 3, 5, 11, 2, 8, 10, 9],
+            [7, 3, 5, 11, 2, 10, 8, 9],
+            [7, 3, 5, 11, 8, 2, 9, 10],
+            [7, 3, 5, 11, 8, 2, 10, 9],
+            [7, 3, 5, 11, 8, 9, 2, 10],
+            [7, 3, 5, 11, 8, 9, 10, 2],
+            [7, 3, 5, 11, 8, 10, 2, 9],
+            [7, 3, 5, 11, 8, 10, 9, 2],
+            [7, 3, 5, 11, 10, 2, 8, 9],
+            [7, 3, 5, 11, 10, 8, 2, 9],
+            [7, 3, 5, 11, 10, 8, 9, 2],
+            [7, 3, 8, 5, 11, 2, 9, 10],
+            [7, 3, 8, 5, 11, 2, 10, 9],
+            [7, 3, 8, 5, 11, 9, 2, 10],
+            [7, 3, 8, 5, 11, 9, 10, 2],
+            [7, 3, 8, 5, 11, 10, 2, 9],
+            [7, 3, 8, 5, 11, 10, 9, 2],
+            [7, 5, 3, 8, 11, 2, 9, 10],
+            [7, 5, 3, 8, 11, 2, 10, 9],
+            [7, 5, 3, 8, 11, 9, 2, 10],
+            [7, 5, 3, 8, 11, 9, 10, 2],
+            [7, 5, 3, 8, 11, 10, 2, 9],
+            [7, 5, 3, 8, 11, 10, 9, 2],
+            [7, 5, 3, 11, 2, 8, 9, 10],
+            [7, 5, 3, 11, 2, 8, 10, 9],
+            [7, 5, 3, 11, 2, 10, 8, 9],
+            [7, 5, 3, 11, 8, 2, 9, 10],
+            [7, 5, 3, 11, 8, 2, 10, 9],
+            [7, 5, 3, 11, 8, 9, 2, 10],
+            [7, 5, 3, 11, 8, 9, 10, 2],
+            [7, 5, 3, 11, 8, 10, 2, 9],
+            [7, 5, 3, 11, 8, 10, 9, 2],
+            [7, 5, 3, 11, 10, 2, 8, 9],
+            [7, 5, 3, 11, 10, 8, 2, 9],
+            [7, 5, 3, 11, 10, 8, 9, 2],
+            [7, 5, 11, 2, 3, 8, 9, 10],
+            [7, 5, 11, 2, 3, 8, 10, 9],
+            [7, 5, 11, 2, 3, 10, 8, 9],
+            [7, 5, 11, 3, 2, 8, 9, 10],
+            [7, 5, 11, 3, 2, 8, 10, 9],
+            [7, 5, 11, 3, 2, 10, 8, 9],
+            [7, 5, 11, 3, 8, 2, 9, 10],
+            [7, 5, 11, 3, 8, 2, 10, 9],
+            [7, 5, 11, 3, 8, 9, 2, 10],
+            [7, 5, 11, 3, 8, 9, 10, 2],
+            [7, 5, 11, 3, 8, 10, 2, 9],
+            [7, 5, 11, 3, 8, 10, 9, 2],
+            [7, 5, 11, 3, 10, 2, 8, 9],
+            [7, 5, 11, 3, 10, 8, 2, 9],
+            [7, 5, 11, 3, 10, 8, 9, 2],
+        ]
+
+        self.assertIn(list(graph.topological_sort()), valid_solutions)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_delayable_split.py

@@ -0,0 +1,93 @@
+# Copyright 2024 Akretion (http://www.akretion.com).
+# @author Florian Mounier <florian.mounier@akretion.com>
+# License AGPL-3.0 or later (http://www.gnu.org/licenses/agpl).
+
+from odoo.tests import common
+
+from odoo.addons.queue_job.delay import Delayable
+
+
+class TestDelayableSplit(common.BaseCase):
+    def setUp(self):
+        super().setUp()
+
+        class FakeRecordSet(list):
+            def __init__(self, *args, **kwargs):
+                super().__init__(*args, **kwargs)
+                self._name = "recordset"
+
+            def __getitem__(self, key):
+                if isinstance(key, slice):
+                    return FakeRecordSet(super().__getitem__(key))
+                return super().__getitem__(key)
+
+            def method(self, arg, kwarg=None):
+                """Method to be called"""
+                return arg, kwarg
+
+        self.FakeRecordSet = FakeRecordSet
+
+    def test_delayable_split_no_method_call_beforehand(self):
+        dl = Delayable(self.FakeRecordSet(range(20)))
+        with self.assertRaises(ValueError):
+            dl.split(3)
+
+    def test_delayable_split_10_3(self):
+        dl = Delayable(self.FakeRecordSet(range(10)))
+        dl.method("arg", kwarg="kwarg")
+        group = dl.split(3)
+        self.assertEqual(len(group._delayables), 4)
+        delayables = sorted(list(group._delayables), key=lambda x: x.description)
+        self.assertEqual(delayables[0].recordset, self.FakeRecordSet([0, 1, 2]))
+        self.assertEqual(delayables[1].recordset, self.FakeRecordSet([3, 4, 5]))
+        self.assertEqual(delayables[2].recordset, self.FakeRecordSet([6, 7, 8]))
+        self.assertEqual(delayables[3].recordset, self.FakeRecordSet([9]))
+        self.assertEqual(delayables[0].description, "Method to be called (split 1/4)")
+        self.assertEqual(delayables[1].description, "Method to be called (split 2/4)")
+        self.assertEqual(delayables[2].description, "Method to be called (split 3/4)")
+        self.assertEqual(delayables[3].description, "Method to be called (split 4/4)")
+        self.assertNotEqual(delayables[0]._job_method, dl._job_method)
+        self.assertNotEqual(delayables[1]._job_method, dl._job_method)
+        self.assertNotEqual(delayables[2]._job_method, dl._job_method)
+        self.assertNotEqual(delayables[3]._job_method, dl._job_method)
+        self.assertEqual(delayables[0]._job_method.__name__, dl._job_method.__name__)
+        self.assertEqual(delayables[1]._job_method.__name__, dl._job_method.__name__)
+        self.assertEqual(delayables[2]._job_method.__name__, dl._job_method.__name__)
+        self.assertEqual(delayables[3]._job_method.__name__, dl._job_method.__name__)
+        self.assertEqual(delayables[0]._job_args, ("arg",))
+        self.assertEqual(delayables[1]._job_args, ("arg",))
+        self.assertEqual(delayables[2]._job_args, ("arg",))
+        self.assertEqual(delayables[3]._job_args, ("arg",))
+        self.assertEqual(delayables[0]._job_kwargs, {"kwarg": "kwarg"})
+        self.assertEqual(delayables[1]._job_kwargs, {"kwarg": "kwarg"})
+        self.assertEqual(delayables[2]._job_kwargs, {"kwarg": "kwarg"})
+        self.assertEqual(delayables[3]._job_kwargs, {"kwarg": "kwarg"})
+
+    def test_delayable_split_10_5(self):
+        dl = Delayable(self.FakeRecordSet(range(10)))
+        dl.method("arg", kwarg="kwarg")
+        group = dl.split(5)
+        self.assertEqual(len(group._delayables), 2)
+        delayables = sorted(list(group._delayables), key=lambda x: x.description)
+        self.assertEqual(delayables[0].recordset, self.FakeRecordSet([0, 1, 2, 3, 4]))
+        self.assertEqual(delayables[1].recordset, self.FakeRecordSet([5, 6, 7, 8, 9]))
+        self.assertEqual(delayables[0].description, "Method to be called (split 1/2)")
+        self.assertEqual(delayables[1].description, "Method to be called (split 2/2)")
+
+    def test_delayable_split_10_10(self):
+        dl = Delayable(self.FakeRecordSet(range(10)))
+        dl.method("arg", kwarg="kwarg")
+        group = dl.split(10)
+        self.assertEqual(len(group._delayables), 1)
+        delayables = sorted(list(group._delayables), key=lambda x: x.description)
+        self.assertEqual(delayables[0].recordset, self.FakeRecordSet(range(10)))
+        self.assertEqual(delayables[0].description, "Method to be called (split 1/1)")
+
+    def test_delayable_split_10_20(self):
+        dl = Delayable(self.FakeRecordSet(range(10)))
+        dl.method("arg", kwarg="kwarg")
+        group = dl.split(20)
+        self.assertEqual(len(group._delayables), 1)
+        delayables = sorted(list(group._delayables), key=lambda x: x.description)
+        self.assertEqual(delayables[0].recordset, self.FakeRecordSet(range(10)))
+        self.assertEqual(delayables[0].description, "Method to be called (split 1/1)")

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_json_field.py

@@ -0,0 +1,154 @@
+# copyright 2016 Camptocamp
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import json
+from datetime import date, datetime
+
+from lxml import etree
+
+from odoo.tests import common
+
+# pylint: disable=odoo-addons-relative-import
+# we are testing, we want to test as we were an external consumer of the API
+from odoo.addons.queue_job.fields import JobDecoder, JobEncoder
+
+
+class TestJson(common.TransactionCase):
+    def test_encoder_recordset(self):
+        demo_user = self.env.ref("base.user_demo")
+        context = demo_user.context_get()
+        partner = self.env(user=demo_user, context=context).ref("base.main_partner")
+        value = partner
+        value_json = json.dumps(value, cls=JobEncoder)
+        expected_context = context.copy()
+        expected_context.pop("uid")
+        expected = {
+            "uid": demo_user.id,
+            "_type": "odoo_recordset",
+            "model": "res.partner",
+            "ids": [partner.id],
+            "su": False,
+            "context": expected_context,
+        }
+        self.assertEqual(json.loads(value_json), expected)
+
+    def test_encoder_recordset_list(self):
+        demo_user = self.env.ref("base.user_demo")
+        context = demo_user.context_get()
+        partner = self.env(user=demo_user, context=context).ref("base.main_partner")
+        value = ["a", 1, partner]
+        value_json = json.dumps(value, cls=JobEncoder)
+        expected_context = context.copy()
+        expected_context.pop("uid")
+        expected = [
+            "a",
+            1,
+            {
+                "uid": demo_user.id,
+                "_type": "odoo_recordset",
+                "model": "res.partner",
+                "ids": [partner.id],
+                "su": False,
+                "context": expected_context,
+            },
+        ]
+        self.assertEqual(json.loads(value_json), expected)
+
+    def test_decoder_recordset(self):
+        demo_user = self.env.ref("base.user_demo")
+        context = demo_user.context_get()
+        partner = self.env(user=demo_user).ref("base.main_partner")
+        value_json = (
+            '{"_type": "odoo_recordset",'
+            '"model": "res.partner",'
+            '"su": false,'
+            '"ids": [%s],"uid": %s, '
+            '"context": {"tz": "%s", "lang": "%s"}}'
+            % (partner.id, demo_user.id, context["tz"], context["lang"])
+        )
+        expected = partner
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        self.assertEqual(value, expected)
+        self.assertEqual(demo_user, expected.env.user)
+
+    def test_decoder_recordset_list(self):
+        demo_user = self.env.ref("base.user_demo")
+        context = demo_user.context_get()
+        partner = self.env(user=demo_user).ref("base.main_partner")
+        value_json = (
+            '["a", 1, '
+            '{"_type": "odoo_recordset",'
+            '"model": "res.partner",'
+            '"su": false,'
+            '"ids": [%s],"uid": %s, '
+            '"context": {"tz": "%s", "lang": "%s"}}]'
+            % (partner.id, demo_user.id, context["tz"], context["lang"])
+        )
+        expected = ["a", 1, partner]
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        self.assertEqual(value, expected)
+        self.assertEqual(demo_user, expected[2].env.user)
+
+    def test_decoder_recordset_list_without_user(self):
+        value_json = (
+            '["a", 1, {"_type": "odoo_recordset",' '"model": "res.users", "ids": [1]}]'
+        )
+        expected = ["a", 1, self.env.ref("base.user_root")]
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        self.assertEqual(value, expected)
+
+    def test_encoder_datetime(self):
+        value = ["a", 1, datetime(2017, 4, 19, 8, 48, 50, 1)]
+        value_json = json.dumps(value, cls=JobEncoder)
+        expected = [
+            "a",
+            1,
+            {"_type": "datetime_isoformat", "value": "2017-04-19T08:48:50.000001"},
+        ]
+        self.assertEqual(json.loads(value_json), expected)
+
+    def test_decoder_datetime(self):
+        value_json = (
+            '["a", 1, {"_type": "datetime_isoformat",'
+            '"value": "2017-04-19T08:48:50.000001"}]'
+        )
+        expected = ["a", 1, datetime(2017, 4, 19, 8, 48, 50, 1)]
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        self.assertEqual(value, expected)
+
+    def test_encoder_date(self):
+        value = ["a", 1, date(2017, 4, 19)]
+        value_json = json.dumps(value, cls=JobEncoder)
+        expected = ["a", 1, {"_type": "date_isoformat", "value": "2017-04-19"}]
+        self.assertEqual(json.loads(value_json), expected)
+
+    def test_decoder_date(self):
+        value_json = '["a", 1, {"_type": "date_isoformat",' '"value": "2017-04-19"}]'
+        expected = ["a", 1, date(2017, 4, 19)]
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        self.assertEqual(value, expected)
+
+    def test_encoder_etree(self):
+        etree_el = etree.Element("root", attr="val")
+        etree_el.append(etree.Element("child", attr="val"))
+        value = ["a", 1, etree_el]
+        value_json = json.dumps(value, cls=JobEncoder)
+        expected = [
+            "a",
+            1,
+            {
+                "_type": "etree_element",
+                "value": '<root attr="val"><child attr="val"/></root>',
+            },
+        ]
+        self.assertEqual(json.loads(value_json), expected)
+
+    def test_decoder_etree(self):
+        value_json = '["a", 1, {"_type": "etree_element", "value": \
+        "<root attr=\\"val\\"><child attr=\\"val\\"/></root>"}]'
+        etree_el = etree.Element("root", attr="val")
+        etree_el.append(etree.Element("child", attr="val"))
+        expected = ["a", 1, etree.tostring(etree_el)]
+        value = json.loads(value_json, cls=JobDecoder, env=self.env)
+        value[2] = etree.tostring(value[2])
+        self.assertEqual(value, expected)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_model_job_channel.py

@@ -0,0 +1,59 @@
+# copyright 2018 Camptocamp
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from psycopg2 import IntegrityError
+
+import odoo
+from odoo.tests import common
+
+
+class TestJobChannel(common.TransactionCase):
+    def setUp(self):
+        super().setUp()
+        self.Channel = self.env["queue.job.channel"]
+        self.root_channel = self.Channel.search([("name", "=", "root")])
+
+    def test_channel_new(self):
+        channel = self.Channel.new()
+        self.assertFalse(channel.name)
+        self.assertFalse(channel.complete_name)
+
+    def test_channel_create(self):
+        channel = self.Channel.create(
+            {"name": "test", "parent_id": self.root_channel.id}
+        )
+        self.assertEqual(channel.name, "test")
+        self.assertEqual(channel.complete_name, "root.test")
+        channel2 = self.Channel.create({"name": "test", "parent_id": channel.id})
+        self.assertEqual(channel2.name, "test")
+        self.assertEqual(channel2.complete_name, "root.test.test")
+
+    @odoo.tools.mute_logger("odoo.sql_db")
+    def test_channel_complete_name_uniq(self):
+        channel = self.Channel.create(
+            {"name": "test", "parent_id": self.root_channel.id}
+        )
+        self.assertEqual(channel.name, "test")
+        self.assertEqual(channel.complete_name, "root.test")
+
+        self.Channel.create({"name": "test", "parent_id": self.root_channel.id})
+
+        # Flush process all the pending recomputations (or at least the
+        # given field and flush the pending updates to the database.
+        # It is normally called on commit.
+
+        # The context manager 'with self.assertRaises(IntegrityError)' purposefully
+        # not uses here due to its 'flush_all()' method inside it and exception raises
+        # before the line 'self.env.flush_all()'. So, we are expecting an IntegrityError.
+        try:
+            self.env.flush_all()
+        except IntegrityError as ex:
+            self.assertIn("queue_job_channel_name_uniq", ex.pgerror)
+        else:
+            self.assertEqual(True, False)
+
+    def test_channel_name_get(self):
+        channel = self.Channel.create(
+            {"name": "test", "parent_id": self.root_channel.id}
+        )
+        self.assertEqual(channel.name_get(), [(channel.id, "root.test")])

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_model_job_function.py

@@ -0,0 +1,57 @@
+# copyright 2020 Camptocamp
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import exceptions
+from odoo.tests import common
+
+
+class TestJobFunction(common.TransactionCase):
+    def test_function_name_compute(self):
+        function = self.env["queue.job.function"].create(
+            {"model_id": self.env.ref("base.model_res_users").id, "method": "read"}
+        )
+        self.assertEqual(function.name, "<res.users>.read")
+
+    def test_function_name_inverse(self):
+        function = self.env["queue.job.function"].create({"name": "<res.users>.read"})
+        self.assertEqual(function.model_id.model, "res.users")
+        self.assertEqual(function.method, "read")
+
+    def test_function_name_inverse_invalid_regex(self):
+        with self.assertRaises(exceptions.UserError):
+            self.env["queue.job.function"].create({"name": "<res.users.read"})
+
+    def test_function_name_inverse_model_not_found(self):
+        with self.assertRaises(exceptions.UserError):
+            self.env["queue.job.function"].create(
+                {"name": "<this.model.does.not.exist>.read"}
+            )
+
+    def test_function_job_config(self):
+        channel = self.env["queue.job.channel"].create(
+            {"name": "foo", "parent_id": self.env.ref("queue_job.channel_root").id}
+        )
+        job_function = self.env["queue.job.function"].create(
+            {
+                "model_id": self.env.ref("base.model_res_users").id,
+                "method": "read",
+                "channel_id": channel.id,
+                "edit_retry_pattern": "{1: 2, 3: 4}",
+                "edit_related_action": (
+                    '{"enable": True,'
+                    ' "func_name": "related_action_foo",'
+                    ' "kwargs": {"b": 1}}'
+                ),
+            }
+        )
+        self.assertEqual(
+            self.env["queue.job.function"].job_config("<res.users>.read"),
+            self.env["queue.job.function"].JobConfig(
+                channel="root.foo",
+                retry_pattern={1: 2, 3: 4},
+                related_action_enable=True,
+                related_action_func_name="related_action_foo",
+                related_action_kwargs={"b": 1},
+                job_function_id=job_function.id,
+            ),
+        )

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_queue_job_protected_write.py

@@ -0,0 +1,25 @@
+# copyright 2020 Camptocamp
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import exceptions
+from odoo.tests import common
+
+
+class TestJobWriteProtected(common.TransactionCase):
+    def test_create_error(self):
+        with self.assertRaises(exceptions.AccessError):
+            self.env["queue.job"].create(
+                {"uuid": "test", "model_name": "res.partner", "method_name": "write"}
+            )
+
+    def test_write_protected_field_error(self):
+        job_ = self.env["res.partner"].with_delay().create({"name": "test"})
+        db_job = job_.db_record()
+        with self.assertRaises(exceptions.AccessError):
+            db_job.method_name = "unlink"
+
+    def test_write_allow_no_protected_field_error(self):
+        job_ = self.env["res.partner"].with_delay().create({"name": "test"})
+        db_job = job_.db_record()
+        db_job.priority = 30
+        self.assertEqual(db_job.priority, 30)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_requeue_dead_job.py

@@ -0,0 +1,133 @@
+# Copyright 2025 ACSONE SA/NV
+# License AGPL-3.0 or later (https://www.gnu.org/licenses/agpl).
+from contextlib import closing
+from datetime import datetime, timedelta
+
+from odoo.tests.common import TransactionCase
+
+from odoo.addons.queue_job.job import Job
+from odoo.addons.queue_job.jobrunner.runner import Database
+
+
+class TestRequeueDeadJob(TransactionCase):
+    def create_dummy_job(self, uuid):
+        """
+        Create dummy job for tests
+        """
+        return (
+            self.env["queue.job"]
+            .with_context(
+                _job_edit_sentinel=self.env["queue.job"].EDIT_SENTINEL,
+            )
+            .create(
+                {
+                    "uuid": uuid,
+                    "user_id": self.env.user.id,
+                    "state": "pending",
+                    "model_name": "queue.job",
+                    "method_name": "write",
+                }
+            )
+        )
+
+    def get_locks(self, uuid, cr=None):
+        """
+        Retrieve lock rows
+        """
+        if cr is None:
+            cr = self.env.cr
+
+        cr.execute(
+            """
+            SELECT
+                queue_job_id
+            FROM
+                queue_job_lock
+            WHERE
+                queue_job_id IN (
+                    SELECT
+                        id
+                    FROM
+                        queue_job
+                    WHERE
+                        uuid = %s
+                )
+            FOR UPDATE SKIP LOCKED
+            """,
+            [uuid],
+        )
+
+        return cr.fetchall()
+
+    def test_add_lock_record(self):
+        queue_job = self.create_dummy_job("test_add_lock")
+        job_obj = Job.load(self.env, queue_job.uuid)
+
+        job_obj.set_started()
+        self.assertEqual(job_obj.state, "started")
+
+        locks = self.get_locks(job_obj.uuid)
+
+        self.assertEqual(1, len(locks))
+
+    def test_lock(self):
+        queue_job = self.create_dummy_job("test_lock")
+        job_obj = Job.load(self.env, queue_job.uuid)
+
+        job_obj.set_started()
+        job_obj.store()
+
+        locks = self.get_locks(job_obj.uuid)
+
+        self.assertEqual(1, len(locks))
+
+        # commit to update queue_job records in DB
+        self.env.cr.commit()  # pylint: disable=E8102
+
+        job_obj.lock()
+
+        with closing(self.env.registry.cursor()) as new_cr:
+            locks = self.get_locks(job_obj.uuid, new_cr)
+
+            # Row should be locked
+            self.assertEqual(0, len(locks))
+
+        # clean up
+        queue_job.unlink()
+
+        self.env.cr.commit()  # pylint: disable=E8102
+
+        # because we committed the cursor, the savepoint of the test method is
+        # gone, and this would break TransactionCase cleanups
+        self.cr.execute("SAVEPOINT test_%d" % self._savepoint_id)
+
+    def test_requeue_dead_jobs(self):
+        uuid = "test_requeue_dead_jobs"
+
+        queue_job = self.create_dummy_job(uuid)
+        job_obj = Job.load(self.env, queue_job.uuid)
+
+        job_obj.set_enqueued()
+        # simulate enqueuing was in the past
+        job_obj.date_enqueued = datetime.now() - timedelta(minutes=1)
+        job_obj.set_started()
+
+        job_obj.store()
+        self.env.cr.commit()  # pylint: disable=E8102
+
+        # requeue dead jobs using current cursor
+        query = Database(self.env.cr.dbname)._query_requeue_dead_jobs()
+        self.env.cr.execute(query)
+
+        uuids_requeued = self.env.cr.fetchall()
+
+        self.assertEqual(len(uuids_requeued), 1)
+        self.assertEqual(uuids_requeued[0][0], uuid)
+
+        # clean up
+        queue_job.unlink()
+        self.env.cr.commit()  # pylint: disable=E8102
+
+        # because we committed the cursor, the savepoint of the test method is
+        # gone, and this would break TransactionCase cleanups
+        self.cr.execute("SAVEPOINT test_%d" % self._savepoint_id)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_runner_channels.py

@@ -0,0 +1,10 @@
+# Copyright 2015-2016 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+# pylint: disable=odoo-addons-relative-import
+# we are testing, we want to test as we were an external consumer of the API
+from odoo.addons.queue_job.jobrunner import channels
+
+from .common import load_doctests
+
+load_tests = load_doctests(channels)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_runner_runner.py

@@ -0,0 +1,10 @@
+# Copyright 2015-2016 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+# pylint: disable=odoo-addons-relative-import
+# we are testing, we want to test as we were an external consumer of the API
+from odoo.addons.queue_job.jobrunner import runner
+
+from .common import load_doctests
+
+load_tests = load_doctests(runner)

odoo-bringout-oca-queue-queue_job/queue_job/tests/test_wizards.py

@@ -0,0 +1,48 @@
+# license lgpl-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+from odoo.tests import common
+
+
+class TestWizards(common.TransactionCase):
+    def setUp(self):
+        super().setUp()
+        self.job = (
+            self.env["queue.job"]
+            .with_context(
+                _job_edit_sentinel=self.env["queue.job"].EDIT_SENTINEL,
+            )
+            .create(
+                {
+                    "uuid": "test",
+                    "user_id": self.env.user.id,
+                    "state": "failed",
+                    "model_name": "queue.job",
+                    "method_name": "write",
+                    "args": (),
+                }
+            )
+        )
+
+    def _wizard(self, model_name):
+        return (
+            self.env[model_name]
+            .with_context(
+                active_model=self.job._name,
+                active_ids=self.job.ids,
+            )
+            .create({})
+        )
+
+    def test_01_requeue(self):
+        wizard = self._wizard("queue.requeue.job")
+        wizard.requeue()
+        self.assertEqual(self.job.state, "pending")
+
+    def test_02_cancel(self):
+        wizard = self._wizard("queue.jobs.to.cancelled")
+        wizard.set_cancelled()
+        self.assertEqual(self.job.state, "cancelled")
+
+    def test_03_done(self):
+        wizard = self._wizard("queue.jobs.to.done")
+        wizard.set_done()
+        self.assertEqual(self.job.state, "done")

odoo-bringout-oca-queue-queue_job/queue_job/utils.py

@@ -0,0 +1,40 @@
+# Copyright 2023 Camptocamp
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+import logging
+import os
+
+_logger = logging.getLogger(__name__)
+
+
+def must_run_without_delay(env):
+    """Retrun true if jobs have to run immediately.
+
+    :param env: `odoo.api.Environment` instance
+    """
+    # TODO: drop in v17
+    if os.getenv("TEST_QUEUE_JOB_NO_DELAY"):
+        _logger.warning(
+            "`TEST_QUEUE_JOB_NO_DELAY`  env var found. NO JOB scheduled. "
+            "Note that this key is deprecated: please use `QUEUE_JOB__NO_DELAY`"
+        )
+        return True
+
+    if os.getenv("QUEUE_JOB__NO_DELAY"):
+        _logger.warning("`QUEUE_JOB__NO_DELAY` env var found. NO JOB scheduled.")
+        return True
+
+    # TODO: drop in v17
+    deprecated_keys = ("_job_force_sync", "test_queue_job_no_delay")
+    for key in deprecated_keys:
+        if env.context.get(key):
+            _logger.warning(
+                "`%s` ctx key found. NO JOB scheduled. "
+                "Note that this key is deprecated: please use `queue_job__no_delay`",
+                key,
+            )
+            return True
+
+    if env.context.get("queue_job__no_delay"):
+        _logger.info("`queue_job__no_delay` ctx key found. NO JOB scheduled.")
+        return True

odoo-bringout-oca-queue-queue_job/queue_job/views/queue_job_channel_views.xml

@@ -0,0 +1,58 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_queue_job_channel_form" model="ir.ui.view">
+        <field name="name">queue.job.channel.form</field>
+        <field name="model">queue.job.channel</field>
+        <field name="arch" type="xml">
+            <form string="Channels">
+                <group>
+                    <field
+                        name="name"
+                        attrs="{'required': [('name', '!=', 'root')], 'readonly': [('name', '=', 'root')]}"
+                    />
+                    <field
+                        name="parent_id"
+                        attrs="{'required': [('name', '!=', 'root')], 'readonly': [('name', '=', 'root')]}"
+                    />
+                    <field name="complete_name" />
+                    <field name="removal_interval" />
+                </group>
+                <group>
+                    <field name="job_function_ids" widget="many2many_tags" />
+                </group>
+            </form>
+        </field>
+    </record>
+
+    <record id="view_queue_job_channel_tree" model="ir.ui.view">
+        <field name="name">queue.job.channel.tree</field>
+        <field name="model">queue.job.channel</field>
+        <field name="arch" type="xml">
+            <tree>
+                <field name="complete_name" />
+            </tree>
+        </field>
+    </record>
+
+    <record id="view_queue_job_channel_search" model="ir.ui.view">
+        <field name="name">queue.job.channel.search</field>
+        <field name="model">queue.job.channel</field>
+        <field name="arch" type="xml">
+            <search string="Channels">
+                <field name="name" />
+                <field name="complete_name" />
+                <field name="parent_id" />
+            </search>
+        </field>
+    </record>
+
+    <record id="action_queue_job_channel" model="ir.actions.act_window">
+        <field name="name">Channels</field>
+        <field name="res_model">queue.job.channel</field>
+        <field name="view_mode">tree,form</field>
+        <field name="context">{}</field>
+        <field name="view_id" ref="view_queue_job_channel_tree" />
+    </record>
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/views/queue_job_function_views.xml

@@ -0,0 +1,58 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_queue_job_function_form" model="ir.ui.view">
+        <field name="name">queue.job.function.form</field>
+        <field name="model">queue.job.function</field>
+        <field name="arch" type="xml">
+            <form string="Job Functions">
+                <group>
+                    <field name="name" readonly="1" />
+                    <field name="model_id" required="1" />
+                    <field name="method" required="1" />
+                    <field name="channel_id" />
+                    <field name="edit_retry_pattern" widget="ace" />
+                    <field name="edit_related_action" widget="ace" />
+                </group>
+            </form>
+        </field>
+    </record>
+
+    <record id="view_queue_job_function_tree" model="ir.ui.view">
+        <field name="name">queue.job.function.tree</field>
+        <field name="model">queue.job.function</field>
+        <field name="arch" type="xml">
+            <tree>
+                <field name="name" />
+                <field name="channel_id" />
+            </tree>
+        </field>
+    </record>
+
+    <record id="view_queue_job_function_search" model="ir.ui.view">
+        <field name="name">queue.job.function.search</field>
+        <field name="model">queue.job.function</field>
+        <field name="arch" type="xml">
+            <search string="Job Functions">
+                <field name="name" />
+                <field name="channel_id" />
+                <group expand="0" string="Group By">
+                    <filter
+                        name="group_by_channel"
+                        string="Channel"
+                        context="{'group_by': 'channel_id'}"
+                    />
+                </group>
+            </search>
+        </field>
+    </record>
+
+    <record id="action_queue_job_function" model="ir.actions.act_window">
+        <field name="name">Job Functions</field>
+        <field name="res_model">queue.job.function</field>
+        <field name="view_mode">tree,form</field>
+        <field name="context">{}</field>
+        <field name="view_id" ref="view_queue_job_function_tree" />
+    </record>
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/views/queue_job_menus.xml

@@ -0,0 +1,34 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <menuitem
+        id="menu_queue_job_root"
+        name="Job Queue"
+        web_icon="queue_job,static/description/icon.png"
+        groups="group_queue_job_manager"
+    />
+
+    <menuitem id="menu_queue" name="Queue" parent="menu_queue_job_root" />
+
+    <menuitem
+        id="menu_queue_job"
+        action="action_queue_job"
+        sequence="10"
+        parent="menu_queue"
+    />
+
+    <menuitem
+        id="menu_queue_job_channel"
+        action="action_queue_job_channel"
+        sequence="12"
+        parent="menu_queue"
+    />
+
+    <menuitem
+        id="menu_queue_job_function"
+        action="action_queue_job_function"
+        sequence="14"
+        parent="menu_queue"
+    />
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/views/queue_job_views.xml

@@ -0,0 +1,330 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_queue_job_form" model="ir.ui.view">
+        <field name="name">queue.job.form</field>
+        <field name="model">queue.job</field>
+        <field name="arch" type="xml">
+            <form string="Jobs" create="false" delete="false">
+                <header>
+                    <button
+                        name="requeue"
+                        states="failed"
+                        class="oe_highlight"
+                        string="Requeue Job"
+                        type="object"
+                        groups="queue_job.group_queue_job_manager"
+                    />
+                    <button
+                        name="button_done"
+                        states="wait_dependencies,pending,enqueued,failed"
+                        class="oe_highlight"
+                        string="Set to 'Done'"
+                        type="object"
+                        groups="queue_job.group_queue_job_manager"
+                    />
+                    <button
+                        name="button_cancelled"
+                        states="pending,enqueued,failed"
+                        class="oe_highlight"
+                        string="Cancel job"
+                        type="object"
+                        groups="queue_job.group_queue_job_manager"
+                    />
+                    <button name="open_related_action" string="Related" type="object" />
+                    <field
+                        name="state"
+                        widget="statusbar"
+                        statusbar_visible="wait_dependencies,pending,enqueued,started,done"
+                        statusbar_colors='{"failed":"red","done":"green","cancelled":"yellow"}'
+                    />
+                </header>
+                <sheet>
+                    <div class="oe_button_box" name="button_box">
+                        <button
+                            name="open_graph_jobs"
+                            type="object"
+                            class="oe_stat_button"
+                            icon="fa-sitemap"
+                            attrs="{'invisible':[('graph_uuid', '=', False)]}"
+                        >
+                            <field
+                                name="graph_jobs_count"
+                                widget="statinfo"
+                                string="Graph Jobs"
+                            />
+                        </button>
+                    </div>
+                    <h1>
+                        <field name="name" class="oe_inline" />
+                    </h1>
+                    <group>
+                        <field name="uuid" />
+                        <field name="graph_uuid" />
+                        <field name="func_string" groups="base.group_no_one" />
+                        <field name="job_function_id" />
+                        <field name="channel" />
+                    </group>
+                    <group>
+                        <group>
+                            <field name="priority" />
+                            <field name="eta" />
+                            <field
+                                name="company_id"
+                                groups="base.group_multi_company"
+                            />
+                            <field name="user_id" />
+                            <field name="worker_pid" groups="base.group_no_one" />
+                        </group>
+                        <group>
+                            <field name="date_created" />
+                            <field name="date_enqueued" groups="base.group_no_one" />
+                            <field name="date_started" />
+                            <field name="date_done" />
+                            <!-- Do not use float_time as it does not work properly -->
+                            <field name="exec_time" string="Time (s)" />
+                        </group>
+                    </group>
+                    <group colspan="4">
+                        <div colspan="2">
+                            <label for="retry" string="Current try / max. retries" />
+                            <field name="retry" class="oe_inline" /> /
+                            <field name="max_retries" class="oe_inline" />
+                            <br />
+                            <span
+                                class="oe_grey oe_inline"
+                            > If the max. retries is 0, the number of retries is infinite.</span>
+                        </div>
+                    </group>
+                    <notebook>
+                      <page
+                            name="results"
+                            string="Results"
+                            attrs="{'invisible': [('result', '=', False), ('exc_info', '=', False)]}"
+                        >
+                        <group
+                                name="result"
+                                string="Result"
+                                attrs="{'invisible': [('result', '=', False)]}"
+                            >
+                            <div id="result" colspan="2">
+                                <field nolabel="1" name="result" />
+                            </div>
+                        </group>
+                        <group
+                                name="exc_info"
+                                string="Exception Information"
+                                attrs="{'invisible': [('exc_info', '=', False)]}"
+                                colspan="4"
+                            >
+                            <div id="exc_name" colspan="4">
+                                <label for="exc_name" string="Exception:" />
+                                <field name="exc_name" class="oe_inline" />
+                            </div>
+                            <field colspan="2" nolabel="1" name="exc_info" />
+                        </group>
+                      </page>
+                      <page
+                            name="dependencies"
+                            string="Dependencies"
+                            attrs="{'invisible': [('graph_uuid', '=', False)]}"
+                        >
+                        <field
+                                nolabel="1"
+                                name="dependency_graph"
+                                widget="job_directed_graph"
+                            />
+                      </page>
+                    </notebook>
+                </sheet>
+                <div class="oe_chatter">
+                    <field name="message_follower_ids" widget="mail_followers" />
+                    <field name="activity_ids" widget="mail_activity" />
+                    <field name="message_ids" widget="mail_thread" />
+                </div>
+            </form>
+        </field>
+    </record>
+
+    <record id="view_queue_job_tree" model="ir.ui.view">
+        <field name="name">queue.job.tree</field>
+        <field name="model">queue.job</field>
+        <field name="arch" type="xml">
+            <tree
+                create="false"
+                delete="false"
+                decoration-danger="state == 'failed'"
+                decoration-muted="state == 'done'"
+            >
+                <field name="name" />
+                <field name="model_name" />
+                <field name="state" />
+                <field name="date_created" />
+                <field
+                    name="eta"
+                    widget="remaining_days"
+                    string="Remaining days to execute"
+                    optional="hide"
+                />
+                <field name="date_done" />
+                <field name="exec_time" />
+                <field name="exc_name" />
+                <field name="exc_message" />
+                <field name="uuid" />
+                <field name="channel" />
+                <field name="company_id" groups="base.group_multi_company" />
+            </tree>
+        </field>
+    </record>
+
+    <record id="view_queue_job_pivot" model="ir.ui.view">
+        <field name="name">queue.job.pivot</field>
+        <field name="model">queue.job</field>
+        <field name="arch" type="xml">
+            <pivot string="Jobs">
+                <field name="exec_time" type="measure" />
+                <field name="job_function_id" type="row" />
+                <field name="date_done" type="col" interval="week" />
+            </pivot>
+        </field>
+    </record>
+
+    <record id="view_queue_job_graph" model="ir.ui.view">
+        <field name="name">queue.job.graph</field>
+        <field name="model">queue.job</field>
+        <field name="arch" type="xml">
+            <graph string="Jobs">
+                <field name="job_function_id" type="row" />
+                <field name="exec_time" type="measure" />
+            </graph>
+        </field>
+    </record>
+
+    <record id="view_queue_job_search" model="ir.ui.view">
+        <field name="name">queue.job.search</field>
+        <field name="model">queue.job</field>
+        <field name="arch" type="xml">
+            <search string="Jobs">
+                <field name="uuid" />
+                <field name="graph_uuid" />
+                <field name="name" />
+                <field name="func_string" />
+                <field name="channel" />
+                <field name="job_function_id" />
+                <field name="model_name" />
+                <field name="exc_name" />
+                <field name="exc_message" />
+                <field name="exc_info" />
+                <field name="result" />
+                <field
+                    name="company_id"
+                    groups="base.group_multi_company"
+                    widget="selection"
+                />
+                <filter
+                    name="wait_dependencies"
+                    string="Wait Dependencies"
+                    domain="[('state', '=', 'wait_dependencies')]"
+                />
+                <filter
+                    name="pending"
+                    string="Pending"
+                    domain="[('state', '=', 'pending')]"
+                />
+                <filter
+                    name="enqueued"
+                    string="Enqueued"
+                    domain="[('state', '=', 'enqueued')]"
+                />
+                <filter
+                    name="started"
+                    string="Started"
+                    domain="[('state', '=', 'started')]"
+                />
+                <filter name="done" string="Done" domain="[('state', '=', 'done')]" />
+                <filter
+                    name="failed"
+                    string="Failed"
+                    domain="[('state', '=', 'failed')]"
+                />
+                <filter
+                    name="cancelled"
+                    string="Cancelled"
+                    domain="[('state', '=', 'cancelled')]"
+                />
+                <separator />
+                <filter
+                    name="last_24_hours"
+                    string="Last 24 hours"
+                    domain="[('date_created', '&gt;=', (context_today() - datetime.timedelta(days=1)).strftime('%Y-%m-%d'))]"
+                />
+                <filter
+                    name="last_7_days"
+                    string="Last 7 days"
+                    domain="[('date_created', '&gt;=', (context_today() - datetime.timedelta(days=7)).strftime('%Y-%m-%d'))]"
+                />
+                <filter
+                    name="last_30_days"
+                    string="Last 30 days"
+                    domain="[('date_created', '&gt;=', (context_today() - datetime.timedelta(days=30)).strftime('%Y-%m-%d'))]"
+                />
+                <group expand="0" string="Group By">
+                    <filter
+                        name="group_by_channel"
+                        string="Channel"
+                        context="{'group_by': 'channel'}"
+                    />
+                    <filter
+                        name="group_by_job_function_id"
+                        string="Job Function"
+                        context="{'group_by': 'job_function_id'}"
+                    />
+                    <filter
+                        name="group_by_state"
+                        string="State"
+                        context="{'group_by': 'state'}"
+                    />
+                    <filter
+                        name="group_by_model_name"
+                        string="Model"
+                        context="{'group_by': 'model_name'}"
+                    />
+                    <filter
+                        name="group_by_exc_name"
+                        string="Exception"
+                        context="{'group_by': 'exc_name'}"
+                    />
+                    <filter
+                        name="group_by_exc_message"
+                        string="Exception message"
+                        context="{'group_by': 'exc_message'}"
+                    />
+                    <filter
+                        name="group_by_graph"
+                        string="Graph"
+                        context="{'group_by': 'graph_uuid'}"
+                    />
+                    <filter
+                        name="group_by_date_created"
+                        string="Created date"
+                        context="{'group_by': 'date_created'}"
+                    />
+                </group>
+            </search>
+        </field>
+    </record>
+
+    <record id="action_queue_job" model="ir.actions.act_window">
+        <field name="name">Jobs</field>
+        <field name="res_model">queue.job</field>
+        <field name="view_mode">tree,form,pivot,graph</field>
+        <field name="context">{'search_default_wait_dependencies': 1,
+                               'search_default_pending': 1,
+                               'search_default_enqueued': 1,
+                               'search_default_started': 1,
+                               'search_default_failed': 1}</field>
+        <field name="view_id" ref="view_queue_job_tree" />
+        <field name="search_view_id" ref="view_queue_job_search" />
+    </record>
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/wizards/__init__.py

@@ -0,0 +1,3 @@
+from . import queue_requeue_job
+from . import queue_jobs_to_done
+from . import queue_jobs_to_cancelled

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_jobs_to_cancelled.py

@@ -0,0 +1,17 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import models
+
+
+class SetJobsToCancelled(models.TransientModel):
+    _inherit = "queue.requeue.job"
+    _name = "queue.jobs.to.cancelled"
+    _description = "Cancel all selected jobs"
+
+    def set_cancelled(self):
+        jobs = self.job_ids.filtered(
+            lambda x: x.state in ("pending", "failed", "enqueued")
+        )
+        jobs.button_cancelled()
+        return {"type": "ir.actions.act_window_close"}

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_jobs_to_cancelled_views.xml

@@ -0,0 +1,34 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_set_jobs_cancelled" model="ir.ui.view">
+        <field name="name">Cancel Jobs</field>
+        <field name="model">queue.jobs.to.cancelled</field>
+        <field name="arch" type="xml">
+            <form>
+                <group string="The selected jobs will be cancelled.">
+                    <field name="job_ids" nolabel="1" colspan="2" />
+                </group>
+                <footer>
+                    <button
+                        name="set_cancelled"
+                        string="Cancel jobs"
+                        type="object"
+                        class="oe_highlight"
+                    />
+                    <button string="Cancel" class="oe_link" special="cancel" />
+                </footer>
+            </form>
+        </field>
+    </record>
+
+    <record id="action_set_jobs_cancelled" model="ir.actions.act_window">
+        <field name="name">Cancel jobs</field>
+        <field name="res_model">queue.jobs.to.cancelled</field>
+        <field name="view_mode">form</field>
+        <field name="view_id" ref="view_set_jobs_cancelled" />
+        <field name="target">new</field>
+        <field name="binding_model_id" ref="queue_job.model_queue_job" />
+    </record>
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_jobs_to_done.py

@@ -0,0 +1,15 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import models
+
+
+class SetJobsToDone(models.TransientModel):
+    _inherit = "queue.requeue.job"
+    _name = "queue.jobs.to.done"
+    _description = "Set all selected jobs to done"
+
+    def set_done(self):
+        jobs = self.job_ids
+        jobs.button_done()
+        return {"type": "ir.actions.act_window_close"}

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_jobs_to_done_views.xml

@@ -0,0 +1,34 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_set_jobs_done" model="ir.ui.view">
+        <field name="name">Set Jobs to Done</field>
+        <field name="model">queue.jobs.to.done</field>
+        <field name="arch" type="xml">
+            <form string="Set jobs done">
+                <group string="The selected jobs will be set to done.">
+                    <field name="job_ids" nolabel="1" colspan="2" />
+                </group>
+                <footer>
+                    <button
+                        name="set_done"
+                        string="Set to done"
+                        type="object"
+                        class="oe_highlight"
+                    />
+                    <button string="Cancel" class="oe_link" special="cancel" />
+                </footer>
+            </form>
+        </field>
+    </record>
+
+    <record id="action_set_jobs_done" model="ir.actions.act_window">
+        <field name="name">Set jobs to done</field>
+        <field name="res_model">queue.jobs.to.done</field>
+        <field name="view_mode">form</field>
+        <field name="view_id" ref="view_set_jobs_done" />
+        <field name="target">new</field>
+        <field name="binding_model_id" ref="queue_job.model_queue_job" />
+    </record>
+
+</odoo>

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_requeue_job.py

@@ -0,0 +1,25 @@
+# Copyright 2013-2020 Camptocamp SA
+# License LGPL-3.0 or later (http://www.gnu.org/licenses/lgpl.html)
+
+from odoo import fields, models
+
+
+class QueueRequeueJob(models.TransientModel):
+    _name = "queue.requeue.job"
+    _description = "Wizard to requeue a selection of jobs"
+
+    def _default_job_ids(self):
+        res = False
+        context = self.env.context
+        if context.get("active_model") == "queue.job" and context.get("active_ids"):
+            res = context["active_ids"]
+        return res
+
+    job_ids = fields.Many2many(
+        comodel_name="queue.job", string="Jobs", default=lambda r: r._default_job_ids()
+    )
+
+    def requeue(self):
+        jobs = self.job_ids
+        jobs.requeue()
+        return {"type": "ir.actions.act_window_close"}

odoo-bringout-oca-queue-queue_job/queue_job/wizards/queue_requeue_job_views.xml

@@ -0,0 +1,34 @@
+<?xml version="1.0" encoding="utf-8" ?>
+<odoo>
+
+    <record id="view_requeue_job" model="ir.ui.view">
+        <field name="name">Requeue Jobs</field>
+        <field name="model">queue.requeue.job</field>
+        <field name="arch" type="xml">
+            <form string="Requeue Jobs">
+                <group string="The selected jobs will be requeued.">
+                    <field name="job_ids" nolabel="1" colspan="2" />
+                </group>
+                <footer>
+                    <button
+                        name="requeue"
+                        string="Requeue"
+                        type="object"
+                        class="oe_highlight"
+                    />
+                    <button string="Cancel" class="oe_link" special="cancel" />
+                </footer>
+            </form>
+        </field>
+    </record>
+
+    <record id="action_requeue_job" model="ir.actions.act_window">
+        <field name="name">Requeue Jobs</field>
+        <field name="res_model">queue.requeue.job</field>
+        <field name="view_mode">form</field>
+        <field name="view_id" ref="view_requeue_job" />
+        <field name="target">new</field>
+        <field name="binding_model_id" ref="queue_job.model_queue_job" />
+    </record>
+
+</odoo>